@layer mobile-priority, desktop;
@layer desktop {
/* Noto Color Emoji (Google, SIL OFL 1.1 — fonts/emoji/OFL.txt), формат COLRv1 — его рисует Chromium/Electron.
   Части грузятся по мере надобности. */
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-0.woff2) format('woff2'); unicode-range: U+1f1e6-1f1ff; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-1.woff2) format('woff2'); unicode-range: U+200d, U+2620, U+26a7, U+fe0f, U+1f308, U+1f38c, U+1f3c1, U+1f3f3-1f3f4, U+1f6a9, U+e0062-e0063, U+e0065, U+e0067, U+e006c, U+e006e, U+e0073-e0074, U+e0077, U+e007f; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-2.woff2) format('woff2'); unicode-range: U+23, U+2a, U+30-39, U+a9, U+ae, U+200d, U+203c, U+2049, U+20e3, U+2122, U+2139, U+2194-2199, U+21a9-21aa, U+23cf, U+23e9-23ef, U+23f8-23fa, U+24c2, U+25aa-25ab, U+25b6, U+25c0, U+25fb-25fe, U+2611, U+2622-2623, U+2626, U+262a, U+262e-262f, U+2638, U+2640, U+2642, U+2648-2653, U+2660, U+2663, U+2665-2666, U+2668, U+267b, U+267e-267f, U+2695, U+269b-269c, U+26a0, U+26a7, U+26aa-26ab, U+26ce, U+26d4, U+2705, U+2714, U+2716, U+271d, U+2721, U+2733-2734, U+2747, U+274c, U+274e, U+2753-2755, U+2757, U+2764, U+2795-2797, U+27a1, U+27b0, U+27bf, U+2934-2935, U+2b05-2b07, U+2b1b-2b1c, U+2b55, U+3030, U+303d, U+3297, U+3299, U+fe0f, U+1f170-1f171, U+1f17e-1f17f, U+1f18e, U+1f191-1f19a, U+1f201-1f202, U+1f21a, U+1f22f, U+1f232-1f23a, U+1f250-1f251, U+1f310, U+1f3a6, U+1f3b5-1f3b6, U+1f3bc, U+1f3e7, U+1f441, U+1f499-1f49c, U+1f49f-1f4a0, U+1f4ac-1f4ad, U+1f4b1-1f4b2, U+1f4b9, U+1f4db, U+1f4f2-1f4f6, U+1f500-1f507, U+1f515, U+1f518-1f524, U+1f52f-1f53d, U+1f549, U+1f54e, U+1f5a4, U+1f5e8, U+1f5ef, U+1f6ab, U+1f6ad-1f6b1, U+1f6b3, U+1f6b7-1f6bc, U+1f6be, U+1f6c2-1f6c5, U+1f6d0-1f6d1, U+1f6d7, U+1f6dc, U+1f7e0-1f7eb, U+1f7f0, U+1f90d-1f90e, U+1f9d1-1f9d2, U+1f9e1, U+1fa75-1fa77, U+1faaf; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-3.woff2) format('woff2'); unicode-range: U+200d, U+231a-231b, U+2328, U+23f0-23f3, U+2602, U+260e, U+2692, U+2694, U+2696-2697, U+2699, U+26b0-26b1, U+26cf, U+26d1, U+26d3, U+2702, U+2709, U+270f, U+2712, U+fe0f, U+1f302, U+1f321, U+1f392-1f393, U+1f3a9, U+1f3bd, U+1f3ee, U+1f3f7, U+1f3fa, U+1f451-1f462, U+1f484, U+1f489-1f48a, U+1f48c-1f48e, U+1f4a1, U+1f4a3, U+1f4a5, U+1f4b0, U+1f4b3-1f4b8, U+1f4bb-1f4da, U+1f4dc-1f4f1, U+1f4ff, U+1f508-1f514, U+1f516-1f517, U+1f526-1f529, U+1f52c-1f52e, U+1f550-1f567, U+1f56f-1f570, U+1f576, U+1f587, U+1f58a-1f58d, U+1f5a5, U+1f5a8, U+1f5b1-1f5b2, U+1f5c2-1f5c4, U+1f5d1-1f5d3, U+1f5dc-1f5de, U+1f5e1, U+1f5f3, U+1f6aa, U+1f6ac, U+1f6bd, U+1f6bf, U+1f6c1, U+1f6cb, U+1f6cd-1f6cf, U+1f6d2, U+1f6e0-1f6e1, U+1f6f0, U+1f97b-1f97f, U+1f9af, U+1f9ba, U+1f9e2-1f9e6, U+1f9ea-1f9ec, U+1f9ee-1f9f4, U+1f9f7-1f9ff, U+1fa71-1fa74, U+1fa79-1fa7b, U+1fa86, U+1fa8e-1fa8f, U+1fa91-1fa93, U+1fa96, U+1fa99-1faa0, U+1faa2-1faa7, U+1faaa-1faae; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-4.woff2) format('woff2'); unicode-range: U+265f, U+26bd-26be, U+26f3, U+26f8, U+fe0f, U+1f004, U+1f0cf, U+1f380-1f384, U+1f386-1f38b, U+1f38d-1f391, U+1f396-1f397, U+1f399-1f39b, U+1f39e-1f39f, U+1f3a3-1f3a5, U+1f3a7-1f3a9, U+1f3ab-1f3b4, U+1f3b7-1f3bb, U+1f3bd-1f3c0, U+1f3c5-1f3c6, U+1f3c8-1f3c9, U+1f3cf-1f3d3, U+1f3f8-1f3f9, U+1f47e, U+1f4e2, U+1f4f7-1f4fd, U+1f52b, U+1f579, U+1f58c-1f58d, U+1f5bc, U+1f6f7, U+1f6f9, U+1f6fc, U+1f93f, U+1f941, U+1f945, U+1f947-1f94f, U+1f9e7-1f9e9, U+1f9f5-1f9f6, U+1fa70-1fa71, U+1fa80-1fa81, U+1fa83-1fa85, U+1fa87-1fa8a, U+1fa94-1fa95, U+1fa97-1fa98, U+1faa1, U+1faa9, U+1fadf; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-5.woff2) format('woff2'); unicode-range: U+2693, U+26e9-26ea, U+26f1-26f2, U+26f4-26f5, U+26fa, U+26fd, U+2708, U+fe0f, U+1f301, U+1f303, U+1f306-1f307, U+1f309, U+1f310, U+1f3a0-1f3a2, U+1f3aa, U+1f3cd-1f3ce, U+1f3d5, U+1f3d7-1f3db, U+1f3df-1f3e6, U+1f3e8-1f3ed, U+1f3ef-1f3f0, U+1f488, U+1f492, U+1f4ba, U+1f54b-1f54d, U+1f5fa-1f5ff, U+1f680-1f6a2, U+1f6a4-1f6a8, U+1f6b2, U+1f6d1, U+1f6d5-1f6d6, U+1f6dd-1f6df, U+1f6e2-1f6e5, U+1f6e9, U+1f6eb-1f6ec, U+1f6f3-1f6f6, U+1f6f8, U+1f6fa-1f6fb, U+1f9bc-1f9bd, U+1f9ed, U+1f9f3, U+1fa7c; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-6.woff2) format('woff2'); unicode-range: U+200d, U+2615, U+fe0f, U+1f32d-1f330, U+1f336, U+1f33d, U+1f344-1f37f, U+1f382, U+1f52a, U+1f7e9, U+1f7eb, U+1f942-1f944, U+1f950-1f96f, U+1f99e, U+1f9aa, U+1f9c0-1f9cb, U+1fad0-1fadc; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-7.woff2) format('woff2'); unicode-range: U+200d, U+2600-2601, U+2603-2604, U+2614, U+2618, U+26a1, U+26c4-26c5, U+26c8, U+26f0, U+2728, U+2744, U+2b1b, U+2b50, U+fe0f, U+1f300, U+1f304-1f305, U+1f308, U+1f30a-1f30f, U+1f311-1f321, U+1f324-1f32c, U+1f331-1f335, U+1f337-1f33c, U+1f33e-1f344, U+1f3d4, U+1f3d6, U+1f3dc-1f3de, U+1f3f5, U+1f400-1f43f, U+1f490, U+1f4a7, U+1f4ae, U+1f525, U+1f54a, U+1f573, U+1f577-1f578, U+1f648-1f64a, U+1f6d8, U+1f940, U+1f980-1f9ae, U+1f9ba, U+1fa90, U+1faa8, U+1fab0-1fabf, U+1facd-1facf, U+1fae7; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-8.woff2) format('woff2'); unicode-range: U+200d, U+2640, U+2642, U+2695-2696, U+26f7, U+26f9, U+2708, U+2764, U+27a1, U+fe0f, U+1f33e, U+1f373, U+1f37c, U+1f384-1f385, U+1f393, U+1f3a4, U+1f3a8, U+1f3c2-1f3c4, U+1f3c7, U+1f3ca-1f3cc, U+1f3eb, U+1f3ed, U+1f3fb-1f3ff, U+1f430, U+1f466-1f469, U+1f46b-1f478, U+1f47c, U+1f481-1f483, U+1f486-1f487, U+1f48b, U+1f48f, U+1f491, U+1f4bb-1f4bc, U+1f527, U+1f52c, U+1f574-1f575, U+1f57a, U+1f645-1f647, U+1f64b, U+1f64d-1f64e, U+1f680, U+1f692, U+1f6a3, U+1f6b4-1f6b6, U+1f6c0, U+1f6cc, U+1f91d, U+1f926, U+1f930-1f931, U+1f934-1f93a, U+1f93c-1f93e, U+1f977, U+1f9af-1f9b3, U+1f9b8-1f9b9, U+1f9bc-1f9bd, U+1f9cc-1f9cf, U+1f9d1-1f9df, U+1fa70, U+1fa82, U+1fac3-1fac5, U+1fac8, U+1faef; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-9.woff2) format('woff2'); unicode-range: U+200d, U+2194-2195, U+2603, U+261d, U+2620, U+2639-263a, U+2665, U+26a1, U+26c4, U+270a-270d, U+2728, U+2763-2764, U+2b50, U+fe0f, U+1f31a-1f31f, U+1f32b, U+1f389-1f38a, U+1f3fb-1f3ff, U+1f440-1f450, U+1f463-1f465, U+1f479-1f47b, U+1f47d-1f480, U+1f485, U+1f48b-1f48c, U+1f493-1f49f, U+1f4a2, U+1f4a4-1f4a6, U+1f4a8-1f4ab, U+1f4af, U+1f525, U+1f573, U+1f590, U+1f595-1f596, U+1f5a4, U+1f5e3, U+1f600-1f644, U+1f648-1f64a, U+1f64c, U+1f64f, U+1f90c-1f925, U+1f927-1f92f, U+1f932-1f933, U+1f970-1f976, U+1f978-1f97a, U+1f9a0, U+1f9b4-1f9b7, U+1f9bb, U+1f9be-1f9bf, U+1f9d0, U+1f9e0-1f9e1, U+1fa75-1fa79, U+1fac0-1fac2, U+1fac6, U+1fae0-1fae6, U+1fae8-1faea, U+1faef-1fafa; }
@font-face { font-family: 'Noto Color Emoji'; font-display: swap; src: url(fonts/emoji/noto-emoji-10.woff2) format('woff2'); unicode-range: U+1f6d9, U+1fa8b-1fa8d, U+1facc, U+1fadd, U+1faeb; }

/* Flow — «жидкое стекло» (в духе Liquid Glass из iOS 26): полупрозрачные слои с размытием и усилением цвета
   того, что под ними, бликом по верхней кромке, светлой окантовкой и тенью объёма. Плитки парят над живым фоном. */
@font-face { font-family: Manrope; src: url(fonts/Manrope.ttf); font-weight: 200 800; font-display: swap; }
@font-face { font-family: Syne; src: url(fonts/Syne.ttf); font-weight: 400 800; font-display: swap; }

:root {
  /* палитра по умолчанию («Неон»); остальные — [data-theme] ниже, «Обложка» задаётся из JS */
  --c1: 34, 211, 238; --c2: 129, 140, 248; --c3: 232, 121, 249;
  --o1: #0ea5e9; --o2: #7c3aed; --o3: #db2777; --o4: #22d3ee;
  --bg: #050813;
  --text: #f3f6ff;
  --muted: #9aa8c7;
  --dim: #66728f;
  --a1: rgb(var(--c1));
  --a2: rgb(var(--c2));
  --a3: rgb(var(--c3));
  --grad: linear-gradient(120deg, rgb(var(--c1)) 0%, rgb(var(--c2)) 55%, rgb(var(--c3)) 100%);
  --on-accent: #0b1020;  /* акценты светлые — текст на кнопках тёмный, иначе не читается */
  --ok: #34d399;
  --warn: #fbbf24;
  --bad: #fb7185;
  /* стекло */
  --glass: linear-gradient(140deg, rgba(255, 255, 255, .13), rgba(255, 255, 255, .045) 45%, rgba(255, 255, 255, .07));
  --glass-strong: linear-gradient(140deg, rgba(255, 255, 255, .2), rgba(255, 255, 255, .07) 50%, rgba(255, 255, 255, .11));
  --glass-blur: blur(30px) saturate(185%);
  --edge-soft: rgba(255, 255, 255, .1);
  --shine: inset 0 1px 0 rgba(255, 255, 255, .42), inset 0 -1px 0 rgba(255, 255, 255, .06), inset 0 0 0 1px rgba(255, 255, 255, .04);
  --lift: 0 24px 60px rgba(0, 0, 0, .38), 0 2px 8px rgba(0, 0, 0, .2);
  --surface: rgba(255, 255, 255, .06);
  --surface-2: rgba(255, 255, 255, .11);
  --border: var(--edge-soft);
  --radius: 26px;
}

* { box-sizing: border-box; margin: 0; padding: 0; }
html, body { height: 100%; overflow: hidden; }
body {
  background: var(--bg); color: var(--text); font: 500 14px/1.45 Manrope, "Noto Color Emoji", "Segoe UI", sans-serif;
  -webkit-font-smoothing: antialiased; user-select: none;
}
input, button, textarea { font: inherit; color: inherit; }
button { cursor: pointer; border: 0; background: none; }
::-webkit-scrollbar { width: 10px; height: 10px; }
::-webkit-scrollbar-thumb { background: rgba(255, 255, 255, .14); border-radius: 10px; border: 3px solid transparent; background-clip: padding-box; }
svg.i { width: 18px; height: 18px; flex: none; }

/* ---------- живой фон: под стеклом должно быть что преломлять ---------- */
.orbs { position: fixed; inset: 0; z-index: 0; overflow: hidden; pointer-events: none; }
.orbs i { position: absolute; border-radius: 50%; filter: blur(90px); opacity: .55; animation: drift 26s ease-in-out infinite alternate; }
.orbs i:nth-child(1) { width: 640px; height: 640px; background: var(--o1); left: -160px; top: -200px; }
.orbs i:nth-child(2) { width: 560px; height: 560px; background: var(--o2); right: -120px; top: 18%; animation-duration: 32s; animation-delay: -8s; }
.orbs i:nth-child(3) { width: 520px; height: 520px; background: var(--o3); left: 28%; bottom: -260px; opacity: .42; animation-duration: 38s; animation-delay: -15s; }
.orbs i:nth-child(4) { width: 300px; height: 300px; background: var(--o4); left: 46%; top: 30%; opacity: .25; animation-duration: 22s; }
@keyframes drift { to { transform: translate(90px, 60px) scale(1.12); } }
/* плывут, только пока окно активно (класс ставит app.js): иначе окно перерисовывается без остановки и грузит видеокарту */
.orbs i { animation-play-state: paused; }
body.active.live-bg .orbs i { animation-play-state: running; }
.orbs::after { content: ""; position: absolute; inset: 0; background: radial-gradient(ellipse at center, transparent 40%, rgba(5, 8, 19, .55)); }

/* ---------- материал стекла ---------- */
.card, .sidebar, .player, .field, .btn, .tabs, .code-pill, .side-room {
  background: var(--glass); backdrop-filter: var(--glass-blur); -webkit-backdrop-filter: var(--glass-blur);
  border: 1px solid var(--edge-soft); box-shadow: var(--shine);
}
/* блик: светлая дуга по верхнему краю, как у стекла под источником света */
.card, .sidebar, .player, .side-room { position: relative; }
.card::before, .sidebar::before, .player::before, .side-room::before {
  content: ""; position: absolute; inset: 0; border-radius: inherit; pointer-events: none;
  background: radial-gradient(120% 60% at 20% -10%, rgba(255, 255, 255, .16), transparent 55%);
}
.card, .sidebar, .player { box-shadow: var(--shine), var(--lift); }

/* ---------- заголовок окна ---------- */
.titlebar {
  height: 40px; display: flex; align-items: center; -webkit-app-region: drag; padding-left: 18px;
  position: relative; z-index: 50; background: transparent;
}
.titlebar .brand { font: 800 15px Syne; letter-spacing: -.03em; display: flex; align-items: center; gap: 8px; }
.titlebar .brand .dot { width: 10px; height: 10px; border-radius: 50%; background: var(--grad); box-shadow: 0 0 14px var(--a1); }
.titlebar .grow { flex: 1; }
.titlebar .net { font-size: 12px; color: var(--muted); margin-right: 12px; display: flex; align-items: center; gap: 6px; }
.titlebar .net::before { content: ""; width: 7px; height: 7px; border-radius: 50%; background: var(--ok); box-shadow: 0 0 8px var(--ok); }
.titlebar .net.off::before { background: var(--bad); box-shadow: 0 0 8px var(--bad); }
.winbtns { display: flex; -webkit-app-region: no-drag; height: 100%; gap: 2px; padding-right: 6px; align-items: center; }
.winbtns button { width: 40px; height: 30px; border-radius: 10px; display: grid; place-items: center; color: var(--muted); }
.winbtns button:hover { background: rgba(255, 255, 255, .1); color: var(--text); }
.winbtns button.close:hover { background: rgba(232, 17, 35, .85); color: #fff; }
.winbtns svg { width: 13px; height: 13px; }
/* Mac: слева родные «светофоры» системы, свои кнопки окна не нужны */
body.mac .titlebar { padding-left: 84px; }
body.mac .winbtns { display: none; }

/* ---------- каркас: плавающие стеклянные плитки ---------- */
#app { height: calc(100% - 40px); position: relative; z-index: 1; }
.shell { height: 100%; display: grid; grid-template-columns: 252px 1fr; grid-template-rows: 1fr auto; gap: 12px; padding: 0 12px 12px; }
.sidebar { grid-row: 1 / 2; padding: 22px 12px 12px; display: flex; flex-direction: column; gap: 4px; border-radius: 28px; z-index: 2; }
.logo {
  font: 800 34px Syne; letter-spacing: -.06em; text-transform: lowercase; padding: 0 14px 20px; position: relative; z-index: 1;
  background: var(--grad); -webkit-background-clip: text; color: transparent; filter: drop-shadow(0 4px 18px rgba(var(--c2), .45));
}
.nav { display: flex; align-items: center; gap: 12px; padding: 11px 14px; border-radius: 16px; color: var(--muted); font-weight: 650; position: relative; z-index: 1; transition: background .2s, color .2s; border: 1px solid transparent; }
.nav:hover { background: rgba(255, 255, 255, .07); color: var(--text); }
.nav.on { background: var(--glass-strong); color: var(--text); box-shadow: var(--shine), 0 6px 18px rgba(0, 0, 0, .2); border-color: var(--edge-soft); }
.nav.on svg { color: var(--a1); filter: drop-shadow(0 0 6px rgba(var(--c1), .6)); }
.side-room { margin-top: 14px; padding: 14px 16px; border-radius: 20px; cursor: pointer; overflow: hidden; z-index: 1;
  background: linear-gradient(135deg, rgba(var(--c1), .2), rgba(var(--c2), .14) 60%, rgba(var(--c3), .16)); border-color: rgba(255, 255, 255, .18); }
.side-room .lbl { font-size: 11px; text-transform: uppercase; letter-spacing: .1em; color: var(--muted); position: relative; }
.side-room .nm { font-weight: 750; margin-top: 2px; position: relative; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.eq { display: inline-flex; gap: 2px; align-items: flex-end; height: 12px; margin-right: 6px; }
/* значок «играет» неподвижный: прыгающие столбики перерисовывали окно каждый кадр */
.eq i { width: 3px; height: 7px; background: var(--a1); border-radius: 2px; }
.eq i:nth-child(2) { height: 12px; } .eq i:nth-child(3) { height: 9px; }
.num .eq { margin-right: 0; }
.sidebar .grow { flex: 1; }
#me { display: flex; align-items: center; gap: 10px; padding: 10px; border-radius: 18px; position: relative; z-index: 1; background: rgba(255, 255, 255, .05); border: 1px solid var(--edge-soft); }
#me .who { flex: 1; min-width: 0; }
#me .who b { display: block; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
#me .who span { font-size: 12px; color: var(--muted); }
.iconbtn { width: 36px; height: 36px; border-radius: 12px; display: grid; place-items: center; color: var(--muted); transition: background .15s, color .15s; }
.iconbtn:hover { background: rgba(255, 255, 255, .12); color: var(--text); }
.iconbtn.on { color: var(--a3); }

.main { overflow: hidden; position: relative; border-radius: 28px; }
.view { height: 100%; overflow-y: auto; padding: 30px 36px 36px; position: relative; z-index: 1; }

/* ---------- элементы ---------- */
.h1 { font: 800 32px Manrope; letter-spacing: -.03em; }
.sub { color: var(--muted); margin-top: 6px; }
.card { border-radius: var(--radius); padding: 22px; }
.card > * { position: relative; z-index: 1; }
.btn {
  display: inline-flex; align-items: center; justify-content: center; gap: 8px; height: 44px; padding: 0 20px;
  border-radius: 999px; font-weight: 750; transition: transform .1s, filter .2s, box-shadow .2s; white-space: nowrap;
}
.btn:hover { filter: brightness(1.18); }
.btn:active { transform: scale(.97); }
.btn.primary {
  background: linear-gradient(120deg, rgba(var(--c1), .85), rgba(var(--c2), .85) 55%, rgba(var(--c3), .85)); color: var(--on-accent);
  border-color: rgba(255, 255, 255, .35); box-shadow: var(--shine), 0 10px 30px rgba(var(--c2), .45);
}
.btn.ghost { background: rgba(255, 255, 255, .04); }
.btn.sm { height: 34px; padding: 0 14px; font-size: 13px; }
.btn:disabled { opacity: .5; pointer-events: none; }
.field {
  width: 100%; height: 46px; padding: 0 18px; border-radius: 999px; outline: none; user-select: text;
  background: linear-gradient(140deg, rgba(0, 0, 0, .22), rgba(255, 255, 255, .05)); transition: border-color .2s, box-shadow .2s;
}
.field:focus { border-color: rgba(var(--c1), .55); box-shadow: var(--shine), 0 0 0 4px rgba(var(--c1), .14); }
.field::placeholder { color: var(--dim); }
label.lbl { display: block; font-size: 12px; color: var(--muted); margin: 14px 4px 6px; font-weight: 650; }
.avatar {
  width: 34px; height: 34px; border-radius: 50%; display: grid; place-items: center; font-weight: 800; color: #fff;
  flex: none; font-size: 14px; position: relative; text-transform: uppercase; box-shadow: inset 0 1px 0 rgba(255, 255, 255, .45), 0 4px 12px rgba(0, 0, 0, .3);
}
.avatar.s { width: 22px; height: 22px; font-size: 10px; }
.avatar.ring::after { content: ""; position: absolute; inset: -3px; border-radius: 50%; border: 1.5px solid transparent; }
.avatar.ready::after { border-color: rgba(52, 211, 153, .7); box-shadow: 0 0 4px rgba(52, 211, 153, .3); }
.avatar.loading::after { border-color: var(--warn); animation: pulse 1s ease-in-out infinite; }
.avatar.error::after { border-color: var(--bad); }
@keyframes pulse { 50% { opacity: .3; } }
.empty { color: var(--muted); text-align: center; padding: 40px 20px; }
.empty svg { width: 40px; height: 40px; color: var(--dim); margin-bottom: 10px; }
.cover { background: rgba(255, 255, 255, .08) center/cover; border-radius: 12px; flex: none; box-shadow: inset 0 0 0 1px rgba(255, 255, 255, .1); }
/* пометки и счётчики — просто приглушённый текст, без рамки */
.tag { font-size: 12px; color: var(--muted); font-weight: 650; display: inline-flex; gap: 4px; align-items: center; white-space: nowrap; }
.tag svg { width: 12px; height: 12px; }

/* ---------- вход ---------- */
.auth { height: 100%; display: grid; place-items: center; position: relative; }
.auth-box { width: 430px; position: relative; z-index: 1; text-align: center; }
.auth-box .logo { font-size: 72px; padding: 0; }
.auth-box .tagline { color: var(--muted); margin: 2px 0 28px; font-size: 15px; }
.auth-box .card { text-align: left; padding: 26px; border-radius: 30px; }
.tabs { display: flex; border-radius: 999px; padding: 4px; margin-bottom: 6px; background: rgba(0, 0, 0, .18); position: relative; z-index: 1; }
.tabs button { flex: 1; height: 38px; border-radius: 999px; font-weight: 750; color: var(--muted); display: inline-flex; align-items: center; justify-content: center; gap: 6px; transition: background .2s, color .2s; }
.tabs button.on { background: var(--glass-strong); color: var(--text); box-shadow: var(--shine), 0 4px 14px rgba(0, 0, 0, .25); }
.err { color: var(--bad); font-size: 13px; margin-top: 12px; min-height: 18px; padding-left: 4px; }

/* ---------- главная ---------- */
.home-grid { display: grid; grid-template-columns: 1fr 1fr; gap: 16px; margin-top: 26px; }
.big-card { padding: 26px; overflow: hidden; }
.big-card h3 { font: 800 19px Manrope; margin-bottom: 6px; letter-spacing: -.02em; }
.big-card p { color: var(--muted); margin-bottom: 18px; }
.big-card .glow { position: absolute; width: 240px; height: 240px; border-radius: 50%; filter: blur(70px); opacity: .35; right: -70px; top: -70px; z-index: 0; }
.code-input { font: 800 26px Manrope; letter-spacing: .4em; text-align: center; text-transform: uppercase; height: 58px; }
.row { display: flex; gap: 10px; align-items: center; }
.section-title { font: 800 17px Manrope; margin: 34px 0 14px; letter-spacing: -.02em; }
.rooms { display: grid; grid-template-columns: repeat(auto-fill, minmax(240px, 1fr)); gap: 14px; }
.room-card { padding: 14px; cursor: pointer; transition: transform .2s, box-shadow .2s; display: flex; gap: 12px; align-items: center; border-radius: 22px; }
.room-card:hover { transform: translateY(-3px); box-shadow: var(--shine), 0 30px 60px rgba(0, 0, 0, .45); }
.room-card .cover { width: 54px; height: 54px; display: grid; place-items: center; color: var(--dim); border-radius: 14px; }
.room-card .t { font-weight: 750; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.room-card .m { font-size: 12px; color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.room-card .info { min-width: 0; flex: 1; }
.online { color: var(--ok); font-weight: 750; }

/* ---------- комната ---------- */
.room-bg { position: absolute; inset: -100px; background: center/cover; filter: blur(80px) saturate(1.6); opacity: .5; z-index: 0; transition: background-image .8s; }
/* верхняя строка — шапка и поиск — общая для обеих колонок: даже если шапка комнаты переносится в две строки,
   карточка трека слева и панель справа начинаются на одной линии */
.room { display: grid; grid-template-columns: minmax(0, 1fr) 380px; grid-template-rows: auto minmax(0, 1fr); gap: 14px 16px; height: 100%; padding: 22px 22px 18px; position: relative; z-index: 1; }
.room > .searchbox { align-self: start; }
.room-left { display: flex; flex-direction: column; min-height: 0; gap: 14px; }
.room-head { display: flex; align-items: center; gap: 8px; min-width: 0; min-height: 46px; flex-wrap: wrap; row-gap: 10px; }
/* пустой баннер не должен добавлять отступ — иначе карточка трека ниже «Мне нравится» справа */
#banner:empty { display: none; }
.room-head .code-pill { letter-spacing: .2em; padding-left: 14px; gap: 8px; }
/* всё в шапке одной высоты с кодом комнаты и «Волной» — и строка ровно на высоту поиска справа */
.room-head .btn.sm, .room-head .iconbtn { height: 38px; }
.room-head .iconbtn { width: 34px; }
.room-head .nm { font: 800 24px Manrope; letter-spacing: -.03em; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; flex: 1 1 auto; min-width: 150px; }
.code-pill { display: inline-flex; align-items: center; gap: 10px; height: 38px; padding: 0 8px 0 16px; border-radius: 999px; font: 800 15px Manrope; letter-spacing: .28em; cursor: pointer; flex: none; }
.code-pill:hover { border-color: rgba(var(--c1), .5); }
.code-pill svg { color: var(--muted); }
.members { display: flex; gap: 0; margin-left: auto; align-items: center; flex: none; }
/* аватарки внахлёст — чтобы участники помещались в одну строку с кнопками */
.members > .avatar + .avatar, .members > .avatar + .kickable, .members > .kickable + .avatar, .members > .kickable + .kickable { margin-left: -8px; }
.members > .avatar, .members > .kickable .avatar { box-shadow: 0 0 0 2px rgba(10, 10, 18, .55), 0 4px 12px rgba(0, 0, 0, .3); }
.members > .iconbtn, .members > .btn { margin-left: 6px; }
.now { display: flex; gap: 26px; align-items: flex-end; padding: 24px; border-radius: 30px; }
.now .cover { width: 210px; height: 210px; border-radius: 26px; box-shadow: 0 28px 60px rgba(0, 0, 0, .5), inset 0 0 0 1px rgba(255, 255, 255, .15); display: grid; place-items: center; color: var(--dim); }
.now .cover svg { width: 56px; height: 56px; }
.now .meta { min-width: 0; flex: 1; }
.now .lbl { font-size: 12px; text-transform: uppercase; letter-spacing: .14em; color: var(--a1); font-weight: 800; }
.now .title { font: 800 32px Manrope; letter-spacing: -.03em; margin: 8px 0 6px; line-height: 1.12; overflow: hidden; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
.now .artist { color: var(--muted); font-size: 16px; font-weight: 650; }
.now .by { display: inline-flex; gap: 8px; align-items: center; margin-top: 16px; font-size: 13px; color: var(--muted);
  padding: 4px 12px 4px 4px; border-radius: 999px; background: rgba(255, 255, 255, .07); border: 1px solid var(--edge-soft); }
.queue-wrap { flex: 1; min-height: 0; display: flex; flex-direction: column; padding: 18px 10px 10px 18px; border-radius: 28px; }
.queue-wrap .hd { display: flex; align-items: center; justify-content: space-between; padding-right: 10px; margin-bottom: 8px; }
.queue-wrap .hd b { font: 800 16px Manrope; letter-spacing: -.02em; }
.queue-wrap .hd-r { display: flex; align-items: center; gap: 6px; }
.queue-wrap .hd-r .iconbtn { width: 30px; height: 30px; }
.queue { overflow-y: auto; flex: 1; padding-right: 6px; }
.qrow { display: flex; align-items: center; gap: 12px; padding: 8px 10px; border-radius: 16px; transition: background .15s; }
.qrow:hover { background: rgba(255, 255, 255, .07); }
.qrow.cur { background: linear-gradient(90deg, rgba(var(--c1), .2), rgba(var(--c2), .12) 60%, rgba(var(--c3), .06)); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .18), inset 0 0 0 1px rgba(255, 255, 255, .08); }
.qrow.played { opacity: .45; }
.qrow .cover { width: 42px; height: 42px; border-radius: 10px; }
.qrow .tt { flex: 1; min-width: 0; }
.qrow .tt b { display: block; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; font-weight: 700; }
.qrow .tt span { font-size: 12px; color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; display: block; }
.qrow .dur { color: var(--muted); font-size: 12px; font-variant-numeric: tabular-nums; width: 40px; text-align: right; }
/* длинная очередь рисуется окном: подпись про сыгранные сверху и «Показать ещё» снизу */
.qmore { display: flex; align-items: center; justify-content: center; gap: 6px; width: 100%; padding: 8px 10px; color: var(--dim); font-size: 12px; }
.qmore svg { width: 14px; height: 14px; }
button.qmore { margin: 6px 0 4px; color: var(--muted); }
.qrow .acts { display: flex; gap: 2px; opacity: 0; width: 152px; justify-content: flex-end; transition: opacity .15s; }
.qrow:hover .acts { opacity: 1; }
.qrow .num { width: 22px; text-align: center; color: var(--dim); font-size: 12px; font-weight: 800; }
.room-right { display: flex; flex-direction: column; gap: 14px; min-height: 0; }
.searchbox { position: relative; }
.searchbox svg { position: absolute; left: 16px; top: 14px; color: var(--muted); z-index: 2; }
.searchbox .field { padding-left: 44px; }
.panel { flex: 1; min-height: 0; display: flex; flex-direction: column; padding: 8px; border-radius: 28px; }
.panel .tabs { margin: 4px 4px 8px; }
.list { overflow-y: auto; flex: 1; padding: 0 4px; }
.trow { display: flex; align-items: center; gap: 10px; padding: 7px 8px; border-radius: 14px; }
.trow:hover { background: rgba(255, 255, 255, .07); }
.trow .cover { width: 40px; height: 40px; border-radius: 10px; }
.trow .tt { flex: 1; min-width: 0; }
.trow .tt b { display: block; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; font-size: 13px; }
.trow .tt span { display: block; font-size: 12px; color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.chat { overflow-y: auto; flex: 1; padding: 4px 8px; display: flex; flex-direction: column; gap: 10px; user-select: text; }
.msg { display: flex; gap: 10px; }
.msg .bub { padding: 8px 12px; border-radius: 4px 18px 18px 18px; background: rgba(255, 255, 255, .08); border: 1px solid var(--edge-soft); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .12); }
.msg .bub b { font-size: 12px; }
.msg .bub p { word-break: break-word; }
.msg.sys { justify-content: center; color: rgba(255, 255, 255, .5); font-size: 11.5px; text-align: center; }
.msg.me { flex-direction: row-reverse; }
.msg.me .bub { border-radius: 18px 4px 18px 18px; background: linear-gradient(135deg, rgba(var(--c1), .22), rgba(var(--c2), .16)); border-color: rgba(var(--c1), .35); }
.msg.me .bub b { display: none; }  /* своё имя над своим же сообщением не нужно */
.chat-input { display: flex; gap: 8px; padding: 8px 4px 2px; }
.chat-input .btn { width: 46px; padding: 0; }
.banner {
  display: flex; align-items: center; gap: 12px; padding: 12px 16px; border-radius: 20px; color: #fde68a;
  background: linear-gradient(140deg, rgba(251, 191, 36, .16), rgba(251, 191, 36, .05)); border: 1px solid rgba(251, 191, 36, .3);
  backdrop-filter: var(--glass-blur); box-shadow: var(--shine);
}
.banner .grow { flex: 1; }

/* ---------- плеер: плавающая стеклянная капсула ---------- */
.player {
  grid-column: 1 / 3; height: 84px; display: grid; grid-template-columns: 300px 1fr 300px; align-items: center; gap: 24px;
  padding: 0 18px; border-radius: 30px; z-index: 5; background: var(--glass-strong);
}
.player > * { position: relative; z-index: 1; }
.player .np { display: flex; align-items: center; gap: 12px; min-width: 0; }
.player .np .cover { width: 54px; height: 54px; border-radius: 14px; }
.player .np .tt { min-width: 0; }
.player .np b { display: block; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.player .np span { font-size: 12px; color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; display: block; }
.controls { display: flex; flex-direction: column; align-items: center; gap: 6px; }
.controls .btns { display: flex; align-items: center; gap: 14px; }
.playbtn {
  width: 44px; height: 44px; border-radius: 50%; display: grid; place-items: center; color: var(--on-accent); transition: transform .1s;
  background: linear-gradient(140deg, rgba(var(--c1), .9), rgba(var(--c2), .9) 55%, rgba(var(--c3), .9));
  box-shadow: inset 0 1px 0 rgba(255, 255, 255, .55), 0 8px 26px rgba(var(--c2), .55); border: 1px solid rgba(255, 255, 255, .35);
}
.playbtn:hover { transform: scale(1.07); }
.playbtn svg { width: 20px; height: 20px; }
.progress { display: flex; align-items: center; gap: 10px; width: 100%; max-width: 620px; font-size: 11px; color: var(--muted); font-variant-numeric: tabular-nums; }
.bar { flex: 1; height: 6px; border-radius: 6px; background: rgba(255, 255, 255, .14); position: relative; cursor: pointer; box-shadow: inset 0 1px 2px rgba(0, 0, 0, .3); transition: height .15s; }
.bar:hover { height: 8px; }
.bar .fill { position: absolute; inset: 0 auto 0 0; border-radius: 6px; background: var(--grad); box-shadow: 0 0 12px rgba(var(--c2), .6); }
.player .right { display: flex; align-items: center; gap: 12px; justify-content: flex-end; }
.sync { font-size: 12px; color: var(--muted); display: flex; align-items: center; gap: 6px; white-space: nowrap; }
.sync::before { content: ""; width: 7px; height: 7px; border-radius: 50%; background: var(--dim); }
.sync.good::before { background: var(--ok); box-shadow: 0 0 8px var(--ok); }
.sync.meh::before { background: var(--warn); }
.sync.bad::before { background: var(--bad); }
input[type=range] { -webkit-appearance: none; appearance: none; height: 6px; border-radius: 6px; outline: none;
  background: linear-gradient(90deg, rgb(var(--c1)), rgb(var(--c2))) 0 / var(--p, 0%) 100% no-repeat, rgba(255, 255, 255, .16); }
input[type=range]::-webkit-slider-thumb { -webkit-appearance: none; width: 16px; height: 16px; border-radius: 50%; background: #fff; cursor: pointer; box-shadow: 0 2px 8px rgba(0, 0, 0, .4); }
.vol { width: 110px; }

/* ---------- избранное и настройки ---------- */
.fav-head { display: flex; align-items: flex-end; gap: 16px; }
.fav-head .grow { flex: 1; }
.fav-list { margin-top: 18px; }
.frow { display: grid; grid-template-columns: 30px 46px minmax(0, 2fr) minmax(0, 1.2fr) 60px 170px; gap: 14px; align-items: center; padding: 8px 12px; border-radius: 16px; position: relative; z-index: 1; }
.frow:hover { background: rgba(255, 255, 255, .07); }
.frow .n { color: var(--dim); text-align: center; font-weight: 800; font-size: 12px; }
.frow .cover { width: 46px; height: 46px; }
.frow b, .frow span { overflow: hidden; text-overflow: ellipsis; white-space: nowrap; display: block; }
.frow span { color: var(--muted); font-size: 12px; }
.frow .alb { color: var(--muted); font-size: 13px; }
.frow .d { color: var(--muted); font-size: 12px; text-align: right; font-variant-numeric: tabular-nums; }
.frow .acts { display: flex; gap: 4px; justify-content: flex-end; }
.settings { max-width: 740px; display: flex; flex-direction: column; gap: 14px; margin-top: 24px; }
.set-row { display: flex; align-items: center; gap: 16px; }
.set-row .txt { flex: 1; }
.set-row .txt b { display: block; font-size: 15px; }
.set-row .txt span { color: var(--muted); font-size: 13px; }
.service-ico { width: 46px; height: 46px; border-radius: 14px; display: grid; place-items: center; font: 800 18px Manrope; flex: none; box-shadow: inset 0 1px 0 rgba(255, 255, 255, .4); }
.lat-val { font: 800 20px Manrope; width: 110px; text-align: right; }
.services { display: grid; grid-template-columns: 1fr 1fr; gap: 12px; }
.service { display: flex; align-items: center; gap: 12px; padding: 14px; border-radius: 20px; background: rgba(255, 255, 255, .05); border: 1px solid var(--edge-soft); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1); }
.service .txt { flex: 1; min-width: 0; }
.service .txt b { display: block; }
.service .txt span { font-size: 12px; color: var(--muted); }

.spin { width: 16px; height: 16px; border-radius: 50%; border: 2px solid rgba(255, 255, 255, .2); border-top-color: #fff; animation: rot .7s linear infinite; }
@keyframes rot { to { transform: rotate(360deg); } }

/* ---------- палитры (Настройки → Оформление) ---------- */
:root { transition: none; }
.orbs i { transition: background 1.2s ease; }
[data-theme="graphite"] { --c1: 255, 196, 107; --c2: 251, 146, 60; --c3: 255, 228, 181; --o1: #44403c; --o2: #57534e; --o3: #92400e; --o4: #78716c; --bg: #0b0a09; --muted: #a8a29e; --dim: #78716c; --on-accent: #1c1206; }
[data-theme="mono"] { --c1: 255, 255, 255; --c2: 212, 212, 216; --c3: 161, 161, 170; --o1: #3f3f46; --o2: #52525b; --o3: #27272a; --o4: #71717a; --bg: #08080a; --muted: #a1a1aa; --dim: #71717a; --on-accent: #111; }
[data-theme="forest"] { --c1: 52, 211, 153; --c2: 163, 230, 53; --c3: 45, 212, 191; --o1: #065f46; --o2: #3f6212; --o3: #115e59; --o4: #10b981; --bg: #03100b; --muted: #9db8ab; --dim: #5f7a6d; --on-accent: #04130c; }
[data-theme="ocean"] { --c1: 56, 189, 248; --c2: 45, 212, 191; --c3: 129, 140, 248; --o1: #075985; --o2: #0f766e; --o3: #1e3a8a; --o4: #0ea5e9; --bg: #030a15; --muted: #94a9c2; --dim: #5d7189; --on-accent: #041018; }
[data-theme="sunset"] { --c1: 251, 113, 133; --c2: 251, 146, 60; --c3: 253, 186, 116; --o1: #9f1239; --o2: #c2410c; --o3: #7c2d12; --o4: #e11d48; --bg: #120609; --muted: #c4a59e; --dim: #8a6b65; --on-accent: #2a0b0f; }
[data-theme="cover"] { --bg: #070709; --muted: #b3b0ad; --dim: #7a7774; }

.themes { display: grid; grid-template-columns: repeat(4, 1fr); gap: 12px; margin-top: 16px; }
.theme {
  border-radius: 20px; padding: 12px; cursor: pointer; text-align: left; background: rgba(255, 255, 255, .05);
  border: 1px solid var(--edge-soft); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1); transition: transform .15s, border-color .15s;
}
.theme:hover { transform: translateY(-2px); }
.theme.on { border-color: rgba(var(--c1), .8); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .2), 0 0 0 3px rgba(var(--c1), .25); }
.theme .sw { height: 54px; border-radius: 14px; margin-bottom: 10px; box-shadow: inset 0 1px 0 rgba(255, 255, 255, .35), inset 0 0 0 1px rgba(255, 255, 255, .1); }
.theme b { display: block; font-size: 13px; }
.theme span { font-size: 11px; color: var(--muted); }

/* кнопка «Волна» и отметка треков, подобранных волной */
.wave-btn {
  display: inline-flex; align-items: center; gap: 8px; height: 38px; padding: 0 16px; border-radius: 999px; font-weight: 750; flex: none;
  background: var(--glass); backdrop-filter: var(--glass-blur); border: 1px solid rgba(var(--c1), .45); box-shadow: var(--shine); color: var(--text);
  transition: color .2s, box-shadow .2s, border-color .2s;
}
.wave-btn svg { color: var(--a1); }
.wave-btn:hover { border-color: rgba(var(--c1), .75); box-shadow: var(--shine), 0 0 16px rgba(var(--c1), .3); }
.wave-btn.on { color: var(--text); border-color: rgba(var(--c1), .7); box-shadow: var(--shine), 0 0 22px rgba(var(--c1), .45);
  background: linear-gradient(120deg, rgba(var(--c1), .35), rgba(var(--c2), .25)); }
.wave-btn.on svg { animation: wave-pulse 1.6s ease-in-out infinite; }
body:not(.active) .wave-btn.on svg { animation-play-state: paused; }
@keyframes wave-pulse { 50% { transform: translateX(2px); opacity: .7; } }
.avatar.wave-mark { background: linear-gradient(135deg, rgba(var(--c1), .9), rgba(var(--c2), .9)); }
.avatar.wave-mark svg { width: 12px; height: 12px; }

/* ---------- узкое и низкое окно (минимум 1040×680): ничего не налезает и не пропадает ---------- */
@media (max-width: 1280px) {
  .shell { grid-template-columns: 212px 1fr; }
  .logo { font-size: 30px; }
  .room { grid-template-columns: minmax(0, 1fr) 312px; gap: 12px; padding: 18px 16px 14px; }
  .room-head { gap: 8px; }
  .room-head .nm { font-size: 20px; min-width: 120px; }
  .code-pill { letter-spacing: .16em; padding-left: 12px; font-size: 14px; }
  .wave-btn { padding: 0 11px; }
  .wave-btn span { display: none; }
  .now { gap: 18px; padding: 18px; }
  .now .cover { width: 150px; height: 150px; border-radius: 20px; }
  .now .title { font-size: 24px; }
  .now .artist { font-size: 14px; }
  .qrow .acts { display: none; width: auto; opacity: 1; }
  .qrow:hover .acts { display: flex; }
  .qrow:hover .avatar.s { display: none; }
  .player { grid-template-columns: 230px 1fr 240px; gap: 14px; }
  .vol { width: 80px; }
  .home-grid { grid-template-columns: 1fr; }
  .frow { grid-template-columns: 30px 46px minmax(0, 1fr) 50px 160px; }
  .frow .alb { display: none; }
  .themes { grid-template-columns: repeat(3, 1fr); }
}
@media (max-height: 780px) {
  .now { padding: 16px; }
  .now .cover { width: 128px; height: 128px; }
  .now .title { font-size: 22px; -webkit-line-clamp: 1; }
  .now .by { margin-top: 10px; }
  .sidebar .logo { padding-bottom: 10px; }
  .view { padding: 24px 28px 28px; }
}

/* кнопка обновления в заголовке окна */
[hidden] { display: none !important; }  /* иначе display у классов перебивает атрибут hidden */
.update-btn {
  -webkit-app-region: no-drag; display: inline-flex; align-items: center; gap: 6px; height: 28px; padding: 0 12px; margin-right: 12px;
  border-radius: 999px; font-size: 12px; font-weight: 800; color: var(--on-accent);
  background: linear-gradient(120deg, rgba(var(--c1), .9), rgba(var(--c2), .9)); box-shadow: 0 0 18px rgba(var(--c1), .45), inset 0 1px 0 rgba(255, 255, 255, .4);
}
.update-btn svg { width: 14px; height: 14px; }
.update-btn .spin { width: 12px; height: 12px; }

/* подтверждение (удалить комнату, выгнать) */
.modal-bg { position: fixed; inset: 0; z-index: 50; display: grid; place-items: center; background: rgba(0, 0, 0, .45); backdrop-filter: blur(6px); animation: fade .15s ease; }
.modal { width: min(400px, calc(100vw - 32px)); padding: 22px; }
.modal p { margin: 0 0 18px; line-height: 1.5; }
.modal .row { display: flex; justify-content: flex-end; gap: 10px; }
.btn.danger { background: linear-gradient(120deg, #ef4444, #f97316); color: #fff; border-color: transparent; }
@keyframes fade { from { opacity: 0; } }
/* владелец: клик по аватарке — выгнать */
.kickable { position: relative; padding: 0; border: 0; background: none; cursor: pointer; border-radius: 50%; }
.kickable .i { position: absolute; inset: 0; margin: auto; width: 16px; height: 16px; color: #fff; opacity: 0; transition: opacity .15s; }
.kickable:hover .avatar { filter: brightness(.45) saturate(.6); }
.kickable:hover .i { opacity: 1; }
.panel > .hd { display: flex; align-items: center; gap: 8px; padding: 2px 4px 12px; }
.panel > .hd .i { width: 16px; height: 16px; }
.hd b.accent { color: var(--a1); }

/* админы: ник с красным неоновым свечением */
.admin-name { color: #ff4d5e !important; text-shadow: 0 0 4px rgba(255, 60, 80, .9), 0 0 10px rgba(255, 30, 60, .75), 0 0 20px rgba(255, 0, 40, .55); }
/* админка */
.admin-room { cursor: default; align-items: flex-start; }
.admin-room .btn { align-self: center; flex: none; }
.mini-members { display: flex; gap: 4px; margin-top: 6px; }
.admin-box { padding: 18px; }
.admin-box .row { display: flex; gap: 10px; }
.admin-box .row .field { flex: 1; }
.admins { display: grid; gap: 8px; margin-top: 16px; }
.admin-row { display: flex; align-items: center; gap: 10px; padding: 8px 10px; border-radius: 14px; background: rgba(255, 255, 255, .05); }
.admin-row .grow { flex: 1; min-width: 0; }
.dim { color: var(--muted); font-size: 12px; }
#admin-rooms { grid-template-columns: repeat(auto-fill, minmax(340px, 1fr)); }
.msg .bub b.admin-name { font-size: 13px; font-weight: 800; }

/* аватарки-картинки */
.avatar.pic { background-size: cover; background-position: center; }
.avatar.xl { width: 84px; height: 84px; font-size: 34px; flex: none; }
.me-pic { padding: 0; border-radius: 50%; flex: none; transition: transform .15s; }
.me-pic:hover { transform: scale(1.08); }
.profile { display: flex; align-items: center; gap: 18px; }
.profile .txt { flex: 1; min-width: 0; display: flex; flex-direction: column; gap: 3px; }
.profile .txt b { font-size: 18px; }
.profile .txt span { color: var(--muted); }
.profile .btns { display: flex; gap: 8px; flex-wrap: wrap; justify-content: flex-end; }
/* смайлики */
.panel { position: relative; }
.chat-input .emoji-btn { width: 44px; height: 44px; flex: none; font-size: 22px; border-radius: 50%; }
.emoji-pop { position: absolute; left: 8px; right: 8px; bottom: 64px; height: min(320px, 60%); z-index: 5; display: flex; flex-direction: column; padding: 8px; border-radius: 22px;
  background: rgba(24, 22, 30, .95); backdrop-filter: blur(24px) saturate(1.6); animation: pop-in .14s ease; }
@keyframes pop-in { from { opacity: 0; transform: translateY(6px) scale(.98); } }
.emoji-tabs { display: flex; gap: 2px; padding-bottom: 6px; border-bottom: 1px solid var(--edge-soft); }
.emoji-tabs button { flex: 1; height: 32px; font-size: 18px; border-radius: 10px; opacity: .55; transition: opacity .15s, background .15s; }
.emoji-tabs button.on, .emoji-tabs button:hover { opacity: 1; background: rgba(255, 255, 255, .1); }
.emoji-grid { flex: 1; overflow-y: auto; display: grid; grid-template-columns: repeat(auto-fill, minmax(38px, 1fr)); align-content: start; gap: 2px; padding-top: 6px; }
.emoji-grid button { height: 38px; font-size: 25px; line-height: 1; border-radius: 10px; transition: transform .1s, background .15s; }
.emoji-grid button:hover { background: rgba(255, 255, 255, .12); transform: scale(1.15); }
.msg .bub.big { background: none; border: 0; box-shadow: none; padding: 0 2px; }
.msg .bub.big p { font-size: 40px; line-height: 1.15; }

/* складная боковая панель: только значки */
.shell { transition: grid-template-columns .25s ease; }
.shell.collapsed { grid-template-columns: 76px 1fr; }
.side-top { display: flex; align-items: flex-start; justify-content: space-between; position: relative; z-index: 1; }
.side-toggle { flex: none; margin-top: 2px; }
.nav span { overflow: hidden; white-space: nowrap; }
.side-room .sr-ico { display: none; }
.shell.collapsed .sidebar { padding: 18px 10px 12px; align-items: stretch; }
.shell.collapsed .side-top { justify-content: center; margin-bottom: 14px; }
.shell.collapsed .logo { display: none; }
.shell.collapsed .nav { justify-content: center; padding: 12px 0; }
.shell.collapsed .nav span { display: none; }
.shell.collapsed .side-room { padding: 12px 0; display: grid; place-items: center; }
.shell.collapsed .side-room > :not(.sr-ico) { display: none; }
.shell.collapsed .side-room .sr-ico { display: grid; place-items: center; height: 22px; }
.shell.collapsed .side-room .sr-ico .eq { margin: 0; }
.shell.collapsed #me { justify-content: center; padding: 8px 0; background: none; border-color: transparent; }
.shell.collapsed #me .who, .shell.collapsed #me > .iconbtn { display: none; }
@media (max-width: 1280px) { .shell.collapsed { grid-template-columns: 76px 1fr; } }

/* плейлисты */
.pl-code { display: flex; gap: 8px; }
.pl-code .field { width: 120px; text-align: center; letter-spacing: .2em; text-transform: uppercase; }
.pl-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(190px, 1fr)); gap: 14px; margin-top: 24px; }
.pl-card { padding: 12px; border-radius: 22px; cursor: pointer; transition: transform .2s, box-shadow .2s; min-width: 0; }
.pl-card:hover { transform: translateY(-3px); }
.pl-card .t { font-weight: 750; margin-top: 10px; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.pl-card .m { font-size: 12px; color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.pl-new { cursor: default; display: flex; flex-direction: column; gap: 8px; }
.pl-new:hover { transform: none; }
.pl-new .field { height: 38px; font-size: 13px; }
.mosaic { aspect-ratio: 1; border-radius: 16px; overflow: hidden; display: grid; background: rgba(255, 255, 255, .06); }
.mosaic.n4 { grid-template-columns: 1fr 1fr; }
.mosaic i { background-size: cover; background-position: center; }
.mosaic.empty, .mosaic.likes { place-items: center; color: var(--muted); }
.mosaic.empty svg, .mosaic.likes svg { width: 34%; height: 34%; }
.mosaic.likes { color: #fff; background: linear-gradient(135deg, rgba(var(--c2), .95), rgba(var(--c3), .9)); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .3); }
.pl-new .mosaic { aspect-ratio: auto; height: 74px; }
.back { margin-bottom: 18px; }
.back svg { width: 16px; height: 16px; }
.pl-head { display: flex; gap: 24px; align-items: flex-end; }
.pl-head .mosaic.big { width: 168px; flex: none; box-shadow: 0 20px 50px rgba(0, 0, 0, .4); }
.pl-head .grow { flex: 1; min-width: 0; }
.pl-title { display: block; width: 100%; font: 800 38px Manrope; letter-spacing: -.03em; color: var(--text); background: none; border: 1px solid transparent; border-radius: 12px; padding: 2px 8px; margin-left: -8px; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
input.pl-title:hover { border-color: var(--edge-soft); }
input.pl-title:focus { outline: none; border-color: rgba(var(--c1), .6); background: rgba(0, 0, 0, .2); }
.pl-head .row { display: flex; gap: 10px; align-items: center; margin-top: 16px; flex-wrap: wrap; }
.pl-results { margin-top: 10px; padding: 8px; }
.pl-row { grid-template-columns: 30px 46px minmax(0, 1fr) 60px auto; }
.pl-row .acts { display: flex; gap: 4px; justify-content: flex-end; }
.pl-menu { position: fixed; z-index: 60; width: 260px; max-height: 340px; overflow-y: auto; padding: 6px; border-radius: 18px; background: rgba(24, 22, 30, .96); backdrop-filter: blur(20px); animation: pop-in .12s ease; }
.pl-menu .hd { font-size: 11px; text-transform: uppercase; letter-spacing: .1em; color: var(--muted); padding: 8px 10px 6px; }
.pl-menu button { display: flex; align-items: center; gap: 10px; width: 100%; padding: 9px 10px; border-radius: 12px; text-align: left; }
.pl-menu button:hover { background: rgba(255, 255, 255, .08); }
.pl-menu button span { flex: 1; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; font-weight: 650; }
.pl-menu button small { color: var(--dim); font-size: 12px; }
.pl-menu svg { width: 16px; height: 16px; color: var(--muted); flex: none; }

/* переключатель */
.switch { flex: none; width: 50px; height: 30px; border-radius: 999px; position: relative; background: rgba(255, 255, 255, .12); border: 1px solid var(--edge-soft); transition: background .2s; }
.switch i { position: absolute; top: 3px; left: 3px; width: 22px; height: 22px; border-radius: 50%; background: #fff; box-shadow: 0 2px 6px rgba(0, 0, 0, .35); transition: transform .2s; }
.switch.on { background: linear-gradient(120deg, rgba(var(--c1), .95), rgba(var(--c2), .95)); }
.switch.on i { transform: translateX(20px); }

/* видимый фокус с клавиатуры */
:focus-visible { outline: 2px solid rgba(var(--c1), .9); outline-offset: 2px; border-radius: 10px; }
button:focus-visible, [data-act]:focus-visible { outline-offset: 3px; }

/* Premium-ник: белое неоновое свечение (у админа — красное) */
.premium-name { color: #fff !important; text-shadow: 0 0 4px rgba(255, 255, 255, .95), 0 0 10px rgba(255, 255, 255, .7), 0 0 20px rgba(200, 220, 255, .5); }
.admin-room-acts { display: flex; gap: 6px; align-items: center; flex: none; align-self: center; }

/* ---------- эксклюзивные палитры (Premium) ---------- */
[data-theme="aurora"] { --c1: 52, 211, 153; --c2: 34, 211, 238; --c3: 168, 85, 247; --o1: #065f46; --o2: #0e7490; --o3: #6b21a8; --o4: #10b981; --bg: #04100d; --muted: #9db8b5; --dim: #5f7a77; --on-accent: #04120e; }
[data-theme="gold"] { --c1: 251, 191, 36; --c2: 245, 158, 11; --c3: 253, 230, 138; --o1: #713f12; --o2: #a16207; --o3: #422006; --o4: #ca8a04; --bg: #0c0a06; --muted: #b3a584; --dim: #7a7152; --on-accent: #1a1206; }
[data-theme="vapor"] { --c1: 244, 114, 182; --c2: 167, 139, 250; --c3: 56, 189, 248; --o1: #9d174d; --o2: #6d28d9; --o3: #0369a1; --o4: #db2777; --bg: #0a0718; --muted: #b9a9cf; --dim: #7a6f93; --on-accent: #12071a; }

/* карточки тем: эксклюзивные и заблокированные */
.theme.prem { position: relative; }
.theme .prem-tag { color: #fbbf24; font-size: 11px; text-shadow: 0 0 6px rgba(251, 191, 36, .7); }
.theme.locked { opacity: .6; }
.theme.locked::after { content: "🔒"; position: absolute; top: 10px; right: 12px; font-size: 13px; }

/* ---------- статусы: анимированный неон ---------- */
.role-name { font-weight: 800 !important; }
.msg .bub b.role-name { font-size: 13px; }
/* свечение без пульсации: бесконечная анимация тени перерисовывала окно каждый кадр */
.r-owner { color: #c77dff !important; text-shadow: 0 1px 3px rgba(0, 0, 0, .65), 0 0 4px rgba(168, 85, 247, .95), 0 0 10px rgba(168, 85, 247, .6), 0 0 16px rgba(139, 60, 240, .4); }
.r-admin { color: #ff4d5e !important; text-shadow: 0 1px 3px rgba(0, 0, 0, .65), 0 0 4px rgba(255, 60, 80, .95), 0 0 10px rgba(255, 30, 60, .6), 0 0 16px rgba(255, 0, 40, .4); }
.r-premium { color: #fff !important; -webkit-text-stroke: .3px rgba(0, 0, 0, .4); text-shadow: 0 1px 3px rgba(0, 0, 0, .6), 0 0 4px rgba(255, 255, 255, .98), 0 0 10px rgba(220, 235, 255, .6), 0 0 16px rgba(190, 215, 255, .4); }
/* подпись статуса рядом с ником */
/* неон и цвет .r-* — для ника; на плашке они красили текст в цвет фона (белый Premium на белом), поэтому здесь свои */
.role-badge { display: inline-block; margin-left: 7px; font: 800 9px Manrope; letter-spacing: .09em; text-transform: uppercase; padding: 2px 6px; border-radius: 6px; vertical-align: middle; position: relative; top: -1px; animation: none; text-shadow: none; -webkit-text-stroke: 0; }
.role-badge.r-owner { background: linear-gradient(120deg, #9333ea, #c084fc); color: #fff !important; box-shadow: 0 0 10px rgba(168, 85, 247, .5); }
.role-badge.r-admin { background: linear-gradient(120deg, #e11d48, #fb7185); color: #fff !important; box-shadow: 0 0 10px rgba(255, 40, 70, .5); }
.role-badge.r-premium { background: rgba(255, 255, 255, .92); color: #15121c !important; box-shadow: 0 0 10px rgba(255, 255, 255, .45); }

/* ---------- свой фон комнаты ---------- */
.room-bg.custom { filter: blur(6px) saturate(1.12) brightness(.9); opacity: .98; }
/* затемнение зонами: ощутимо только под шапкой и чатом (там текст), центр — яркий, фон виден */
.room-scrim { position: absolute; inset: 0; z-index: 0; opacity: 0; transition: opacity .4s; pointer-events: none; background:
  radial-gradient(140% 110% at 48% 28%, transparent 50%, rgba(6, 6, 12, .4) 100%),
  linear-gradient(90deg, transparent 58%, rgba(6, 6, 12, .52) 100%),
  linear-gradient(180deg, rgba(6, 6, 12, .5) 0, transparent 150px),
  linear-gradient(180deg, rgba(6, 6, 12, .12), rgba(6, 6, 12, .26)); }
.room-scrim.on { opacity: 1; }
/* по яркости картинки: тёмную почти не трогаем, светлую приглушаем, чтобы текст читался */
body[data-bg-lum="dark"] .room-bg.custom { filter: blur(6px) saturate(1.12) brightness(1.02); }
body[data-bg-lum="dark"] .room-scrim { opacity: .7; }
body[data-bg-lum="light"] .room-bg.custom { filter: blur(7px) saturate(1.12) brightness(.74); }
/* GIF: сильнее размыть и чуть притушить — чтобы движение не дёргало глаз */
body.is-gif .room-bg.custom { filter: blur(11px) saturate(1.12) brightness(.76); opacity: .9; }
/* при кастомном фоне — тёмная подложка под стекло в комнате, чтобы цвет фона не просвечивал грязью */
body.room-custom .room .card { background: var(--glass), rgba(10, 10, 18, .34); backdrop-filter: blur(30px) saturate(140%); -webkit-backdrop-filter: blur(30px) saturate(140%); }
body.room-custom .room .panel { background: rgba(10, 12, 20, .5); }
body.room-custom .room .msg .bub { background: rgba(14, 14, 24, .52); border-color: rgba(255, 255, 255, .14); }
body.room-custom .room .msg.me .bub { background: linear-gradient(135deg, rgba(var(--c1), .3), rgba(var(--c2), .22)), rgba(14, 14, 24, .4); }
body.room-custom .room .msg.sys { color: rgba(255, 255, 255, .72); }

/* профиль: имя и бейдж в одну строку, пилюля по содержимому (не на всю ширину) */
.profile .txt .pname { display: flex; align-items: center; gap: 2px; min-width: 0; }
.profile .txt .pname .role-name { overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.profile .txt .role-badge { align-self: center; flex: none; }

/* Flow desktop: quiet navy surfaces, artwork first, one luminous playback stage.
   Kept separate from the existing feature styles so room themes and account UI
   can continue to share their current components. */

:root {
  --text: #f3f5f9;
  --muted: color-mix(in srgb, rgb(var(--c1)) 16%, #aeb6c6);
  --dim: color-mix(in srgb, rgb(var(--c1)) 12%, #778191);
  --panel-bg: color-mix(in srgb, rgb(var(--c1)) 8%, #090c11);
  --panel-raised: color-mix(in srgb, rgb(var(--c1)) 12%, #10141c);
  --panel-line: rgba(var(--c1), .22);
  --edge-soft: rgba(var(--c1), .16);
  --surface: rgba(var(--c1), .055);
  --surface-2: rgba(var(--c1), .11);
  --border: var(--edge-soft);
  --glass: linear-gradient(145deg, var(--panel-raised), var(--panel-bg));
  --glass-strong: linear-gradient(140deg, color-mix(in srgb, rgb(var(--c1)) 17%, #10141c), var(--panel-bg));
  --shine: inset 0 1px 0 rgba(255, 255, 255, .035);
  --lift: 0 14px 36px rgba(0, 0, 0, .18);
  --radius: 20px;
  --panel: var(--panel-bg);
  --sidebar-width: 224px;
  --context-width: 320px;
}
:root:not([data-theme]), :root[data-theme="neon"] {
  --bg: var(--panel-bg);
  --c1: 109, 146, 255;
  --c2: 128, 91, 255;
  --c3: 108, 194, 255;
  --o1: rgb(var(--c2));
  --o2: var(--panel-bg);
  --o3: var(--panel-bg);
  --o4: rgb(var(--c2));
  --muted: rgb(var(--c1));
  --dim: rgb(var(--c1));
  --on-accent: #090b10;
}
:root[data-theme="cover"] { --bg: color-mix(in srgb, rgb(var(--c1)) 5%, #030507); }
body { background: var(--bg); font-weight: 500; }
button, input, textarea { -webkit-tap-highlight-color: transparent; }
button { touch-action: manipulation; }
button:disabled { cursor: default; }
button:not(:disabled):active { transform: translateY(1px); }
button:focus-visible, a:focus-visible, input:focus-visible, textarea:focus-visible, [tabindex]:focus-visible {
  outline: 2px solid rgb(var(--c1)); outline-offset: 3px;
}
input, textarea { user-select: text; }
input::placeholder { color: var(--dim); }
::-webkit-scrollbar { width: 7px; height: 7px; }
::-webkit-scrollbar-thumb { background-color: rgba(var(--c1), .2); border-width: 2px; }
.orbs { opacity: .28; }
.orbs i { filter: blur(110px); }
.orbs i:nth-child(1) { width: 640px; height: 480px; top: -250px; left: 26%; opacity: .6; }
.orbs i:nth-child(2) { width: 440px; height: 600px; right: -250px; top: 4%; opacity: .3; }
.orbs i:nth-child(3) { width: 700px; height: 440px; left: 20%; bottom: -300px; opacity: .3; }
.orbs i:nth-child(4) { display: none; }
/* мягкий край шаров — градиентом в увеличенном на 220 px элементе, а не filter: blur(110px):
   размытие видеокарта пересчитывала каждый кадр анимации, градиент рисуется один раз */
.orbs i { filter: none; border-radius: 0; }
.orbs i:nth-child(1) { width: 1080px; height: 920px; top: -470px; left: calc(26% - 220px); background: radial-gradient(closest-side, var(--o1) 0%, color-mix(in srgb, var(--o1) 78%, transparent) 38%, color-mix(in srgb, var(--o1) 34%, transparent) 66%, transparent 100%); }
.orbs i:nth-child(2) { width: 880px; height: 1040px; right: -470px; top: calc(4% - 220px); background: radial-gradient(closest-side, var(--o2) 0%, color-mix(in srgb, var(--o2) 78%, transparent) 38%, color-mix(in srgb, var(--o2) 34%, transparent) 66%, transparent 100%); }
.orbs i:nth-child(3) { width: 1140px; height: 880px; left: calc(20% - 220px); bottom: -520px; background: radial-gradient(closest-side, var(--o3) 0%, color-mix(in srgb, var(--o3) 78%, transparent) 38%, color-mix(in srgb, var(--o3) 34%, transparent) 66%, transparent 100%); }
.titlebar { height: 40px; padding-left: 26px; }
.titlebar .brand { font-size: 12px; opacity: .6; }
.titlebar .brand .dot { width: 5px; height: 5px; box-shadow: none; }
.titlebar .net { font-size: 11px; }
.winbtns button { width: 42px; height: 28px; border-radius: 7px; }
.update-btn { box-shadow: none; font-size: 11px; height: 25px; }

/* App shell: every independently scrolling region can shrink inside the grid. */
#app { height: calc(100% - 40px); }
.shell {
  height: 100%; padding: 0 12px 12px; gap: 12px;
  grid-template-columns: var(--sidebar-width) minmax(0, 1fr) var(--context-width);
  grid-template-rows: minmax(0, 1fr) 84px;
  transition: grid-template-columns .2s ease;
}
.shell.collapsed { grid-template-columns: 76px minmax(0, 1fr) var(--context-width); }
.sidebar, .context-panel, .player {
  border: 1px solid var(--panel-line); background: var(--glass);
  /* фон непрозрачный — размытие под ним не видно, а видеокарта пересчитывала его каждый кадр */
  box-shadow: var(--shine); backdrop-filter: none; -webkit-backdrop-filter: none;
}
.sidebar::before, .player::before, .card::before, .side-room::before { display: none; }
.sidebar { grid-column: 1; grid-row: 1; min-height: 0; padding: 20px 9px 9px; border-radius: 22px; gap: 4px; overflow: hidden; }
.workspace { grid-column: 2; grid-row: 1; display: flex; flex-direction: column; min-width: 0; min-height: 0; }
.main { flex: 1; min-height: 0; border-radius: 20px; overflow: hidden; }
.view { padding: 20px 10px 26px; height: 100%; }
.view > .h1, .view > .sub, .view > .settings, .view > .home-grid, .view > .section-title,
.view > .rooms, .view > .pl-grid, .view > .fav-head, .view > .fav-list, .view > .pl-head,
.view > .back, .view > .pl-results { position: relative; z-index: 1; }
.logo { color: #f8faff; background: none; filter: none; font: 800 38px/1 Syne, sans-serif; letter-spacing: -.075em; padding: 0 15px 24px; }
.side-top { align-items: flex-start; }
.side-letter { display:none; font:800 34px/1 Syne,sans-serif; color:var(--text); }
.shell.collapsed .side-toggle { background:none; border:0; }
.shell.collapsed .side-toggle > svg { display:none; }
.shell.collapsed .side-letter { display:block; }
.side-toggle { width: 28px; height: 30px; margin: 3px 3px 0 0; color: var(--dim); }
.side-toggle svg { width: 15px; height: 15px; }
.primary-nav { display: flex; flex-direction: column; gap: 4px; }
.nav { padding: 12px 14px; min-height: 46px; gap: 14px; border-radius: 12px; font-size: 15px; font-weight: 550; }
.nav svg.i { width: 21px; height: 21px; }
.nav:hover { background: rgba(var(--c1), .08); }
.nav.on {
  background: linear-gradient(110deg, rgba(var(--c1), .32), rgba(var(--c2), .21));
  border-color: rgba(var(--c1), .55); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .06); color: #fff;
}
.nav.on svg { color: #fff; filter: drop-shadow(0 0 7px rgba(var(--c1), .7)); }
.side-room { margin: 8px 4px; padding: 11px 12px; border-radius: 12px; background: rgba(var(--c1), .08); border-color: rgba(var(--c1), .18); box-shadow: none; }
.side-room .lbl { font-size: 9px; letter-spacing: .1em; }
.side-room .nm { font-size: 12px; }
.side-room { width: calc(100% - 8px); text-align: left; }
.side-library { display: flex; flex: 1; min-height: 0; flex-direction: column; margin-top: 14px; padding-top: 12px; border-top: 1px solid var(--edge-soft); }
.library-head { display: flex; align-items: center; justify-content: space-between; min-height: 28px; padding: 0 8px 5px; gap: 8px; font-size: 12px; color: var(--dim); }
.library-head .iconbtn { width: 26px; height: 26px; border-radius: 50%; background: rgba(var(--c1), .16); color: var(--text); }
.library-head .iconbtn svg { width: 15px; height: 15px; }
#library-list { overflow-y: auto; flex: 1; min-height: 0; padding-top: 4px; }
.library-item { display: flex; align-items: center; gap: 11px; width: 100%; padding: 5px 7px; margin-bottom: 3px; text-align: left; min-width: 0; border-radius: 12px; border: 1px solid transparent; }
.library-item:hover { background: rgba(var(--c1), .08); }
.library-item.on { background: rgba(var(--c1), .2); border-color: rgba(var(--c1), .12); }
.library-art { width: 44px; height: 44px; flex: none; overflow: hidden; border-radius: 8px; }
.library-art > .mosaic { width: 100%; height: 100%; border-radius: inherit; }
.library-art.mosaic, .library-art.cover { box-shadow: none; }
.library-art.likes, .library-item .mosaic.likes { background: linear-gradient(140deg, rgb(var(--c1)), rgb(var(--c1)) 60%, rgb(var(--c1))); color: #fff; }
.library-likes { display: grid; place-items: center; background: linear-gradient(140deg, rgb(var(--c1)), rgb(var(--c1)) 60%, rgb(var(--c1))); color: #fff; }
.library-art svg { width: 23px; height: 23px; }
.library-copy { flex: 1; min-width: 0; }
.library-copy b, .library-copy span { display: block; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.library-copy b { font-size: 13px; font-weight: 650; }
.library-copy span { color: var(--dim); font-size: 11px; margin-top: 3px; }
.library-empty { color: var(--dim); font-size: 11px; padding: 12px 9px; line-height: 1.7; }
.library-all { display: flex; align-items: center; gap: 5px; padding: 9px 8px 3px; color: rgb(var(--c1)); font-size: 11px; text-align: left; flex: none; }
.library-all svg { width: 13px; height: 13px; }
.sidebar .grow { display: none; }
#me { min-height: 58px; flex: none; margin-top: 8px; padding: 8px 9px; border-radius: 13px; background: color-mix(in srgb, rgba(var(--c1), .7) 10%, rgba(7, 9, 13, .7)); }
#me .avatar { width: 34px; height: 34px; box-shadow: none; }
#me .who b { font-size: 12px; }
#me .profile-name { display: flex; align-items: center; min-width: 0; }
#me .profile-name > b { min-width: 0; }
#me .profile-name .role-badge { flex: none; top: 0; }
#me .who > span { font-size: 10px; }
#me .who .role-badge { font-size: 7px; padding: 2px 4px; margin-left: 4px; }
#me > .iconbtn { width: 26px; height: 28px; }
#me > .iconbtn .i { width: 15px; height: 15px; }
.iconbtn { border-radius: 50%; color: var(--muted); }
.iconbtn:hover { background: rgba(var(--c1), .11); }
.iconbtn.on { color: var(--a1); }
.shell.collapsed .sidebar { padding: 19px 9px 9px; }
.shell.collapsed .side-top { min-height: 38px; margin-bottom: 16px; }
.shell.collapsed .side-toggle { margin: 0; width: 36px; height: 36px; }
.shell.collapsed .nav { padding: 12px 0; }
.shell.collapsed .side-library { margin-top: 12px; }
.shell.collapsed .library-head { justify-content: center; padding: 0 0 8px; }
.shell.collapsed .library-head > span, .shell.collapsed .library-copy, .shell.collapsed .library-empty { display: none; }
.shell.collapsed .library-all { display: none; }
.shell.collapsed .library-item { justify-content: center; padding: 4px 0; }
.shell.collapsed .library-art { width: 40px; height: 40px; }
.shell.collapsed #me { min-height: 50px; padding: 8px 0; }

/* Global search stays in place as pages change. */
.app-header { min-height: 52px; height: 52px; display: flex; gap: 14px; align-items: center; padding: 0 2px 12px; flex: none; }
.history-controls { display: flex; gap: 7px; flex: none; }
.history-controls .iconbtn { width: 37px; height: 38px; border-radius: 11px; border: 1px solid rgba(var(--c1), .1); background: color-mix(in srgb, rgba(var(--c1), .64) 10%, rgba(7, 9, 13, .64)); }
.history-controls .iconbtn:disabled { opacity: .28; }
.history-controls .iconbtn svg { width: 16px; height: 16px; }
.global-search { flex: 1; min-width: 0; display: flex; align-items: center; gap: 10px; height: 40px; border: 1px solid rgba(var(--c1), .4); border-radius: 999px; padding: 0 13px; background: linear-gradient(110deg, color-mix(in srgb, rgba(var(--c1), .9) 10%, rgba(7, 9, 13, .9)), rgba(var(--c1), .07)); transition: border-color .18s, box-shadow .18s; }
.global-search:focus-within { border-color: rgba(var(--c1), .75); box-shadow: 0 0 0 3px rgba(var(--c1), .09); }
.global-search > svg { width: 18px; height: 18px; color: rgb(var(--c1)); }
.global-search input { flex: 1; width: 0; border: 0; background: none; min-width: 0; font-size: 14px; height: 100%; outline: none; }
.global-search input::placeholder { color: var(--muted); opacity: .82; }
.global-search input:focus-visible { outline: none; }
.global-search .iconbtn { width: 24px; height: 24px; }
.global-search .iconbtn svg { width: 14px; height: 14px; }
.global-search kbd { font: 10px Manrope, sans-serif; color: var(--dim); border: 1px solid rgba(var(--c1), .2); border-radius: 5px; padding: 2px 5px; }
.header-actions { display: flex; align-items: center; gap: 7px; }
.header-actions .iconbtn { width: 36px; height: 36px; }
.header-actions .iconbtn.on { background: rgba(var(--c1), .1); }
.header-actions .queue-toggle { display: none; }

/* Artwork stage and the personal library below it. */
.main .home-view { height: 100%; overflow-y: auto; padding: 0 1px 22px; }
.home-hero {
  position: relative; isolation: isolate; overflow: clip; min-height: 292px;
  display: grid; grid-template-columns: 212px minmax(0, 1fr); gap: 20px 26px;
  padding: 25px 25px 18px; border: 1px solid rgba(var(--c1), .48); border-radius: 21px;
  background: radial-gradient(ellipse at 48% -20%, rgba(var(--c3), .68), transparent 58%),
    radial-gradient(ellipse at 0% 0%, rgba(var(--c2), .74), transparent 66%),
    linear-gradient(115deg, rgb(var(--c2)), var(--panel-bg) 58%, var(--panel-bg));
}
.home-hero::after { content: ""; position: absolute; z-index: -1; inset: -30% -15% -30% 40%; background: var(--hero-cover, none) center/cover; opacity: .22; filter: blur(5px) saturate(.8); mix-blend-mode: luminosity; transform: rotate(-7deg); pointer-events: none; }
.hero-ambient { position: absolute; z-index: -1; inset: -25% -10% -25% 42%; background: center/cover; opacity: .22; filter: blur(5px) saturate(.8); mix-blend-mode: luminosity; transform: rotate(-7deg); pointer-events: none; }
.hero-art { position: relative; width: 212px; height: 212px; border-radius: 18px; align-self: center; background: color-mix(in srgb, rgba(var(--c1), .55) 10%, rgba(7, 9, 13, .55)) center/cover; box-shadow: 0 12px 34px color-mix(in srgb, rgba(var(--c1), .3) 10%, rgba(7, 9, 13, .3)); display: grid; place-items: center; overflow: hidden; }
.hero-art > svg { width: 66px; height: 66px; color: rgba(255, 255, 255, .4); }
.hero-copy { position: relative; align-self: center; min-width: 0; padding-top: 1px; padding-right: 16px; }
.eyebrow, .hero-copy > .lbl { font-size: 11px; font-weight: 700; text-transform: uppercase; letter-spacing: .16em; color: var(--muted); }
.hero-copy h1 { font: 800 clamp(27px, 3vw, 46px)/1.1 Manrope, sans-serif; letter-spacing: -.045em; margin: 10px 0 6px; overflow: hidden; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
.hero-artist { font-size: clamp(15px, 1.5vw, 21px); color: var(--muted); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.hero-source { display: inline-flex; align-items: center; gap: 7px; border: 1px solid rgba(var(--c1), .27); border-radius: 999px; background: color-mix(in srgb, rgba(var(--c1), .25) 10%, rgba(7, 9, 13, .25)); margin-top: 15px; padding: 6px 11px; color: var(--text); font-size: 12px; max-width: 100%; }
.hero-source svg { width: 16px; height: 16px; color: var(--muted); }
.hero-source:disabled { opacity: .62; }
.hero-source.on { border-color: rgba(var(--c1), .65); background: rgba(var(--c1), .18); }
.hero-added-by { display: inline-flex; gap: 7px; align-items: center; color: rgb(var(--c1)); font-size: 10px; margin-top: 12px; }
.hero-added-by .avatar { width: 20px; height: 20px; font-size: 9px; box-shadow: none; }
.hero-copy:has(.hero-source) > .eyebrow { padding-right: 62px; display: block; }
.hero-actions { display: flex; gap: 19px; align-items: center; margin-top: 16px; }
.hero-actions .iconbtn { color: var(--text); width: 30px; height: 30px; }
.hero-actions .iconbtn svg { width: 21px; height: 21px; }
.hero-actions .playbtn { width: 52px; height: 52px; }
.hero-actions .playbtn svg { width: 24px; height: 24px; }
.hero-top-actions { position: absolute; top: 17px; right: 17px; display: flex; gap: 7px; z-index: 2; }
.hero-top-actions .iconbtn { width: 34px; height: 34px; border: 1px solid rgba(var(--c1), .18); background: color-mix(in srgb, rgba(var(--c1), .35) 10%, rgba(7, 9, 13, .35)); color: var(--text); }
.hero-top-actions .iconbtn.on { color: #fff; background: rgba(var(--c1), .25); }
.hero-top-actions .iconbtn svg { width: 17px; height: 17px; }
.hero-timeline { grid-column: 1 / -1; display: flex; align-items: center; gap: 12px; color: var(--muted); font-size: 12px; font-variant-numeric: tabular-nums; }
.hero-timeline .seek-range { flex: 1; width: 0; }
.hero-timeline > span { min-width: 29px; }
.home-filters { display: flex; align-items: center; gap: 8px; padding: 17px 2px 19px; overflow-x: auto; scrollbar-width: none; }
.home-filters::-webkit-scrollbar { display: none; }
.filter-chip { flex: none; height: 37px; display: inline-flex; align-items: center; gap: 7px; padding: 0 14px; border-radius: 999px; border: 1px solid rgba(var(--c1), .27); background: color-mix(in srgb, rgba(var(--c1), .55) 10%, rgba(7, 9, 13, .55)); color: var(--muted); font-size: 12px; transition: background .15s, border-color .15s; }
.filter-chip svg { width: 15px; height: 15px; }
.filter-chip:hover { color: var(--text); border-color: rgba(var(--c1), .5); }
.filter-chip.on { color: #fff; font-weight: 750; border-color: rgba(var(--c1), .82); background: linear-gradient(115deg, rgb(var(--c1)), rgb(var(--c2))); box-shadow: 0 0 13px rgba(var(--c1), .24), inset 0 0 0 2px rgba(255, 255, 255, .08); }
.home-section { margin-bottom: 21px; padding: 0 3px; }
.section-heading { display: flex; align-items: center; justify-content: space-between; gap: 16px; margin-bottom: 12px; }
.section-heading h2 { font-size: 20px; line-height: 1.3; letter-spacing: -.035em; font-weight: 800; }
.section-heading > button, .section-heading > a { display: inline-flex; align-items: center; gap: 5px; color: rgb(var(--c1)); font-size: 11px; text-decoration: none; white-space: nowrap; }
.section-heading > button svg { width: 13px; height: 13px; }
.track-shelf { display: grid; grid-auto-flow: column; grid-auto-columns: minmax(112px, 1fr); grid-template-rows: auto; gap: 12px; overflow-x: auto; padding: 2px 1px 5px; }
.track-card { min-width: 0; position: relative; text-align: left; border-radius: 13px; padding: 3px; border: 1px solid transparent; cursor: pointer; transition: background .16s, border-color .16s; }
.track-card:hover, .track-card:focus-within { background: rgba(var(--c1), .1); }
.track-card.on, .track-card.is-current { border-color: rgba(var(--c1), .8); background: linear-gradient(150deg, rgba(var(--c1), .24), rgba(var(--c2), .35)); }
.track-art { width: 100%; aspect-ratio: 1.02; position: relative; background: color-mix(in srgb, rgba(var(--c1), .6) 10%, rgba(7, 9, 13, .6)) center/cover; border: 1px solid rgba(var(--c1), .13); border-radius: 12px; overflow: hidden; display: grid; place-items: center; }
.track-art > svg { color: var(--dim); width: 30px; height: 30px; }
.track-play { position: absolute; right: 8px; bottom: 8px; width: 33px; height: 33px; display: grid; place-items: center; color: #fff; border-radius: 50%; border: 1px solid rgba(var(--c1), .35); background: rgba(var(--c1), .9); opacity: 0; transform: translateY(3px); transition: opacity .15s, transform .15s; box-shadow: 0 3px 12px rgba(0, 0, 0, .2); }
.track-card:hover .track-play, .track-card:focus-within .track-play, .track-card.on .track-play, .track-card.is-current .track-play { opacity: 1; transform: none; }
.track-play svg { width: 17px; height: 17px; }
.track-title, .track-artist { display: block; overflow: hidden; white-space: nowrap; text-overflow: ellipsis; }
.track-title { margin: 7px 2px 0; font-size: 13px; font-weight: 650; text-align: left; }
.track-artist { margin: 3px 2px 2px; color: var(--muted); font-size: 11px; }
.playlist-shelf { display: grid; grid-template-columns: repeat(5, minmax(0, 1fr)); gap: 11px; }
.playlist-tile { position: relative; min-width: 0; height: 137px; border: 1px solid rgba(var(--c1), .18); border-radius: 14px; overflow: hidden; text-align: left; cursor: pointer; background: var(--panel-bg); }
.playlist-tile::after { content: ""; position: absolute; inset: 0; background: linear-gradient(0deg, color-mix(in srgb, rgba(var(--c1), .86) 10%, rgba(7, 9, 13, .86)), color-mix(in srgb, rgba(var(--c1), .12) 10%, rgba(7, 9, 13, .12)) 78%); pointer-events: none; }
.playlist-art, .playlist-tile > .mosaic { position: absolute; inset: 0; border-radius: 0; width: 100%; height: 100%; aspect-ratio: auto; background: center/cover; transition: transform .25s; }
.playlist-art .mosaic { width: 100%; height: 100%; border-radius: 0; }
.playlist-tile:hover .playlist-art, .playlist-tile:hover > .mosaic { transform: scale(1.035); }
.playlist-tile.likes::after, .playlist-tile.is-likes::after { background: linear-gradient(0deg, rgba(var(--c1), .65), transparent); }
.playlist-tile .mosaic.likes { background: linear-gradient(135deg, #ec44cf, rgb(var(--c1)) 62%, rgb(var(--c2))); }
.playlist-tile .mosaic.likes svg { width: 27px; height: 27px; margin-bottom: 24px; }
.playlist-info { position: absolute; left: 13px; right: 11px; bottom: 12px; z-index: 1; }
.playlist-info b, .playlist-info span { display: block; overflow: hidden; white-space: nowrap; text-overflow: ellipsis; }
.playlist-info b { font-size: 13px; font-weight: 750; }
.playlist-info span { color: rgba(var(--c1), .66); font-size: 11px; margin-top: 4px; }
.playlist-open { position: absolute; right: 10px; top: 10px; z-index: 2; display: grid; place-items: center; width: 25px; height: 25px; border-radius: 50%; background: color-mix(in srgb, rgba(var(--c1), .45) 10%, rgba(7, 9, 13, .45)); border: 1px solid rgba(var(--c1), .17); opacity: 0; transition: opacity .15s; }
.playlist-open svg { width: 12px; height: 12px; }
.playlist-tile:hover .playlist-open, .playlist-tile:focus-visible .playlist-open { opacity: 1; }
.playlist-create .playlist-art { display: grid; place-items: center; background: linear-gradient(135deg, rgba(var(--c1), .13), rgba(var(--c2), .2)); }
.playlist-create .playlist-art > span { display: grid; place-items: center; width: 33px; height: 33px; border: 1px solid rgba(var(--c1), .3); border-radius: 50%; margin-bottom: 24px; color: var(--muted); }
.playlist-create .playlist-art svg { width: 19px; height: 19px; }
.home-welcome { display: flex; flex-direction: column; justify-content: center; min-height: 292px; padding: 37px; border-radius: 21px; border: 1px solid rgba(var(--c1), .38); background: radial-gradient(ellipse at 85% 0, rgba(var(--c2), .35), transparent 65%), linear-gradient(120deg, var(--panel-bg), var(--panel-bg)); overflow: hidden; }
.home-welcome h1 { max-width: 600px; margin: 13px 0 10px; font-size: clamp(29px, 3.3vw, 45px); font-weight: 800; letter-spacing: -.045em; line-height: 1.12; }
.home-welcome p { color: var(--muted); font-size: 13px; max-width: 440px; line-height: 1.65; }
.home-section .home-welcome { display: flex; flex-direction: row; gap: 16px; align-items: center; justify-content: flex-start; min-height: 118px; padding: 22px; border-radius: 14px; background: color-mix(in srgb, rgba(var(--c1), .52) 10%, rgba(7, 9, 13, .52)); border-color: rgba(var(--c1), .18); }
.home-section .home-welcome > div:not(.welcome-symbol) { flex: 1; }
.home-section .home-welcome h3 { font-size: 14px; letter-spacing: -.02em; margin-bottom: 5px; }
.home-section .home-welcome p { font-size: 11px; line-height: 1.6; }
.welcome-symbol { width: 42px; height: 42px; flex: none; border-radius: 12px; background: rgba(var(--c1), .1); color: rgb(var(--c1)); display: grid; place-items: center; }
.welcome-symbol svg { width: 22px; height: 22px; }
.welcome-actions { display: flex; gap: 10px; margin-top: 24px; flex-wrap: wrap; }
.welcome-actions .btn { height: 39px; font-size: 12px; }
.home-empty { padding: 20px; border: 1px dashed var(--edge-soft); border-radius: 14px; color: var(--muted); font-size: 12px; line-height: 1.7; }

/* Permanent queue. Chat uses this same space while listening in a room. */
.context-panel { grid-column: 3; grid-row: 1; display: flex; flex-direction: column; min-width: 0; min-height: 0; border-radius: 21px; overflow: hidden; z-index: 3; margin-top: 52px; }
.context-tabs { min-height: 52px; display: flex; align-items: stretch; gap: 19px; padding: 0 16px; flex: none; border-bottom: 1px solid var(--panel-line); }
.context-tab { position: relative; display: flex; align-items: center; justify-content: center; gap: 7px; color: var(--muted); font-size: 14px; padding: 0; }
.context-tab.on { color: #fff; font-weight: 750; }
.context-tab.on::after { content: ""; position: absolute; left: 0; right: 0; bottom: -1px; height: 3px; border-radius: 3px 3px 0 0; background: rgb(var(--c1)); box-shadow: 0 -2px 12px rgba(var(--c2), .4); }
.context-tab > span { font-size: 10px; border-radius: 5px; background: rgba(var(--c1), .25); padding: 2px 5px; color: var(--muted); }
.context-close { display: none; align-self: center; margin-left: auto; width: 26px; height: 26px; }
.context-close svg { width: 15px; height: 15px; }
.context-body { flex: 1; display: flex; min-height: 0; overflow: hidden; }
.context-queue { flex: 1; display: flex; flex-direction: column; min-width: 0; min-height: 0; padding: 8px 6px 6px; }
.queue-head { display: flex; align-items: center; gap: 8px; justify-content: space-between; padding: 0 8px 5px; min-height: 28px; }
.queue-head > b, .queue-head > span, .queue-head #qcount { color: var(--dim); font-size: 10px; font-weight: 500; }
.queue-head .iconbtn { height: 24px; width: 24px; }
.queue-head .iconbtn svg { width: 14px; height: 14px; }
.context-panel .queue { min-height: 0; padding-right: 0; }
.context-panel .qrow { position: relative; gap: 9px; min-height: 59px; padding: 7px 8px 7px 5px; border-radius: 12px; }
.context-panel .qrow.cur { background: linear-gradient(115deg, rgba(var(--c1), .28), rgba(var(--c1), .17)); box-shadow: inset 0 1px 0 rgba(255, 255, 255, .025); }
.context-panel .qrow.played { opacity: .6; }
.context-panel .qrow .num { width: 17px; font-size: 10px; color: rgb(var(--c1)); flex: none; font-weight: 500; }
.context-panel .qrow .cover { width: 38px; height: 42px; border-radius: 6px; }
.context-panel .qrow .tt b, .context-panel .queue-title { font-size: 12px; font-weight: 650; }
.queue-title { display: block; width: 100%; text-align: left; color: var(--text); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.queue-title:disabled { color: var(--text); }
.context-panel .qrow .tt span { font-size: 11px; margin-top: 3px; }
.context-panel .qrow .dur { width: 29px; flex: none; font-size: 11px; }
.context-panel .qrow > .avatar { display: none; }
.context-panel .qrow .acts { position: absolute; right: 5px; top: 50%; transform: translateY(-50%); width: auto; max-width: calc(100% - 55px); display: flex; opacity: 0; pointer-events: none; gap: 1px; padding: 3px; background: var(--panel-bg); border: 1px solid rgba(var(--c1), .18); border-radius: 999px; box-shadow: 0 4px 10px rgba(0, 0, 0, .2); }
.context-panel .qrow .acts .iconbtn { width: 27px; height: 27px; }
.context-panel .qrow .acts .iconbtn .i { width: 14px; height: 14px; }
.context-panel .qrow:hover .acts, .context-panel .qrow:focus-within .acts { opacity: 1; pointer-events: auto; }
.context-panel .qrow:focus-within { background: rgba(var(--c1), .17); }
.context-panel .empty { font-size: 12px; padding: 36px 20px; }
.context-panel .empty svg { width: 30px; height: 30px; }
.context-chat { display: flex; flex: 1; min-width: 0; min-height: 0; }
.context-chat .panel { border: 0; border-radius: 0; background: none; box-shadow: none; padding: 10px 6px 6px; }
.context-chat .panel > .tabs { margin: 0 3px 10px; }
.context-chat .panel > .tabs button { height: 29px; font-size: 10px; }
.context-chat .panel > .tabs .i { width: 13px; height: 13px; }
.context-chat .chat { padding: 4px; gap: 12px; }
.context-chat .msg { gap: 6px; font-size: 11px; }
.context-chat .msg .avatar { width: 23px; height: 23px; font-size: 10px; }
.context-chat .msg .bub { padding: 7px 9px; border-radius: 4px 12px 12px; box-shadow: none; background: rgba(var(--c1), .07); }
.context-chat .msg .bub b { font-size: 10px; }
.context-chat .msg.me .bub { border-radius: 12px 4px 12px 12px; background: rgba(var(--c1), .13); }
.context-chat .chat-input { gap: 5px; padding-top: 12px; }
.context-chat .chat-input .field { height: 36px; font-size: 11px; padding: 0 12px; }
.context-chat .chat-input .emoji-btn { width: 29px; height: 36px; font-size: 18px; }
.context-chat .chat-input .btn { width: 34px; height: 36px; flex: none; }
.context-chat .chat-input .btn svg { width: 15px; height: 15px; }
.context-scrim { display: none; }

/* Search uses full-width rows, leaving artwork and text legible while adding. */
.main .search-view { padding: 18px 13px 30px; }
.search-view > .section-heading { align-items: flex-end; padding: 8px 0 0; margin-bottom: 10px; }
.search-view .h1 { font-size: 30px; margin-top: 8px; }
.search-view .eyebrow { color: var(--dim); font-size: 10px; }
.search-hint { font-size: 10px; color: var(--dim); text-align: right; max-width: 155px; line-height: 1.6; }
.search-results { margin-top: 22px; padding-top: 9px; border-top: 1px solid rgba(var(--c1), .16); }
.search-results > .trow { gap: 13px; padding: 10px 8px; border-radius: 12px; }
.trow:focus-within { background: rgba(var(--c1), .08); }
.trow > button.cover { position: relative; display: grid; place-items: center; width: 46px; height: 46px; overflow: hidden; border-radius: 8px; }
.trow > button.cover::before { content: ""; position: absolute; inset: 0; background: color-mix(in srgb, rgba(var(--c1), .5) 10%, rgba(7, 9, 13, .5)); opacity: 0; transition: opacity .15s; }
.trow > button.cover > svg { position: relative; z-index: 1; width: 20px; height: 20px; opacity: 0; color: #fff; transition: opacity .15s; filter: drop-shadow(0 1px 4px rgba(0, 0, 0, .4)); }
.trow:hover > button.cover::before, .trow:focus-within > button.cover::before,
.trow:hover > button.cover > svg, .trow:focus-within > button.cover > svg { opacity: 1; }
.trow .tt .track-title { font-size: 13px; line-height: 1.5; font-weight: 650; margin: 0; width: 100%; }
.trow .tt > span { font-size: 11px; margin-top: 3px; }
.search-results .empty { padding: 55px 24px; }
.search-results .empty h3 { color: var(--text); font-size: 17px; margin-bottom: 8px; }
.search-results .empty p { font-size: 12px; line-height: 1.7; max-width: 360px; margin: 0 auto; }
.search-results .empty > .btn { margin-top: 19px; }
.search-skeleton { display: flex; align-items: center; gap: 14px; height: 67px; padding: 10px 8px; }
.search-skeleton > span { width: 46px; height: 46px; border-radius: 8px; flex: none; background: rgba(var(--c1), .1); }
.search-skeleton > div { flex: 1; }
.search-skeleton i { display: block; height: 9px; width: 52%; max-width: 340px; border-radius: 3px; background: rgba(var(--c1), .12); }
.search-skeleton i + i { width: 33%; margin-top: 10px; background: rgba(var(--c1), .07); }
.search-skeleton:nth-child(2n) i { width: 44%; }
.search-skeleton:nth-child(2n) i + i { width: 29%; }

/* Playback dock is shared by all pages. */
.player { grid-column: 1 / -1; grid-row: 2; height: 84px; grid-template-columns: minmax(250px, 1fr) minmax(270px, 1.55fr) minmax(190px, 1fr); padding: 0 16px; gap: 22px; border-radius: 20px; background: linear-gradient(120deg, color-mix(in srgb, rgba(var(--c1), .96) 10%, rgba(7, 9, 13, .96)), color-mix(in srgb, rgba(var(--c1), .96) 10%, rgba(7, 9, 13, .96)) 52%, color-mix(in srgb, rgba(var(--c1), .96) 10%, rgba(7, 9, 13, .96))); }
.player .np { gap: 12px; }
.player .np .cover { width: 51px; height: 54px; border-radius: 9px; }
.player .np .tt { flex: 1; max-width: 190px; }
.player .np b { font-size: 13px; font-weight: 650; }
.player .np span { font-size: 11px; margin-top: 4px; }
.player .np .iconbtn { width: 29px; height: 29px; flex: none; }
.player .np .iconbtn svg { width: 19px; height: 19px; }
.player .np .iconbtn.on { color: rgb(var(--c1)); }
.controls { gap: 5px; min-width: 0; }
.controls .btns { gap: 19px; }
.controls .btns > .iconbtn { width: 29px; height: 29px; }
.controls .btns > .iconbtn svg { width: 19px; height: 19px; }
.playbtn { width: 42px; height: 42px; color: #fff; border-color: rgba(var(--c1), .62); background: linear-gradient(145deg, rgb(var(--c1)), rgb(var(--c2))); box-shadow: inset 0 1px 1px rgba(255, 255, 255, .34), 0 0 15px rgba(var(--c1), .38); }
.playbtn:hover { filter: brightness(1.1); transform: scale(1.04); }
.progress { gap: 10px; font-size: 11px; max-width: 620px; min-width: 0; }
.progress > span { min-width: 28px; }
.progress > span:last-child { text-align: right; }
.seek-range { flex: 1; width: 0; cursor: pointer; min-width: 20px; }
input[type="range"] { height: 6px; background: linear-gradient(90deg, rgb(var(--c2)), rgb(var(--c1))) 0 / var(--p, 0%) 100% no-repeat, rgba(var(--c1), .18); border-radius: 99px; }
input[type="range"]::-webkit-slider-thumb { width: 12px; height: 12px; box-shadow: 0 1px 5px rgba(0, 0, 0, .4); }
.seek-range::-webkit-slider-thumb { width: 9px !important; height: 9px !important; opacity: 0; transition: opacity .15s; }
.seek-range:hover::-webkit-slider-thumb, .seek-range:focus-visible::-webkit-slider-thumb { opacity: 1; }
.player .right { gap: 12px; }
.player .right > .i { width: 19px; height: 19px; }
.player .right .iconbtn { width: 31px; height: 31px; }
.player .right .iconbtn svg { width: 18px; height: 18px; }
.player .right .queue-toggle { display: none; }
.vol { width: 94px; }
.sync { font-size: 9px; gap: 5px; max-width: 100px; white-space: normal; }
.sync::before { width: 5px; height: 5px; flex: none; }
.sync.good::before { box-shadow: none; }

/* Existing screens retain their behavior inside the new shell. */
.h1 { font-size: 28px; line-height: 1.2; letter-spacing: -.035em; }
.sub { font-size: 12px; line-height: 1.7; }
.card { border-radius: 18px; padding: 20px; box-shadow: none; backdrop-filter: none; -webkit-backdrop-filter: none; background: color-mix(in srgb, rgba(var(--c1), .72) 10%, rgba(7, 9, 13, .72)); border-color: rgba(var(--c1), .15); }
.btn { height: 40px; padding: 0 17px; box-shadow: none; backdrop-filter: none; -webkit-backdrop-filter: none; font-size: 12px; font-weight: 650; background: rgba(var(--c1), .07); border-color: rgba(var(--c1), .22); }
.btn.primary { color: var(--on-accent); background: linear-gradient(115deg, rgba(var(--c1), .92), rgba(var(--c2), .92)); box-shadow: 0 5px 17px rgba(var(--c2), .15); border-color: rgba(var(--c1), .45); }
.btn.sm { height: 33px; font-size: 11px; padding: 0 12px; }
.btn.danger { color: #fff; background: #b93650; border-color: rgba(255, 157, 180, .18); }
.field { height: 42px; font-size: 12px; border-radius: 11px; background: color-mix(in srgb, rgba(var(--c1), .55) 10%, rgba(7, 9, 13, .55)); border-color: rgba(var(--c1), .22); backdrop-filter: none; -webkit-backdrop-filter: none; box-shadow: none; }
.field:focus { box-shadow: 0 0 0 3px rgba(var(--c1), .09); }
.tabs { border-radius: 11px; background: color-mix(in srgb, rgba(var(--c1), .3) 10%, rgba(7, 9, 13, .3)); box-shadow: none; backdrop-filter: none; -webkit-backdrop-filter: none; }
.tabs button { height: 33px; border-radius: 8px; font-size: 12px; }
.tabs button.on { background: rgba(var(--c1), .17); box-shadow: none; }
.main .player-view { position: relative; height: 100%; overflow-y: auto; padding: 4px 2px 24px; }
.player-view .room-head { padding: 4px 7px 14px; min-height: 45px; }
.player-view .room-head .nm { font-size: 21px; min-width: 90px; }
.player-view #banner { margin-bottom: 13px; }
.player-view .now { border-radius: 20px; padding: 25px; gap: 25px; background: radial-gradient(ellipse at 20% 0, rgba(var(--c2), .22), transparent 75%), color-mix(in srgb, rgba(var(--c1), .8) 10%, rgba(7, 9, 13, .8)); }
.player-view .now .cover { width: 190px; height: 190px; border-radius: 16px; box-shadow: 0 15px 28px rgba(0, 0, 0, .2); }
.player-view .now .title { font-size: clamp(25px, 3vw, 39px); line-height: 1.13; }
.player-view .now .artist { font-size: 16px; font-weight: 500; }
.player-view .now .lbl { font-size: 10px; color: var(--muted); }
.player-collection { margin-top: 24px; padding: 0 7px; }
.player-collection .section-heading { margin-bottom: 14px; }
.player-collection .track-shelf { grid-auto-columns: minmax(110px, 1fr); }
.wave-btn { box-shadow: none; height: 34px; padding: 0 12px; font-size: 11px; background: rgba(var(--c1), .06); border-color: rgba(var(--c1), .28); backdrop-filter: none; }
.wave-btn svg { width: 17px; height: 17px; }
.wave-btn.on { box-shadow: 0 0 0 2px rgba(var(--c1), .07); background: rgba(var(--c1), .18); }
.wave-btn.on svg { animation: none; }
.code-pill { height: 34px; font-size: 12px; background: rgba(var(--c1), .07); box-shadow: none; backdrop-filter: none; }
.banner { border-radius: 12px; box-shadow: none; font-size: 11px; backdrop-filter: none; }
.home-grid { gap: 12px; margin-top: 21px; }
.big-card { padding: 22px; }
.big-card h3 { font-size: 17px; }
.big-card p { font-size: 12px; line-height: 1.65; }
.big-card .glow { opacity: .1; }
.room-card { border-radius: 14px; }
.room-card:hover { transform: translateY(-2px); box-shadow: none; border-color: rgba(var(--c1), .35); }
.room-card .cover { width: 45px; height: 45px; border-radius: 9px; }
.room-card .t { font-size: 12px; }
.room-card .m { font-size: 10px; }
.room-card .tag { font-size: 10px; }
.rooms { grid-template-columns: repeat(auto-fill, minmax(215px, 1fr)); }
.fav-head { flex-wrap: wrap; align-items: center; gap: 10px; }
.fav-head .searchbox { max-width: 260px; }
.fav-head .searchbox svg { top: 12px; }
.fav-list { margin-top: 20px; }
.frow { grid-template-columns: 22px 40px minmax(0, 1.8fr) minmax(0, 1fr) 38px 112px; gap: 10px; padding: 8px 5px; border-radius: 11px; }
.frow .cover { width: 40px; height: 40px; border-radius: 7px; }
.frow b { font-size: 11px; }
.frow span { font-size: 10px; }
.frow .n, .frow .d, .frow .alb { font-size: 10px; }
.frow .acts { gap: 1px; }
.frow .acts .iconbtn { width: 27px; height: 29px; }
.frow .acts .iconbtn svg { width: 15px; height: 15px; }
.pl-row { grid-template-columns: 22px 40px minmax(0, 1fr) 38px auto; }
.pl-grid { grid-template-columns: repeat(auto-fill, minmax(150px, 1fr)); gap: 13px; }
.pl-card { padding: 10px; border-radius: 14px; }
.pl-card:hover { box-shadow: none; }
.pl-card .mosaic { border-radius: 10px; }
.pl-card .t { font-size: 12px; }
.pl-card .m { font-size: 10px; }
.pl-head { gap: 20px; align-items: center; }
.pl-head .mosaic.big { width: 142px; border-radius: 14px; box-shadow: none; }
.pl-title { font-size: 29px; }
.pl-head .row { margin-top: 13px; gap: 7px; }
.pl-head .sub { margin-top: 4px; }
.pl-new .field { font-size: 11px; }
.pl-menu { border: 1px solid var(--panel-line); background: var(--panel-bg); border-radius: 14px; box-shadow: 0 14px 36px color-mix(in srgb, rgba(var(--c1), .4) 10%, rgba(7, 9, 13, .4)); }
.pl-menu button { font-size: 12px; border-radius: 8px; }
.settings { margin-top: 20px; gap: 12px; }
.set-row { gap: 13px; }
.set-row .txt b { font-size: 13px; }
.set-row .txt span { font-size: 11px; line-height: 1.6; }
.service { border-radius: 12px; box-shadow: none; }
.service-ico { width: 39px; height: 39px; border-radius: 10px; box-shadow: none; }
.service .txt b { font-size: 12px; }
.service .txt span { font-size: 10px; }
.theme { border-radius: 12px; padding: 9px; box-shadow: none; }
.theme.on { box-shadow: 0 0 0 2px rgba(var(--c1), .13); }
.theme .sw { border-radius: 7px; height: 40px; box-shadow: none; }
.theme b { font-size: 11px; }
.theme span { font-size: 9px; }
.profile { gap: 13px; flex-wrap: wrap; }
.profile .avatar.xl { width: 62px; height: 62px; }
.profile .txt b { font-size: 15px; }
.profile .txt > span { font-size: 11px; }
.profile .btns { gap: 6px; }
.profile .btns .btn { height: 32px; padding: 0 11px; font-size: 10px; }
.modal-bg { z-index: 80; background: color-mix(in srgb, rgba(var(--c1), .66) 10%, rgba(7, 9, 13, .66)); }
.modal { background: var(--panel-bg); border-color: rgba(var(--c1), .25); }
.modal p { font-size: 13px; }
.auth-box .logo { padding: 0; }
.auth-box .card { background: color-mix(in srgb, rgba(var(--c1), .92) 10%, rgba(7, 9, 13, .92)); border-radius: 22px; }
.auth-box .field { border-radius: 12px; }
.auth-box .tagline { color: var(--muted); font-size: 13px; }
.auth-box .btn.primary { font-size: 13px; }
body.room-custom .player-view .card { background: color-mix(in srgb, rgba(var(--c1), .64) 10%, rgba(7, 9, 13, .64)); backdrop-filter: blur(22px); -webkit-backdrop-filter: blur(22px); }
body.room-custom .context-panel { background: color-mix(in srgb, rgba(var(--c1), .9) 10%, rgba(7, 9, 13, .9)); backdrop-filter: blur(20px); -webkit-backdrop-filter: blur(20px); }

@media (min-width: 1600px) {
  :root { --sidebar-width: 258px; --context-width: 338px; }
  .shell { gap: 15px; padding-right: 15px; padding-left: 15px; }
  .home-hero { min-height: 320px; grid-template-columns: 238px minmax(0, 1fr); padding: 28px 28px 20px; gap: 22px 30px; }
  .hero-art { width: 238px; height: 238px; }
  .hero-copy h1 { font-size: 48px; }
  .track-shelf { gap: 15px; }
  .playlist-tile { height: 157px; }
}
@media (max-width: 1399px) {
  :root { --sidebar-width: 210px; --context-width: 292px; }
  .shell { gap: 10px; padding-left: 10px; padding-right: 10px; }
  .sidebar { padding-left: 7px; padding-right: 7px; }
  .logo { font-size: 34px; padding-left: 13px; }
  .nav { gap: 12px; font-size: 13px; padding-left: 13px; }
  .nav svg.i { width: 20px; height: 20px; }
  .side-toggle { width: 24px; }
  .library-item { gap: 9px; }
  .library-art { width: 38px; height: 38px; }
  .library-copy b { font-size: 12px; }
  .library-copy span { font-size: 10px; }
  .app-header { gap: 10px; }
  .global-search { padding-left: 12px; gap: 8px; }
  .global-search input { font-size: 12px; }
  .history-controls .iconbtn { width: 31px; }
  .home-hero { min-height: 256px; grid-template-columns: 174px minmax(0, 1fr); padding: 23px 21px 16px; gap: 18px 20px; }
  .hero-art { width: 174px; height: 174px; border-radius: 15px; }
  .hero-copy h1 { font-size: 32px; }
  .hero-artist { font-size: 16px; }
  .hero-top-actions { top: 13px; right: 13px; }
  .hero-top-actions .iconbtn { width: 29px; height: 29px; }
  .hero-source { margin-top: 12px; padding: 5px 9px; font-size: 11px; }
  .hero-actions { gap: 14px; margin-top: 13px; }
  .hero-actions .playbtn { width: 44px; height: 44px; }
  .eyebrow { font-size: 10px; }
  .home-filters { gap: 6px; padding-top: 15px; padding-bottom: 18px; }
  .filter-chip { font-size: 11px; padding: 0 11px; height: 34px; }
  .track-shelf { grid-auto-columns: minmax(102px, 1fr); gap: 11px; }
  .section-heading h2 { font-size: 18px; }
  .playlist-tile { height: 124px; }
  .playlist-info { left: 10px; bottom: 10px; }
  .playlist-info b { font-size: 12px; }
  .context-panel .qrow { gap: 7px; padding-right: 6px; }
  .context-panel .qrow .cover { width: 35px; height: 39px; }
  .context-panel .qrow .tt b, .context-panel .queue-title { font-size: 11px; }
  .context-panel .qrow .tt span { font-size: 10px; }
  .context-tabs { gap: 17px; padding: 0 14px; }
  .context-tab { font-size: 13px; }
  .player { grid-template-columns: minmax(240px, 1fr) minmax(230px, 1.4fr) minmax(170px, .8fr); gap: 17px; }
  .player .right { gap: 10px; }
  .vol { width: 77px; }
  .player .np { gap: 9px; }
  .player .np .iconbtn { width: 26px; }
  .player-view .now { gap: 20px; padding: 22px; }
  .player-view .now .cover { width: 155px; height: 155px; }
  .player-view .now .title { font-size: 29px; }
  .player-view .now .artist { font-size: 14px; }
  .frow { grid-template-columns: 20px 36px minmax(0, 1fr) 36px 110px; gap: 8px; }
  .frow .cover { width: 36px; height: 36px; }
  .frow .alb { display: none; }
  .pl-row { grid-template-columns: 20px 36px minmax(0, 1fr) 36px auto; }
  .home-welcome { min-height: 256px; padding: 28px; }
  .home-welcome h1 { font-size: 35px; }
  .home-grid { grid-template-columns: 1fr; }
  .themes { gap: 9px; grid-template-columns: repeat(3, 1fr); }
}
@media (max-width: 1199px) {
  .shell, .shell.collapsed { grid-template-columns: 76px minmax(0, 1fr); }
  .sidebar { padding: 19px 9px 9px; }
  .side-top { min-height: 38px; justify-content: center; margin-bottom: 16px; }
  .sidebar .logo { display: none; }
  .sidebar .side-toggle { display:grid; background:none; border:0; }
  .sidebar .side-toggle > svg { display:none; }
  .sidebar .side-letter { display:block; }
  .side-toggle { margin: 0; width: 36px; height: 36px; }
  .nav { justify-content: center; padding: 12px 0; }
  .nav span { display: none; }
  .side-library { margin-top: 12px; }
  .library-head { justify-content: center; padding: 0 0 8px; }
  .library-head > span, .library-copy, .library-empty { display: none; }
  .library-all { display: none; }
  .library-item { justify-content: center; padding: 4px 0; }
  .library-art { width: 40px; height: 40px; }
  .side-room { padding: 11px 0; display: grid; place-items: center; margin: 6px 0; }
  .side-room > :not(.sr-ico) { display: none; }
  .side-room .sr-ico { display: grid; place-items: center; height: 22px; }
  #me { min-height: 50px; padding: 8px 0; justify-content: center; background: none; border-color: transparent; }
  #me .who, #me > .iconbtn { display: none; }
  .context-panel { position: absolute; top: 52px; bottom: 106px; right: 10px; width: 326px; margin-top: 0; z-index: 32; background: color-mix(in srgb, rgba(var(--c1), .98) 10%, rgba(7, 9, 13, .98)); box-shadow: -12px 0 50px color-mix(in srgb, rgba(var(--c1), .5) 10%, rgba(7, 9, 13, .5)); visibility: hidden; opacity: 0; transform: translateX(18px); transition: opacity .18s, transform .18s, visibility .18s; }
  .shell.context-open .context-panel { visibility: visible; opacity: 1; transform: none; }
  .context-close, .header-actions .queue-toggle { display: grid; }
  .player .right .queue-toggle { display: grid; }
  .shell.context-open .context-scrim { display: block; position: absolute; inset: 0 0 106px; background: color-mix(in srgb, rgba(var(--c1), .5) 10%, rgba(7, 9, 13, .5)); backdrop-filter: blur(3px); -webkit-backdrop-filter: blur(3px); z-index: 30; border-radius: 20px; }
  .app-header { gap: 12px; }
  .global-search input { font-size: 13px; }
  .history-controls .iconbtn { width: 35px; }
  .home-hero { min-height: 280px; grid-template-columns: 202px minmax(0, 1fr); padding: 23px 25px 17px; gap: 19px 28px; }
  .hero-art { width: 202px; height: 202px; }
  .hero-copy h1 { font-size: 40px; }
  .hero-copy { padding-right: 20px; }
  .hero-artist { font-size: 18px; }
  .hero-source { margin-top: 15px; font-size: 11px; }
  .hero-actions { margin-top: 15px; gap: 20px; }
  .hero-actions .playbtn { width: 48px; height: 48px; }
  .track-shelf { grid-auto-columns: minmax(114px, 1fr); }
  .playlist-shelf { grid-template-columns: repeat(5, minmax(0, 1fr)); }
  .playlist-tile { height: 138px; }
  .context-panel .qrow .tt b, .context-panel .queue-title { font-size: 12px; }
  .context-panel .qrow .tt span { font-size: 11px; }
  .player { grid-template-columns: minmax(240px, 1fr) minmax(270px, 1.25fr) minmax(160px, .8fr); gap: 17px; }
  .vol { width: 87px; }
  .player-view .now .cover { width: 190px; height: 190px; }
  .player-view .now .title { font-size: 36px; }
  .view { padding-left: 16px; padding-right: 16px; }
  .home-grid { grid-template-columns: 1fr 1fr; }
  .frow { grid-template-columns: 24px 40px minmax(0, 1.5fr) minmax(0, 1fr) 40px 112px; }
  .frow .cover { width: 40px; height: 40px; }
  .frow .alb { display: block; }
  .pl-row { grid-template-columns: 24px 40px minmax(0, 1fr) 40px auto; }
  .themes { grid-template-columns: repeat(4, 1fr); }
}
@media (max-height: 780px) {
  .shell { grid-template-rows: minmax(0, 1fr) 78px; gap: 10px; padding-bottom: 10px; }
  .player { height: 78px; }
  .sidebar { padding-top: 15px; }
  .logo { padding-bottom: 18px; }
  .nav { min-height: 40px; padding-top: 9px; padding-bottom: 9px; }
  .side-library { margin-top: 10px; padding-top: 9px; }
  .library-item { margin-bottom: 2px; }
  .library-art { width: 36px; height: 36px; }
  #me { min-height: 50px; }
  .app-header { height: 49px; min-height: 49px; padding-bottom: 10px; }
  .context-panel { margin-top: 49px; }
  .home-hero { min-height: 226px; grid-template-columns: 154px minmax(0, 1fr); padding: 18px 22px 15px; gap: 13px 23px; }
  .hero-art { width: 154px; height: 154px; border-radius: 13px; }
  .hero-copy h1 { font-size: 32px; margin-top: 7px; }
  .hero-artist { font-size: 15px; }
  .hero-source { margin-top: 10px; font-size: 10px; padding: 4px 9px; }
  .hero-actions { margin-top: 11px; gap: 16px; }
  .hero-actions .playbtn { width: 41px; height: 41px; }
  .hero-actions .playbtn svg { width: 20px; height: 20px; }
  .hero-top-actions { top: 12px; right: 12px; }
  .hero-top-actions .iconbtn { width: 29px; height: 29px; }
  .hero-timeline { font-size: 11px; }
  .home-filters { padding-top: 13px; padding-bottom: 15px; }
  .home-section { margin-bottom: 18px; }
  .section-heading { margin-bottom: 10px; }
  .section-heading h2 { font-size: 16px; }
  .track-shelf { grid-auto-columns: minmax(102px, 1fr); gap: 12px; }
  .track-art { aspect-ratio: 1.1; }
  .playlist-tile { height: 112px; }
  .home-welcome { min-height: 226px; padding: 25px 29px; }
  .home-welcome h1 { font-size: 32px; margin-top: 10px; }
  .home-welcome p { font-size: 12px; }
  .welcome-actions { margin-top: 17px; }
  .player-view .now { padding: 20px; }
  .player-view .now .cover { width: 154px; height: 154px; }
  .player-view .now .title { font-size: 31px; -webkit-line-clamp: 2; }
  .player-collection { margin-top: 20px; }
  .controls .btns { gap: 18px; }
  .controls .playbtn { width: 38px; height: 38px; }
  .controls { gap: 4px; }
  .view { padding-top: 14px; }
}
@media (max-width: 1199px) and (max-height: 780px) {
  .context-panel { top: 49px; bottom: 98px; margin-top: 0; }
  .shell.context-open .context-scrim { bottom: 98px; }
  .sidebar, .shell.collapsed .sidebar { padding-top: 15px; }
  .side-top, .shell.collapsed .side-top { margin-bottom: 10px; }
  .library-art, .shell.collapsed .library-art { width: 36px; height: 36px; }
}
@media (max-width: 899px) {
  .shell, .shell.collapsed { grid-template-columns: 64px minmax(0, 1fr); padding-left: 8px; padding-right: 8px; gap: 9px; }
  .sidebar, .shell.collapsed .sidebar { border-radius: 17px; padding-left: 5px; padding-right: 5px; }
  .app-header { gap: 8px; }
  .history-controls { gap: 4px; }
  .history-controls .iconbtn { width: 29px; height: 35px; }
  .global-search { height: 37px; gap: 7px; }
  .global-search input { font-size: 11px; }
  .global-search kbd { display: none; }
  .header-actions { gap: 3px; }
  .header-actions .iconbtn { width: 30px; }
  .home-hero { grid-template-columns: 148px minmax(0, 1fr); gap: 15px 21px; padding: 22px 20px 16px; min-height: 236px; }
  .hero-art { width: 148px; height: 148px; }
  .hero-copy h1 { font-size: 30px; }
  .hero-top-actions .iconbtn { width: 27px; height: 27px; }
  .hero-artist { font-size: 14px; }
  .hero-actions { gap: 16px; }
  .hero-source { font-size: 10px; padding: 4px 8px; }
  .playlist-shelf { grid-template-columns: none; grid-auto-flow: column; grid-auto-columns: 150px; overflow-x: auto; padding-bottom: 4px; }
  .track-shelf { grid-auto-columns: 113px; }
  .player { grid-template-columns: minmax(190px, 1fr) minmax(230px, 1.3fr) 115px; padding: 0 12px; gap: 13px; }
  .player .np .cover { width: 43px; height: 46px; }
  .player .np b { font-size: 11px; }
  .player .np span { font-size: 9px; }
  .player .np > .iconbtn:last-child { display: none; }
  .player .right { gap: 8px; }
  .player .right .sync { display: none; }
  .vol { width: 61px; }
  .player .right > .iconbtn { display: none; }
  .player-view .now .cover { width: 148px; height: 148px; }
  .player-view .now .title { font-size: 29px; }
  .frow { grid-template-columns: 20px 36px minmax(0, 1fr) 36px 110px; }
  .frow .alb { display: none; }
  .frow .cover { width: 36px; height: 36px; }
  .pl-row { grid-template-columns: 20px 36px minmax(0, 1fr) 36px auto; }
  .themes { grid-template-columns: repeat(3, 1fr); }
  .home-grid { grid-template-columns: 1fr; }
  .services { grid-template-columns: 1fr; }
  .pl-head .mosaic.big { width: 114px; }
  .pl-title { font-size: 25px; }
}
@media (max-width: 679px) {
  .shell, .shell.collapsed { grid-template-columns: 54px minmax(0, 1fr); grid-template-rows: minmax(0, 1fr) 73px; gap: 7px; padding: 0 6px 7px; }
  .sidebar, .shell.collapsed .sidebar { padding-left: 2px; padding-right: 2px; border-radius: 14px; }
  .nav { min-height: 39px; }
  .nav svg.i { width: 18px; height: 18px; }
  .library-art, .shell.collapsed .library-art { width: 32px; height: 32px; }
  .library-head .iconbtn { width: 24px; height: 24px; }
  #me .avatar { width: 29px; height: 29px; }
  .history-controls { display: none; }
  .global-search { padding: 0 10px; }
  .global-search > svg { width: 15px; height: 15px; }
  .global-search input { font-size: 10px; }
  .main .search-view { padding: 12px 7px 22px; }
  .search-view .h1 { font-size: 24px; }
  .search-hint { display: none; }
  .search-results { margin-top: 17px; }
  .search-results > .trow { gap: 9px; padding: 9px 4px; }
  .trow > button.cover { width: 36px; height: 39px; }
  .trow .tt .track-title { font-size: 11px; }
  .trow .tt > span { font-size: 10px; }
  .search-results .trow > .iconbtn { width: 25px; height: 29px; }
  .search-results .trow > .iconbtn svg { width: 14px; height: 14px; }
  .header-actions .iconbtn { width: 28px; }
  .home-hero { grid-template-columns: 90px minmax(0, 1fr); gap: 16px 14px; padding: 34px 14px 15px; min-height: 210px; border-radius: 16px; }
  .hero-art { width: 90px; height: 108px; border-radius: 10px; }
  .hero-copy { padding-right: 0; }
  .hero-copy h1 { font-size: 24px; margin-top: 6px; }
  .hero-artist { font-size: 11px; }
  .eyebrow { font-size: 7px; letter-spacing: .12em; }
  .hero-source { display: none; }
  .hero-actions { gap: 9px; margin-top: 12px; }
  .hero-actions .playbtn { width: 35px; height: 35px; }
  .hero-actions .iconbtn { width: 22px; height: 26px; }
  .hero-actions .iconbtn svg { width: 17px; height: 17px; }
  .hero-top-actions { top: 8px; right: 8px; gap: 5px; }
  .hero-top-actions .iconbtn { width: 23px; height: 23px; }
  .hero-top-actions .iconbtn svg { width: 12px; height: 12px; }
  .hero-copy:has(.hero-source) > .eyebrow { padding-right: 0; }
  .hero-timeline { gap: 8px; font-size: 9px; }
  .home-filters { gap: 6px; padding-top: 13px; padding-bottom: 16px; }
  .filter-chip { font-size: 9px; height: 29px; padding: 0 10px; }
  .section-heading { gap: 8px; }
  .section-heading h2 { font-size: 15px; }
  .section-heading > button, .section-heading > a { font-size: 9px; }
  .track-shelf { grid-auto-columns: 108px; gap: 11px; }
  .playlist-shelf { grid-template-columns: none; grid-auto-columns: 142px; gap: 10px; }
  .playlist-tile { height: 126px; }
  .context-panel { right: 6px; top: 49px; bottom: 87px; width: min(330px, calc(100% - 24px)); border-radius: 16px; }
  .shell.context-open .context-scrim { bottom: 87px; }
  .player { height: 73px; border-radius: 16px; padding: 0 10px; gap: 9px; grid-template-columns: minmax(0, 1fr) minmax(150px, 1.1fr); }
  .player .np { gap: 8px; }
  .player .np .cover { width: 35px; height: 38px; border-radius: 7px; }
  .player .np b { font-size: 10px; }
  .player .np span { font-size: 8px; }
  .player .np > .iconbtn { display: none; }
  .player > .right { display: none; }
  .controls .btns { gap: 13px; }
  .controls .btns > .iconbtn { width: 24px; height: 24px; }
  .controls .playbtn { width: 32px; height: 32px; }
  .controls .playbtn svg { width: 16px; height: 16px; }
  .progress { gap: 6px; font-size: 8px; }
  .progress > span { min-width: 22px; }
  input[type="range"] { height: 4px; }
  .home-welcome { min-height: 245px; padding: 23px 20px; }
  .home-welcome h1 { font-size: 29px; }
  .home-welcome p { font-size: 11px; }
  .welcome-actions { gap: 7px; margin-top: 17px; }
  .welcome-actions .btn { height: 34px; font-size: 10px; padding: 0 12px; }
  .home-section .home-welcome { padding: 18px 16px; gap: 11px; flex-wrap: wrap; }
  .home-section .home-welcome h3 { font-size: 12px; }
  .home-section .home-welcome p { font-size: 10px; }
  .home-section .home-welcome > .btn { margin-left: 53px; }
  .view { padding: 12px 7px 22px; }
  .h1 { font-size: 24px; }
  .player-view .room-head .nm { font-size: 17px; }
  .player-view .now { gap: 14px; padding: 17px; align-items: center; }
  .player-view .now .cover { width: 90px; height: 105px; border-radius: 10px; }
  .player-view .now .title { font-size: 23px; }
  .player-view .now .artist { font-size: 11px; }
  .player-view .now .lbl { font-size: 8px; }
  .player-view .now .by { font-size: 9px; margin-top: 9px; }
  .frow { grid-template-columns: 30px minmax(0, 1fr) 30px 84px; gap: 5px; }
  .frow .n { display: none; }
  .frow .cover { width: 30px; height: 33px; }
  .frow .acts .iconbtn { width: 25px; }
  .frow .acts .iconbtn svg { width: 13px; height: 13px; }
  .frow .acts .iconbtn:nth-last-child(n+4) { display: none; }
  .pl-row { grid-template-columns: 30px minmax(0, 1fr) 30px auto; }
  .pl-head { gap: 13px; align-items: flex-start; }
  .pl-head .mosaic.big { width: 82px; }
  .pl-title { font-size: 22px; }
  .pl-head .row { gap: 5px; }
  .pl-head .row .btn { height: 29px; padding: 0 8px; font-size: 9px; }
  .pl-head .row .btn svg { width: 13px; height: 13px; }
  .pl-grid { grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 10px; }
  .fav-head { gap: 9px; }
  .fav-head .grow { flex-basis: 100%; }
  .fav-head .searchbox { max-width: none; flex: 1; min-width: 100px; }
  .set-row { flex-wrap: wrap; }
  .set-row .txt { min-width: 130px; }
  .card { padding: 15px; border-radius: 14px; }
  .themes { grid-template-columns: repeat(2, 1fr); }
  .auth-box { width: min(390px, calc(100% - 26px)); }
}
@media (prefers-reduced-transparency: reduce) {
  .sidebar, .context-panel, .player, .card, .modal { background-color: var(--panel-bg); backdrop-filter: none; -webkit-backdrop-filter: none; }
  .shell.context-open .context-scrim { backdrop-filter: none; -webkit-backdrop-filter: none; }
}
@media (prefers-reduced-motion: reduce) {
  :root { --motion-distance:0px; --motion-scale:1; --hover-lift:0px; }
  .role-name, .role-badge { animation:none !important; }
  body:not(.live-bg) .orbs i { animation:none !important; }
  * { scroll-behavior:auto !important; }
}

/* Artwork-responsive foundations; no fixed blue overrides on themed surfaces. */
body { background: var(--bg); }
.titlebar .brand { visibility: hidden; }
.titlebar .net { color: var(--muted); }
.playbtn, .btn.primary { color: var(--on-accent); background: linear-gradient(135deg, rgb(var(--c1)), color-mix(in srgb, rgb(var(--c1)) 88%, #10131a)); border-color: rgba(var(--c1), .7); }
.playbtn { box-shadow: inset 0 1px 0 rgba(255,255,255,.35), 0 0 22px rgba(var(--c1), .28); }
.iconbtn.on, .text-link, .library-all, .player .np .iconbtn.on { color: rgb(var(--c1)); }
.library-likes, .library-item .mosaic.likes, .playlist-tile .mosaic.likes { background: linear-gradient(135deg, rgb(var(--c1)), rgb(var(--c2))); color: var(--on-accent); }
.filter-chip.on { background: linear-gradient(120deg, rgba(var(--c1),.34), rgba(var(--c2),.32)); border-color: rgba(var(--c1),.7); box-shadow: 0 0 16px rgba(var(--c1),.16), inset 0 0 0 1px rgba(var(--c1),.12); }
.player#player {
  border:0; box-shadow:none;
  background:radial-gradient(ellipse at 12% 100%,rgba(var(--c3),.12),transparent 55%),
    linear-gradient(110deg,color-mix(in srgb,rgb(var(--c1)) 24%,#101219),color-mix(in srgb,rgb(var(--c2)) 22%,#101219) 58%,color-mix(in srgb,rgb(var(--c3)) 19%,#101219));
}
.home-hero { background: radial-gradient(ellipse at 36% 0, rgba(var(--c2),.55), transparent 65%), linear-gradient(115deg, color-mix(in srgb, rgb(var(--c1)) 36%, #11151b), var(--panel-bg)); border-color: rgba(var(--c1),.42); }
.hero-ambient { opacity: .32; mix-blend-mode: normal; filter: blur(8px) saturate(.9); }
.hero-copy .eyebrow, .hero-artist, .hero-timeline, .hero-source, .hero-added-by { color: var(--muted); }
.hero-copy h1 { color: var(--text); }
.hero-source { background: rgba(3,5,8,.22); border-color: rgba(var(--c1),.3); }
.hero-source svg { color: rgb(var(--c1)); }
.hero-actions .iconbtn { color: var(--text); }
.card, .pl-menu, .context-panel .qrow .acts, .emoji-pop { background: var(--panel-bg); border-color: var(--panel-line); }
.field, .global-search, .tabs { background: rgba(0,0,0,.18); border-color: var(--edge-soft); }
.context-panel { background: var(--glass); }
.context-tab.on::after { background: rgb(var(--c1)); }
.context-tab > span { color: var(--text); }
.hero-art, .cover { aspect-ratio: 1; }
.hero-artist { white-space: normal; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
.hero-art { max-width: 100%; }
.track-title, .playlist-info b, .queue-title { line-height: 1.45; }
.player .np .cover, .context-panel .qrow .cover { aspect-ratio: 1; height: auto; }
.btn:disabled, .iconbtn:disabled, .playbtn:disabled { opacity: .4; pointer-events: none; }

/* Full-width product pages follow the same shell as the reference. */
.shell:not(.view-home) { grid-template-columns: var(--sidebar-width) minmax(0,1fr); }
.shell.collapsed:not(.view-home) { grid-template-columns: 76px minmax(0,1fr); }
.shell:not(.view-home) > .context-panel { position: absolute; top: 52px; right: 12px; bottom: 108px; width: 340px; margin: 0; z-index: 32; visibility: hidden; opacity: 0; transform: translateX(16px); background: var(--panel-bg); }
.shell:not(.view-home).context-open > .context-panel { visibility: visible; opacity: 1; transform: none; box-shadow: 0 12px 70px #0008; }
.shell:not(.view-home).context-open .context-scrim { display: block; position: absolute; inset: 0 0 108px; z-index:30; background: #0006; backdrop-filter: blur(4px); }
.shell:not(.view-home) .context-close, .shell:not(.view-home) .header-actions .queue-toggle { display: grid; }
.player .right .queue-toggle { display: grid; }
.main > .view:not(.home-view) { padding: 24px 28px 32px; }
.page-heading { display:flex; align-items:center; justify-content:space-between; gap:20px; margin-bottom:24px; }
.page-heading .sub { max-width:650px; margin-top:8px; }
.page-heading .h1 { font-size:28px; }
.page-heading > .btn { flex:none; }
.page-tabs { display:flex; align-items:center; gap:8px; padding-bottom:20px; margin-top:20px; overflow-x:auto; }
.page-tabs button { display:flex; justify-content:center; align-items:center; gap:7px; min-height:36px; padding:0 18px; border:1px solid var(--edge-soft); border-radius:999px; font-size:12px; color:var(--muted); white-space:nowrap; background:rgba(0,0,0,.13); }
.page-tabs button.on { color:var(--text); border-color:rgba(var(--c1),.55); background:linear-gradient(120deg,rgba(var(--c1),.24),rgba(var(--c2),.16)); box-shadow:0 0 20px rgba(var(--c1),.08); }
.page-tabs svg { width:15px; height:15px; }
.inline-search { display:flex; align-items:center; gap:9px; min-width:0; height:37px; padding:0 12px; border:1px solid var(--edge-soft); border-radius:10px; background:rgba(0,0,0,.14); }
.inline-search input { background:none; border:0; outline:0; width:100%; min-width:0; font-size:12px; }
.inline-search svg { width:16px; height:16px; color:var(--muted); }
select.field { width:auto; min-width:135px; height:37px; color:var(--text); }
select option { background:var(--panel-bg); }
.catalog-toolbar { display:flex; gap:10px; align-items:center; margin-bottom:20px; flex-wrap:wrap; }
.catalog-toolbar .inline-search { flex:1; min-width:200px; }
.catalog-grid { display:grid; grid-template-columns:repeat(auto-fill,minmax(170px,1fr)); gap:18px; }
.catalog-grid .playlist-tile { height:auto; aspect-ratio:1; border-radius:16px; }
.catalog-grid .playlist-info b { font-size:15px; }
.catalog-grid .playlist-info span { font-size:12px; }
.catalog-grid .playlist-tile .mosaic.likes svg { width:44px; height:44px; }
.catalog-count { color:var(--dim); font-size:12px; }

/* Focused player: centered artwork and controls instead of a second home page. */
.main > .player-view { display:flex; flex-direction:column; padding:12px 18px 18px !important; }
.player-view .room-head { flex:none; min-height:40px; padding:0 6px 12px; }
.player-view .room-head .nm { font-size:18px; }
.listening-stage { position:relative; isolation:isolate; flex:1; min-height:0; border:1px solid var(--edge-soft); border-radius:22px; overflow:hidden; background:radial-gradient(ellipse at 35% 10%,rgba(var(--c1),.2),transparent 70%),var(--panel-bg); display:flex; align-items:center; justify-content:center; padding:26px; }
.stage-ambient { position:absolute; z-index:-1; inset:-10%; background:center/cover; filter:blur(55px) saturate(1.1); opacity:.23; pointer-events:none; }
.stage-content { width:min(100%,520px); display:flex; flex-direction:column; align-items:center; gap:18px; }
.stage-art { width:min(32vh,290px); aspect-ratio:1; border-radius:18px; background:rgba(0,0,0,.2) center/cover; box-shadow:0 18px 65px #0005; display:grid; place-items:center; flex:none; }
.stage-art > svg { width:70px; height:70px; color:var(--muted); }
.stage-meta { width:100%; display:flex; align-items:center; gap:18px; }
.stage-meta > div:first-child { flex:1; min-width:0; text-align:center; padding-left:78px; }
.stage-meta h1 { font-size:26px; letter-spacing:-.035em; line-height:1.2; overflow:hidden; display:-webkit-box; -webkit-line-clamp:2; -webkit-box-orient:vertical; }
.stage-meta p { margin-top:7px; font-size:15px; color:var(--muted); text-align:center; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.stage-tools { display:flex; gap:6px; }
.stage-timeline { display:flex; align-items:center; gap:14px; width:100%; font-size:12px; color:var(--muted); font-variant-numeric:tabular-nums; }
.stage-timeline input { flex:1; }
.stage-controls { display:flex; align-items:center; justify-content:center; gap:32px; }
.stage-controls .playbtn { width:56px; height:56px; }
.stage-controls .iconbtn { width:38px; height:38px; }
.stage-controls svg { width:23px; height:23px; }
.stage-empty { display:flex; flex-direction:column; align-items:center; gap:18px; text-align:center; }
.stage-empty h1 { font-size:26px; letter-spacing:-.03em; }
.stage-empty p { color:var(--muted); }
.listening-stage .hero-added-by { margin-top:0; }

/* Rooms use two clear entry actions and a separate room library. */
.room-entry-grid { display:grid; grid-template-columns:1fr 1fr; gap:20px; margin:24px 0 30px; }
.room-entry-card { border:1px solid var(--panel-line); background:linear-gradient(140deg,rgba(var(--c1),.14),rgba(var(--c2),.06)),var(--panel-bg); padding:28px; border-radius:18px; }
.room-entry-icon { width:48px; height:48px; border-radius:13px; background:rgba(var(--c1),.25); display:grid; place-items:center; color:var(--text); margin-bottom:20px; }
.room-entry-icon svg { width:25px; height:25px; }
.room-entry-card h2 { font-size:21px; letter-spacing:-.03em; margin-bottom:8px; }
.room-entry-card p { color:var(--muted); font-size:13px; line-height:1.7; min-height:45px; max-width:420px; margin-bottom:22px; }
.room-entry-card .field { width:100%; height:42px; font-size:13px; margin-bottom:10px; }
.room-entry-card > .btn { width:100%; font-size:13px; }
.room-entry-card .code-input { text-align:left; font:500 13px Manrope; letter-spacing:.08em; }
.room-grid { display:grid; grid-template-columns:repeat(auto-fill,minmax(180px,1fr)); gap:16px; }
.room-tile { position:relative; text-align:left; min-height:170px; border-radius:15px; border:1px solid var(--edge-soft); overflow:hidden; background:linear-gradient(140deg,rgba(var(--c1),.18),rgba(var(--c2),.1)); padding:18px; display:flex; align-items:flex-end; }
.room-tile .room-art { position:absolute; inset:0; background:center/cover; opacity:.65; }
.room-tile::after { content:""; position:absolute; inset:0; background:linear-gradient(transparent,#05070be8); }
.room-tile .info { position:relative; z-index:1; min-width:0; }
.room-tile .t { font-size:15px; font-weight:750; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.room-tile .m { color:#c7cbd3; font-size:12px; margin-top:5px; }

/* Playlist details share a consistent table with the likes screen. */
.playlist-detail .pl-head, .likes-detail .pl-head { border-bottom:1px solid var(--edge-soft); padding-bottom:24px; margin-bottom:22px; }
.pl-head .mosaic.big, .likes-detail .likes-art { width:168px; height:168px; border-radius:17px; box-shadow:0 12px 30px #0003; }
.pl-title { font-size:32px; line-height:1.2; }
.track-table-head { display:grid; grid-template-columns:30px 44px minmax(0,1fr) 170px 54px 120px; gap:12px; padding:10px 12px; border-bottom:1px solid var(--edge-soft); color:var(--dim); font-size:11px; }
.pl-row { display:grid; grid-template-columns:30px 44px minmax(0,1fr) 170px 54px 120px; gap:12px; padding:9px 12px; border-radius:10px; min-height:62px; }
.pl-row .track-primary { min-width:0; }
.pl-row .track-primary b { font-size:13px; }
.pl-row .track-primary span { font-size:11px; }
.pl-row .track-artist { font-size:12px; color:var(--muted); white-space:nowrap; text-overflow:ellipsis; overflow:hidden; }
.pl-row .cover { width:44px; height:44px; }
.pl-row .d { font-size:12px; }
.pl-row .acts { min-width:0; }
#pl-tracks, .fav-list { padding:0; background:none; border:0; }
.playlist-add-area { margin-bottom:16px; }
.playlist-add-area > .searchbox { max-width:480px; }
.playlist-detail .catalog-toolbar { margin-top:20px; }
.frow { min-width:0; }
.frow > * { min-width:0; }
.settings-page .settings { max-width:none; width:100%; margin-top:0; }
.settings-pane { display:flex; flex-direction:column; gap:16px; }
.settings-pane .card { padding:24px; border-radius:16px; }
.settings-pane .themes { grid-template-columns:repeat(5,minmax(0,1fr)); gap:12px; }
.settings-pane .theme { padding:10px; min-width:0; border-radius:12px; text-align:left; }
.settings-pane .theme .sw { height:60px; border-radius:9px; }
.settings-pane .theme b { font-size:12px; }
.settings-pane .theme span { font-size:11px; }
.settings-pane .set-row .txt b { font-size:15px; }
.settings-pane .set-row .txt span { font-size:12px; }
.session-list { list-style:none; margin:0 0 20px; padding:0; }
.session-row { display:flex; align-items:center; justify-content:space-between; flex-wrap:wrap; gap:16px; padding:18px 0; border-bottom:1px solid var(--border); }
.session-row .txt { min-width:0; flex:1 1 220px; overflow-wrap:anywhere; }
.session-row .txt b,.session-row .txt > span { display:block; }
.session-row .txt > span,.session-status { font-size:12px; line-height:1.7; color:var(--muted); }
.session-current { display:inline-block; font-size:11px; font-weight:500; color:var(--muted); margin-left:8px; }
.session-status { margin:12px 0 0; }
.profile-sessions { padding-bottom:28px; margin-bottom:28px; border-bottom:1px solid var(--border); }
.profile-sessions h2 { margin:0 0 6px; font-size:19px; letter-spacing:-.025em; }
.profile-sessions .set-row { flex-wrap:wrap; }
.profile-discord { padding-bottom:28px; margin-bottom:28px; border-bottom:1px solid var(--border); }
.profile-discord .profile-section-heading { margin-bottom:16px; }
.profile-discord-row { display:flex; flex-wrap:wrap; align-items:center; gap:10px 16px; }
.profile-discord-state { display:inline-flex; align-items:center; gap:7px; font-size:13px; color:var(--muted); }
.profile-discord-state b { color:var(--text); font-weight:600; overflow-wrap:anywhere; }
.profile-discord-state .i { width:15px; height:15px; color:rgb(var(--c1)); }
.profile-discord-help { flex-basis:100%; margin:0; font-size:12px; line-height:1.6; color:var(--muted); }
.settings-pane .services { display:grid; grid-template-columns:repeat(2,minmax(0,1fr)); gap:12px; }
.settings-pane .service { margin:0; padding:15px; }
.admin-page .page-tabs { margin-top:0; }
.admin-page #admin-rooms { display:flex; flex-direction:column; gap:8px; }
.admin-page .admin-room { border-radius:12px; padding:13px 16px; min-height:76px; background:rgba(var(--c1),.035); align-items:center; }
.admin-page .admin-room .cover { width:48px; height:48px; }
.admin-page .admin-room .t { font-size:14px; }
.admin-page .admin-room .m { font-size:12px; }
.admin-page .admin-room-acts { flex-direction:row; }
.admin-pane .admin-box { margin-bottom:20px; }
.queue-layout { display:flex; min-height:0; flex:1; }
.queue-page { display:flex; flex-direction:column; }
#queue-host { display:flex; flex:1; min-height:0; min-width:0; }
.queue-layout .context-panel { display:flex; position:static; width:100%; margin:0; visibility:visible; opacity:1; transform:none; flex:1; }
.queue-layout .context-panel .qrow { min-height:64px; }
.queue-layout .context-panel .qrow .cover { width:42px; }
.queue-layout .context-panel .qrow .tt { flex:1; }
@media(min-width:1440px) { .catalog-grid { grid-template-columns:repeat(5,minmax(0,1fr)); } }
@media(max-width:1199px) {
  .shell:not(.view-home), .shell.collapsed:not(.view-home) { grid-template-columns:76px minmax(0,1fr); }
  .main > .view:not(.home-view) { padding:20px; }
  .settings-pane .themes { grid-template-columns:repeat(5,minmax(0,1fr)); }
  .stage-art { width:min(32vh,250px); }
  .track-table-head, .pl-row { grid-template-columns:24px 40px minmax(0,1fr) 130px 48px 100px; gap:9px; }
  .queue-layout .context-panel { inset:auto; }
  .context-panel { background:var(--panel-bg); }
}
@media(max-height:780px) {
  .stage-content { gap:13px; }
  .stage-art { width:min(29vh,200px); }
  .stage-meta h1 { font-size:23px; }
  .stage-controls .playbtn { width:48px; height:48px; }
  .listening-stage { padding:18px; }
  .room-entry-card { padding:22px; }
  .room-entry-card p { min-height:0; margin-bottom:18px; }
}
@media(max-width:899px) {
  .room-entry-grid { gap:12px; }
  .room-entry-card { padding:19px; }
  .settings-pane .themes { grid-template-columns:repeat(3,minmax(0,1fr)); }
  .settings-pane .services { grid-template-columns:1fr; }
  .track-table-head, .pl-row { grid-template-columns:24px 36px minmax(0,1fr) 48px 94px; }
  .pl-row .track-artist, .track-table-head .artist-heading { display:none; }
  .page-heading { align-items:flex-start; }
  .page-heading .h1 { font-size:24px; }
}
@media(prefers-reduced-transparency:reduce) { .sidebar,.context-panel,.player,.card { background:var(--panel-bg); } }

/* The muted scale stays readable for both artwork and manually selected themes. */
:root[data-theme] {
  --muted: color-mix(in srgb, rgb(var(--c1)) 13%, #aeb6c6);
  --dim: color-mix(in srgb, rgb(var(--c1)) 10%, #778191);
}
.equalizer { position:fixed; right:26px; bottom:110px; z-index:65; width:min(480px,calc(100vw - 36px)); padding:20px; border:1px solid var(--panel-line); border-radius:18px; background:var(--glass-strong); box-shadow:0 20px 80px #0008; }
.eq-heading { display:flex; align-items:center; gap:12px; margin-bottom:19px; }
.eq-heading h2 { font-size:15px; margin-right:auto; }
.eq-heading .switch { width:38px; height:23px; }
.eq-heading .switch i { width:16px; height:16px; top:2px; left:3px; }
.eq-heading .switch.on i { transform:translateX(15px); }
.eq-heading .text-link { font-size:11px; }
.eq-heading .iconbtn { width:25px; height:25px; }
.eq-presets { display:flex; gap:6px; margin-bottom:18px; }
.eq-presets button { flex:1; min-width:0; height:28px; font-size:10px; border-radius:8px; border:1px solid var(--edge-soft); color:var(--muted); }
.eq-presets button.on { background:rgba(var(--c1),.25); border-color:rgba(var(--c1),.5); color:var(--text); }
.eq-bands { display:grid; grid-template-columns:repeat(10,minmax(0,1fr)); gap:6px; padding:0 1px; }
.eq-band { display:flex; flex-direction:column; align-items:center; gap:9px; color:var(--muted); font-size:10px; min-width:0; }
.eq-band output { font-size:8px; font-variant-numeric:tabular-nums; white-space:nowrap; }
.eq-band input.eq-slider { writing-mode:vertical-lr; direction:rtl; width:5px; height:132px; background:rgba(var(--c1),.17); appearance:auto; accent-color:rgb(var(--c1)); cursor:pointer; }
.eq-band input.eq-slider::-webkit-slider-thumb { opacity:1; }
.eq-preamp { display:grid; grid-template-columns:1fr auto; gap:12px; margin-top:22px; font-size:11px; color:var(--muted); }
.eq-preamp input { grid-column:1/-1; width:100%; }
.eq-toggle { font-size:10px; font-weight:750; letter-spacing:.04em; border-radius:9px; border:1px solid var(--edge-soft); }
.player .right { position:relative; }
.player .right .sync { position:absolute; right:0; top:-16px; max-width:none; font-size:9px; }
@media(max-height:780px) { .equalizer { bottom:100px; padding:18px; } .eq-band input.eq-slider {height:110px;} }
.track-card > .track-title { width:calc(100% - 4px); max-width:calc(100% - 4px); }
.track-card > .track-artist { max-width:calc(100% - 4px); }

/* A shelf's card size depends on the window, never on its item count. */
.home-view { --home-track-size:144px; --home-playlist-size:172px; --home-playlist-height:144px; }
.home-view .track-shelf { grid-template-columns:none; grid-auto-columns:var(--home-track-size); justify-content:start; align-items:start; }
.home-view .track-card { width:var(--home-track-size); }
.home-view .playlist-shelf { grid-template-columns:none; grid-auto-flow:column; grid-auto-columns:var(--home-playlist-size); justify-content:start; gap:12px; overflow-x:auto; padding:2px 1px 7px; }
.home-view .playlist-tile { width:var(--home-playlist-size); height:var(--home-playlist-height); }
.home-view .playlist-tile.is-likes .playlist-info { color:var(--on-accent); }
.home-view .playlist-tile.is-likes .playlist-info span { color:inherit; opacity:.72; }
.home-view .playlist-create .playlist-info span { color:var(--muted); }
@media(min-width:1600px) { .home-view { --home-track-size:168px; --home-playlist-size:190px; --home-playlist-height:158px; } }
@media(max-width:1199px) { .home-view { --home-track-size:132px; --home-playlist-size:156px; --home-playlist-height:132px; } }
@media(max-width:599px) { .home-view { --home-track-size:118px; --home-playlist-size:144px; --home-playlist-height:124px; } }
.likes-art { background:linear-gradient(135deg,rgb(var(--c1)),rgb(var(--c2))); color:var(--on-accent); }
.likes-art > svg { width:58px; height:58px; }
.room-tile .info > span { display:block; }
.settings-pane .themes { margin-top:16px; }
.room-entry-card { display:flex; flex-direction:column; }
.room-entry-fields { margin-top:auto; }
.room-entry-fields > .btn { width:100%; }
.theme .sw { position:relative; overflow:hidden; }
.theme .sw::after { content:""; position:absolute; inset:-45% -10%; background:radial-gradient(ellipse at 32% 50%,#ffffff70,transparent 35%); filter:blur(9px); }
.queue-layout .context-close { display:none !important; }

/* Keep both library shelves in view on a standard laptop window. */
@media (min-width:1200px) and (min-height:780px) and (max-height:900px) {
  .home-hero { min-height:220px; grid-template-columns:154px minmax(0,1fr); padding:14px 22px 12px; gap:12px 23px; }
  .hero-art { width:154px; height:154px; }
  .hero-copy h1 { font-size:30px; margin:6px 0 4px; }
  .hero-artist { font-size:15px; }
  .hero-source { margin-top:10px; font-size:11px; }
  .hero-actions { margin-top:10px; }
  .hero-actions .playbtn { width:44px; height:44px; }
  .home-filters { padding:10px 2px; }
  .filter-chip { height:34px; }
  .home-section { margin-bottom:8px; }
  .home-section .section-heading { margin-bottom:8px; }
  .home-section .section-heading h2 { font-size:18px; }
  .main .home-view { padding-bottom:0; }
}

/* Player composition: current track above its queue, conversation alongside. */
.main { overflow:clip; }
.player-page .room-bg { inset:0; }
.profile-settings { display:flex; align-items:center; gap:10px; flex:1; min-width:0; text-align:left; border-radius:12px; }
.profile-settings > .avatar { width:39px; height:39px; flex:none; }
.profile-settings .who { display:flex; flex-direction:column; min-width:0; }
.profile-settings .profile-name { display:flex; align-items:center; gap:5px; }
.profile-settings .who > span:last-child { color:var(--muted); font-size:11px; }
.profile-settings .profile-name > b { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.shell.collapsed .profile-settings .who { display:none; }
.player-queue-label, .context-tab.player-only { display:none; }
.view-player .context-tab.player-only { display:flex; }
.main > .player-view { gap:0; overflow:hidden; }
.player-workspace { display:grid; grid-template-columns:minmax(0,1fr) 320px; gap:16px; min-height:0; flex:1; }
.player-main-column { display:flex; flex-direction:column; min-width:0; min-height:0; gap:16px; }
.player-main-column .listening-stage { flex:none; min-height:230px; padding:22px; }
.player-main-column .stage-content, .player-main-column .stage-empty { display:flex; flex-direction:row; align-items:center; width:100%; min-width:0; gap:24px; }
.player-main-column .stage-art { width:184px; height:184px; border-radius:16px; }
.stage-description { flex:1; min-width:0; padding:18px 0; }
.stage-description h1 { font-size:clamp(23px,2.1vw,32px); line-height:1.15; letter-spacing:-.035em; margin:10px 0 7px; overflow:hidden; display:-webkit-box; -webkit-line-clamp:2; -webkit-box-orient:vertical; }
.stage-description > p { color:var(--muted); font-size:15px; line-height:1.5; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.stage-description .hero-added-by { margin-top:16px; }
.player-main-column .stage-tools { position:absolute; top:12px; right:12px; }
.player-main-column .stage-tools .iconbtn { width:28px; height:28px; }
.player-main-column .stage-tools svg { width:16px; height:16px; }
.player-queue-host { display:flex; flex:1; min-width:0; min-height:0; border:0; border-radius:0; background:none; box-shadow:none; overflow:hidden; }
.player-queue-host .context-queue { padding:12px 10px 10px; }
.player-queue-host .queue-head { flex:none; gap:10px; padding:0 4px 10px; min-height:34px; }
.player-queue-host .player-queue-label { display:block; font-size:15px; color:var(--text); margin-right:auto; }
.player-queue-host #qcount { color:var(--muted); font-size:10px; }
.player-queue-host .queue { position:relative; padding:0; }
.player-queue-host .qrow { min-height:58px; padding:8px 10px; border-radius:12px; gap:10px; }
.player-queue-host .qrow .num { width:20px; font-size:11px; flex:none; color:var(--muted); }
.player-queue-host .qrow .cover { width:38px; height:38px; flex:none; border-radius:7px; }
.player-queue-host .queue-title { font-size:12px; }
.player-queue-host .qrow .tt > span { font-size:11px; }
.player-queue-host .qrow .avatar { width:24px; height:24px; font-size:10px; }
.player-queue-host .qrow .acts { position:absolute; right:45px; top:50%; transform:translateY(-50%); opacity:0; pointer-events:none; display:flex; padding:3px; background:var(--panel-bg); border:1px solid var(--edge-soft); border-radius:12px; z-index:1; }
.player-queue-host .qrow { position:relative; }
.player-queue-host .qrow:hover .acts, .player-queue-host .qrow:focus-within .acts { opacity:1; pointer-events:auto; }
.player-queue-host .qrow .acts .iconbtn { width:26px; height:26px; }
.player-queue-host .qrow .acts svg { width:14px; height:14px; }
#player-context-host { display:flex; min-width:0; min-height:0; }
#player-context-host .context-panel { display:flex; position:static; visibility:visible; opacity:1; transform:none; margin:0; width:100%; flex:1; background:var(--glass); }
#player-context-host .context-tab[data-tab="queue"], #player-context-host .context-close { display:none; }
#player-context-host .context-tabs { gap:18px; padding:0 16px; min-height:50px; }
#player-context-host .context-tab { font-size:12px; }
#player-context-host .context-tab svg { width:15px; height:15px; }
#player-context-host .context-body { padding:0 6px 6px; }
#player-context-host .solo-chat { display:flex; flex-direction:column; align-items:center; justify-content:center; gap:18px; height:100%; }
.context-favorites { flex:1; min-width:0; min-height:0; overflow-y:auto; padding:10px 3px; }
.context-favorites .trow { padding:8px 3px; gap:8px; }
.context-favorites .trow .cover { width:34px; height:34px; }
.context-favorites .trow .track-title { font-size:11px; }
.context-favorites .trow .tt > span { font-size:10px; }
.context-favorites .trow > .iconbtn { width:24px; height:27px; }
.context-favorites .trow > .iconbtn[data-act="pl-menu"] { display:flex; }
.context-favorites > .text-link { margin:14px 8px; }
.player-view .room-head.has-room { align-items:center; gap:14px; padding-bottom:16px; }
.room-heading { flex:1 1 210px; min-width:0; }
.player-view .room-heading .nm { min-width:0; width:100%; font-size:19px; line-height:1.4; }
.room-listeners { display:flex; align-items:center; gap:12px; min-height:32px; margin-top:3px; }
.room-listeners > span { color:var(--muted); font-size:11px; white-space:nowrap; }
.room-avatar-stack { display:flex; flex:none; align-items:center; padding:0 3px; border:0; background:none; border-radius:20px; }
.room-avatar-stack > .avatar, .room-avatar-more { position:relative; width:30px; height:30px; flex:none; border-radius:50%; box-shadow:0 0 0 2px var(--bg); }
.room-avatar-stack > :not(:first-child) { margin-left:-9px; }
.room-avatar-stack > .avatar { border:1px solid rgba(var(--c1),.4); }
.room-avatar-more { display:grid; place-items:center; background:color-mix(in srgb,rgb(var(--c1)) 14%,var(--bg)); color:var(--muted); font-size:10px; font-weight:750; }
.room-avatar-stack:hover { filter:brightness(1.15); }
.room-actions { display:flex; align-items:center; justify-content:flex-end; flex-wrap:wrap; gap:6px; min-width:0; margin-left:auto; }
#player-context-host .context-tabs { gap:12px; padding:0 12px; }
#player-context-host .context-tab { font-size:11px; gap:5px; white-space:nowrap; }
#player-context-host .context-tab svg { width:13px; height:13px; }
.context-members { flex:1; min-height:0; overflow-y:auto; padding:14px 8px; }
.room-members-heading { margin:0 4px 12px; font-size:11px; color:var(--muted); }
.room-members-list { display:flex; flex-direction:column; gap:4px; list-style:none; margin:0; padding:0; }
.room-member { display:flex; align-items:center; gap:10px; min-height:64px; padding:8px 4px; border-radius:10px; }
.room-member > .avatar { flex:none; width:37px; height:37px; }
.room-member-copy { flex:1; min-width:0; }
.room-member-copy > div { display:flex; align-items:center; gap:6px; min-width:0; }
.room-member-copy b { font-size:12px; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; }
.room-member-name { color:var(--text); text-shadow:none; }
.room-member-copy > span { display:block; margin-top:4px; font-size:10px; color:var(--muted); overflow:hidden; white-space:nowrap; text-overflow:ellipsis; }
.room-member-you { flex:none; font-size:9px; color:var(--muted); }
.room-member > .iconbtn { flex:none; width:28px; height:28px; color:var(--dim); }
.room-member > .iconbtn:hover { color:var(--text); }
@media(max-width:899px) {
  .player-view .room-head.has-room { gap:8px; }
  .room-heading { flex-basis:190px; }
  .room-listeners { gap:8px; }
  .room-actions { gap:3px; }
}
.shell.view-player .context-scrim, .shell.view-player .app-header .queue-toggle { display:none !important; }
@media(max-width:1199px) {
  .profile-settings .who { display:none; }
  .player-workspace { grid-template-columns:minmax(0,1fr) 290px; gap:12px; }
  .player-main-column { gap:12px; }
  .player-main-column .listening-stage { padding:18px; }
  .player-main-column .stage-content { gap:18px; }
  .player-main-column .stage-art { width:154px; height:154px; }
}
@media(max-height:780px) {
  .player-main-column .listening-stage { min-height:184px; padding:16px; }
  .player-main-column .stage-art { width:142px; height:142px; }
  .stage-description h1 { font-size:23px; }
  .stage-description > p { font-size:13px; }
  .stage-description .eyebrow { font-size:9px; }
  .stage-description .hero-added-by { margin-top:10px; }
  .player-queue-host .qrow { min-height:52px; }
}

/* A shared motion rhythm; position changes never delay playback or input. */
:root { --motion-ease:cubic-bezier(.22,1,.36,1); }
:root:not([data-motion="none"]) { --motion-distance:8px; --motion-scale:.98; --hover-lift:-1px; }
:is(.btn,.iconbtn,.playbtn,.nav,.filter-chip,.library-item,.text-link,.profile-settings,.page-tabs button,.context-tab,.eq-presets button,.theme,.trow,.qrow) {
  transition:background-color 240ms ease,border-color 240ms ease,color 220ms ease,opacity 200ms ease,box-shadow 280ms ease,transform 220ms var(--motion-ease);
}
.btn:not(:disabled):hover { transform:translateY(var(--hover-lift)); }
.btn:not(:disabled):active { transform:translateY(1px); }
.playbtn:not(:disabled):hover { transform:scale(1.045); }
.playbtn:not(:disabled):active { transform:scale(.96); }
:is(.main > .view,.settings-pane,.admin-pane):not([hidden]) { animation:view-arrive 320ms var(--motion-ease) both; }
:is(.context-chat,.context-favorites,.context-queue):not([hidden]) { animation:panel-arrive 240ms var(--motion-ease) both; }
:is(.pl-menu,.emoji-pop,.equalizer,.modal) { animation:surface-arrive 240ms var(--motion-ease) both; }
.modal-bg { animation:veil-arrive 200ms ease both; }
@keyframes view-arrive { from {opacity:0;translate:0 var(--motion-distance);} to {opacity:1;translate:0 0;} }
@keyframes panel-arrive { from {opacity:0;} to {opacity:1;} }
@keyframes surface-arrive { from {opacity:0;translate:0 var(--motion-distance);scale:var(--motion-scale);} to {opacity:1;translate:0 0;scale:1;} }
@keyframes veil-arrive { from {opacity:0;} to {opacity:1;} }
.context-tabs { position:relative; }
.context-tab.on::after { display:none; }
.context-indicator { position:absolute; left:0; bottom:-1px; height:3px; border-radius:3px 3px 0 0; background:rgb(var(--c1)); box-shadow:0 -2px 12px rgba(var(--c2),.3); pointer-events:none; transition:transform 320ms var(--motion-ease),width 320ms var(--motion-ease); }
:is(.context-panel,.player-queue-host) .qrow .acts { transition:opacity 220ms ease,background-color 220ms ease,border-color 220ms ease; }
.qrow .queue-cover { position:relative; overflow:hidden; padding:0; cursor:pointer; }
.qrow .queue-cover-control { position:absolute; inset:0; display:grid; place-items:center; background:#05070b99; color:#fff; opacity:0; transition:opacity 220ms ease; }
.qrow .queue-cover-control .i { width:20px; height:20px; animation:panel-arrive 180ms ease; }
.qrow .queue-cover:not(:disabled):hover .queue-cover-control,
.qrow .queue-cover:focus-visible .queue-cover-control { opacity:1; }
.qrow .queue-cover:active { transform:none; }
@media(hover:none) { .qrow .queue-cover-control {opacity:1;background:#05070b66;} }
/* Quiet conversation, with a stable composer and compact message rhythm. */
.context-chat .panel { position:relative; padding:0 4px 6px; }
.context-chat .chat { padding:14px 7px 10px; gap:14px; scrollbar-gutter:stable; overscroll-behavior:contain; overflow-anchor:auto; }
.context-chat .msg { flex:none; align-items:flex-start; gap:7px; font-size:12px; line-height:1.5; }
.context-chat .msg > .avatar { width:22px; height:22px; font-size:9px; margin-top:2px; flex:none; }
.context-chat .msg .bub { max-width:calc(100% - 29px); min-width:0; padding:0; border:0; border-radius:0; background:none; box-shadow:none; }
.context-chat .message-meta { display:flex; align-items:baseline; gap:9px; min-height:15px; margin-bottom:3px; }
.context-chat .message-meta b { font-size:10px; font-weight:650; }
.context-chat .message-meta time { font-size:9px; color:var(--dim); opacity:0; white-space:nowrap; transition:opacity 200ms ease; }
.context-chat .msg:hover time,.context-chat .msg:focus-within time { opacity:1; }
.context-chat .msg .bub p { white-space:pre-wrap; overflow-wrap:anywhere; word-break:normal; color:var(--text); }
.context-chat .msg.me { padding-left:25px; }
.context-chat .msg.me > .avatar { display:none; }
.context-chat .msg.me .bub { max-width:100%; padding:8px 11px; border-radius:12px 12px 3px 12px; background:rgba(var(--c1),.09); }
.context-chat .msg.me .message-meta { display:none; }
.context-chat .msg.sys { padding:0 5px; font-size:10px; line-height:1.55; color:var(--dim); }
.context-chat .msg .bub.big { padding:0; background:none; }
.context-chat .msg-enter { animation:view-arrive 280ms var(--motion-ease) both; }
.context-chat .chat-input { flex:none; align-items:flex-end; gap:6px; margin:0 3px; padding:8px 0 0; border-top:1px solid var(--edge-soft); }
.context-chat .chat-input textarea.field { min-height:38px; max-height:108px; height:38px; resize:none; padding:9px 10px; border-radius:12px; line-height:18px; font-size:12px; overflow-y:hidden; scrollbar-width:thin; }
.context-chat .chat-input textarea.field,
.context-chat .chat-input textarea.field:is(:focus,:focus-visible) { border:0; outline:none; box-shadow:none; }
.context-chat .chat-input .emoji-btn { width:26px; height:36px; font-size:17px; flex:none; }
.context-chat .chat-input .emoji-btn > svg { width:25px; height:25px; stroke-width:1.6; }
.context-chat .chat-input .chat-send { width:34px; height:36px; border-radius:11px; }
.context-chat .chat-input .chat-send:disabled { opacity:.28; }
.chat-latest { position:absolute; bottom:62px; left:50%; translate:-50% 0; display:flex; align-items:center; gap:7px; white-space:nowrap; padding:8px 12px; border-radius:20px; border:1px solid var(--panel-line); background:var(--panel-raised); color:var(--text); box-shadow:0 4px 20px #0004; font-size:11px; z-index:2; animation:panel-arrive 200ms ease; }
.chat-latest svg { width:13px; height:13px; rotate:90deg; }
@media(prefers-reduced-motion:reduce) {
  :root:not([data-motion="none"]) { --motion-distance:0px; --motion-scale:1; --hover-lift:0px; }
  .playbtn:not(:disabled):hover,.playbtn:not(:disabled):active { transform:none; }
  .context-indicator { transition-duration:180ms; }
}

/* Row actions sit directly on the row, without a separate capsule. */
:is(.context-panel,.player-queue-host) .qrow .acts {
  background:none; border:0; box-shadow:none; border-radius:0; padding:0; width:auto;
  right:calc(10px + var(--queue-duration-width) + 12px);
}
:is(.context-panel,.player-queue-host) .qrow > .dur {
  width:var(--queue-duration-width); min-width:var(--queue-duration-width); flex:none; white-space:nowrap;
}
.qrow { --queue-duration-width:40px; --queue-action-space:96px; }
.qrow:has(.acts > :nth-child(4)) { --queue-action-space:124px; }
.qrow .tt { transition:padding-right 220ms var(--motion-ease); }
.qrow:hover .tt,.qrow:focus-within .tt { padding-right:var(--queue-action-space); }
.qrow > :is(.avatar,.wave-mark) { transition:opacity 180ms ease; }
.qrow:hover > :is(.avatar,.wave-mark),.qrow:focus-within > :is(.avatar,.wave-mark) { opacity:0; }
.qrow > .wave-mark { display:grid; place-items:center; width:24px; height:24px; flex:none; color:var(--muted); background:none; border:0; border-radius:0; box-shadow:none; }
.qrow > .wave-mark svg { width:16px; height:16px; }
:is(.context-panel,.player-queue-host) .qrow .acts .iconbtn { background:transparent; }
:is(.context-panel,.player-queue-host) .qrow .acts .iconbtn:hover { background:rgba(var(--c1),.12); }
.queue-tools { display:flex; align-items:center; gap:8px; padding:0 5px 10px; flex:none; }
.queue-search-field { display:flex; align-items:center; gap:7px; height:34px; padding:0; border:0; border-radius:0; flex:1; min-width:0; background:none; transition:color 200ms ease; }
.queue-search-field:focus-within > svg { color:rgb(var(--c1)); }
.queue-search-field > svg { width:14px; height:14px; flex:none; color:var(--muted); }
.queue-search-field input { width:100%; min-width:0; border:0; outline:none; background:none; color:var(--text); font:inherit; font-size:11px; }
.queue-search-field input:focus-visible { outline:none; }
.queue-search-field input::-webkit-search-cancel-button { display:none; }
.queue-search-field .iconbtn { width:20px; height:24px; flex:none; }
.queue-search-field .iconbtn svg { width:12px; height:12px; }
.queue-search-mode { height:34px; max-width:125px; min-width:0; padding:0 7px; border:1px solid var(--edge-soft); border-radius:9px; background:var(--panel-bg); color:var(--muted); font:inherit; font-size:10px; cursor:pointer; }
.queue-search-status { color:var(--dim); font-size:10px; padding:6px 8px 10px; }
.queue-search-result { display:flex; align-items:center; gap:10px; min-height:58px; padding:8px; border-radius:12px; animation:panel-arrive 220ms ease; }
.queue-search-result:hover { background:var(--surface); }
.queue-search-result .cover { width:36px; height:36px; flex:none; border-radius:7px; background:center/cover; }
.queue-search-result .tt { min-width:0; flex:1; }
.queue-search-result .tt b { display:block; color:var(--text); font-size:12px; font-weight:650; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; }
.queue-search-result .tt span { display:block; color:var(--muted); font-size:11px; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; margin-top:3px; }
.queue-search-result > .iconbtn { width:29px; height:29px; flex:none; color:rgb(var(--c1)); }
.context-panel .queue-search-result { gap:8px; padding:7px 5px; }
.context-panel .queue-search-result .tt b { font-size:11px; }
.context-panel .queue-search-result .tt span { font-size:10px; }
.player-queue-host .queue-head { padding-bottom:9px; }
@media(max-width:1199px) { .queue-search-mode { max-width:112px; } }

/* One search, aligned with the queue title. */
.context-queue .queue-head { gap:10px; padding-bottom:10px; justify-content:flex-start; }
.context-queue .queue-tools { padding:0; flex:1; min-width:90px; margin-left:2px; max-width:320px; }
.player-queue-host .queue-head .player-queue-label { margin:0; flex:none; }
.context-queue .queue-search-field { height:32px; }
.context-queue .queue-head #qcount { margin-left:auto; flex:none; white-space:nowrap; font-size:10px; }
.context-queue .queue-head #qclear { flex:none; }
.context-queue .queue-search-status { margin:0; padding:10px 8px 8px; font-weight:600; color:var(--muted); }
.queue-search-notice { display:flex; align-items:center; flex-wrap:wrap; gap:9px; padding:8px; color:var(--dim); font-size:11px; line-height:1.5; }
.queue-search-notice .spin { width:13px; height:13px; }
.queue-catalog { margin-top:12px; padding-top:4px; border-top:1px solid var(--edge-soft); }
#queue { overflow-anchor:none; }
.qrow { isolation:isolate; }
:is(.context-panel,.player-queue-host) .qrow.cur { background:transparent; }
.qrow::before { content:""; position:absolute; inset:0; z-index:-1; pointer-events:none; border-radius:inherit; background:linear-gradient(115deg,rgba(var(--c1),.22),rgba(var(--c1),.1)); opacity:0; transition:opacity 260ms ease; }
.qrow.cur::before { opacity:1; }
@media(max-width:1199px) {
  .player-queue-host .player-queue-label {font-size:14px;}
  .context-queue .queue-head {gap:8px;}
}
/* Profile identity in the sidebar. */
#me { padding:9px; border:0; background:none; box-shadow:none; }
#me .profile-settings { width:100%; min-width:0; padding:0; }
.shell.collapsed #me .profile-settings { justify-content:center; }
#me .who { flex:1; min-width:0; }
#me .who b,#me .who > span:last-child { white-space:normal; overflow:visible; text-overflow:clip; overflow-wrap:anywhere; }
#me .who b { line-height:1.4; font-size:12px; color:var(--text); }
#me .who > span:last-child { font-size:10px; line-height:1.4; }
.profile-avatar { display:inline-flex; align-items:center; justify-content:center; width:40px; height:40px; border-radius:50%; flex:none; padding:1px; border:1px solid var(--edge-soft); }
.profile-avatar > .avatar,#me .profile-avatar > .avatar { width:100%; height:100%; border-radius:50%; }
.profile-avatar.is-premium { padding:2px; border:0; background:linear-gradient(145deg,#ffffffbb,rgba(var(--c1),.9) 45%,rgba(var(--c3),.65) 80%,#fff9); box-shadow:0 0 0 2px rgba(var(--c1),.07),0 0 14px rgba(var(--c1),.13); }
.profile-avatar.large { width:54px; height:54px; }
.profile .pname { overflow-wrap:anywhere; }

/* Banner controls share one row, with a waveform beside the live seek position. */
.hero-transport { gap:14px; }
.hero-transport .hero-control-divider { width:1px; height:15px; flex:none; background:rgba(var(--c1),.24); }
.hero-transport .hero-like { color:rgb(var(--c1)); }
.hero-transport .hero-like svg,.hero-transport .hero-more svg { width:19px; height:19px; }
.hero-transport .hero-play { color:var(--on-accent); background:linear-gradient(135deg,rgb(var(--c1)),rgb(var(--c2))); box-shadow:inset 0 1px 2px #fff6,0 0 18px rgba(var(--c1),.45); }
.hero-seek { --p:0%; position:relative; flex:1; min-width:0; height:24px; }
.hero-waveform { position:absolute; inset:3px 4px; color:rgba(var(--c3),.42); clip-path:inset(0 0 0 var(--p)); pointer-events:none; }
.hero-waveform svg { display:block; width:100%; height:100%; fill:currentColor; }
.hero-seek-fill { position:absolute; left:4px; right:4px; top:10px; height:4px; border-radius:99px; background:linear-gradient(90deg,rgb(var(--c1)),rgb(var(--c2))); clip-path:inset(-9px calc(100% - var(--p)) -9px 0); box-shadow:0 0 9px rgba(var(--c1),.6); pointer-events:none; }
.hero-timeline .hero-seek .seek-range { position:absolute; inset:0; width:100%; height:24px; margin:0; background:none; border:0; }
.hero-seek .seek-range::-webkit-slider-thumb { opacity:1; background:rgb(var(--c2)); box-shadow:0 0 10px rgba(var(--c2),.65); }
.hero-seek:has(input:disabled) { opacity:.6; }
@media(max-width:1199px) {
  .shell #me .profile-settings { justify-content:center; }
}
@media(max-width:699px) {
  .hero-transport { gap:8px; }
  .hero-transport .hero-control-divider { height:12px; }
}

/* At compact widths the logo is static; the sidebar stays inside its grid column. */
.sidebar .side-toggle:disabled { opacity:1; cursor:default; }

/* The home banner owns its compact queue and playback controls. */
.shell.view-home { grid-template-columns:var(--sidebar-width) minmax(0,1fr); grid-template-rows:minmax(0,1fr); }
.shell.view-home.collapsed { grid-template-columns:76px minmax(0,1fr); }
.shell.view-home > :is(#player,#context,.context-scrim),.shell.view-home .header-actions .queue-toggle { display:none; }
.home-view { --home-queue-width:296px; }
.home-hero { grid-template-columns:minmax(0,1fr) var(--home-queue-width); grid-template-rows:minmax(0,1fr); height:290px; min-height:290px; padding:0; gap:0; border:0; border-radius:0; clip-path:var(--hero-shape,inset(0 round 21px)); }
.hero-contour { position:absolute; inset:0; width:100%; height:100%; z-index:3; pointer-events:none; fill:none; stroke:rgba(var(--c1),.42); stroke-width:1; }
.home-hero::after { display:none; }
.hero-stage { display:grid; grid-template-columns:174px minmax(0,1fr); grid-template-rows:minmax(0,1fr) auto; gap:14px 24px; min-width:0; min-height:0; padding:20px 24px 44px; }
.home-view > .home-filters { margin-top:-26px; padding-top:8px; max-width:calc(100% - var(--home-queue-width) - 46px); }
.hero-stage .hero-art { width:174px; height:174px; }
.hero-stage .hero-copy { padding-right:0; }
.hero-stage .hero-copy > .eyebrow { padding-right:0; }
.hero-stage .hero-copy h1 { font-size:clamp(26px,2.7vw,39px); }
.hero-stage .hero-title { display:block; height:1.15em; line-height:1.15; white-space:nowrap; text-overflow:ellipsis; overflow:hidden; -webkit-line-clamp:unset; }
.hero-title > span { display:inline-block; white-space:nowrap; }
.hero-title.is-overflowing { mask-image:linear-gradient(90deg,#000 0%,#000 calc(100% - 24px),transparent); }
.hero-title.is-overflowing:is(:hover,:focus-visible) > span { animation:hero-title-scroll var(--title-duration,8s) linear .35s infinite alternate; }
@keyframes hero-title-scroll { 0% {transform:translateX(0);} 92%,100% {transform:translateX(var(--title-shift));} }
@media(prefers-reduced-motion:reduce) { .hero-title.is-overflowing:is(:hover,:focus-visible) > span {animation-iteration-count:1;animation-fill-mode:forwards;} }
.hero-stage .hero-artist { display:block; font-size:16px; line-height:1.5; height:1.5em; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; }
.hero-stage .hero-source { font-size:11px; margin-top:12px; }
.hero-stage .hero-transport { gap:12px; margin-top:14px; }
.hero-stage .hero-transport .playbtn { width:44px; height:44px; }
.hero-queue { position:relative; isolation:isolate; min-width:0; padding:17px 12px 14px; border:0; background:none; }
.hero-queue::before { content:""; position:absolute; inset:0 0 0 -72px; z-index:-1; background:linear-gradient(90deg,transparent,rgba(6,8,12,.08) 45%,rgba(6,8,12,.2)); pointer-events:none; }
.hero-queue-heading { display:flex; align-items:center; justify-content:space-between; gap:8px; margin-bottom:10px; padding:0 5px; min-height:25px; }
.hero-queue-heading h2 { margin:0; font-size:12px; font-weight:750; white-space:nowrap; }
.hero-queue-heading h2 span { font-size:10px; color:var(--muted); font-weight:500; }
.hero-queue-all { min-height:25px; padding:3px 9px; border:1px solid var(--edge-soft); border-radius:999px; font-size:9px; color:var(--text); white-space:nowrap; transition:background-color 220ms ease,border-color 220ms ease; }
.hero-queue-all:hover { border-color:rgba(var(--c1),.4); background:rgba(var(--c1),.1); }
.hero-queue-track { display:flex; align-items:center; gap:9px; width:100%; height:43px; padding:4px 7px; border-radius:8px; text-align:left; transition:background-color 240ms ease,color 220ms ease; }
.hero-queue-track:hover { background:rgba(var(--c1),.08); }
.hero-queue-track:disabled { opacity:.6; }
.hero-queue-number { width:12px; flex:none; text-align:center; font-size:9px; color:var(--muted); font-variant-numeric:tabular-nums; }
.hero-queue-cover { position:relative; width:30px; height:30px; flex:none; border-radius:5px; overflow:hidden; background:center/cover; }
.hero-queue-cover > span { position:absolute; inset:0; display:grid; place-items:center; background:#080b1199; color:#fff; opacity:0; transition:opacity 220ms ease; }
.hero-queue-cover svg { width:15px; height:15px; }
.hero-queue-track:hover .hero-queue-cover > span,.hero-queue-track:focus-visible .hero-queue-cover > span { opacity:1; }
.hero-queue-title { flex:1; min-width:0; }
.hero-queue-title b,.hero-queue-title small { display:block; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; }
.hero-queue-title b { font-size:10px; font-weight:650; line-height:1.5; }
.hero-queue-name { display:block; max-width:100%; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; text-align:left; font-size:10px; font-weight:650; line-height:1.5; padding:0; }
.hero-queue-title small { font-size:9px; color:var(--muted); line-height:1.5; }
.hero-queue-duration { flex:none; font-size:9px; color:var(--muted); font-variant-numeric:tabular-nums; }
.hero-queue-track .eq { flex:none; width:12px; height:12px; margin:0 0 0 2px; }

/* Artist credits stay in place while exposing a keyboard-accessible catalog. */
.artist-link { display:inline; max-width:100%; padding:0; border:0; border-radius:2px; background:none; box-shadow:none; font:inherit; line-height:inherit; color:inherit; text-align:inherit; cursor:pointer; text-decoration:underline; text-decoration-color:transparent; text-underline-offset:3px; transition:color 220ms ease,text-decoration-color 220ms ease; }
.artist-link:hover { color:var(--text); text-decoration-color:currentColor; }
.artist-link:focus-visible { outline:2px solid rgba(var(--c1),.8); outline-offset:3px; }
.room-head .btn.solo-friends { border:0; background:transparent; box-shadow:none; }
.room-head .btn.solo-friends:hover { color:var(--text); background:rgba(var(--c1),.07); }
.artist-header { display:flex; align-items:center; gap:24px; margin-bottom:32px; }
.artist-art { flex:none; width:126px; height:126px; border-radius:18px; }
.artist-header > div:last-child { min-width:0; }
.artist-header .h1 { margin:8px 0; overflow-wrap:anywhere; }
.artist-header .sub { margin:0; }
.artist-tracks { max-width:1100px; }
.artist-status { display:flex; align-items:center; gap:12px; color:var(--muted); font-size:13px; padding:24px 0; }
.artist-status p { flex:1; }
.artist-more { margin-top:20px; }
/* Карточка исполнителя: круглое фото, статистика, «Слушать»/«Перемешать»; треки пронумерованы от популярных */
.artist-header .artist-art { width:148px; height:148px; border-radius:50%; background-size:cover; background-position:center; }
.artist-actions { display:flex; flex-wrap:wrap; gap:10px; margin-top:16px; }
.artist-row { display:flex; align-items:center; gap:4px; }
.artist-row > .n { flex:none; width:28px; text-align:right; color:var(--muted); font-size:12px; font-variant-numeric:tabular-nums; }
.artist-row > .trow { flex:1; min-width:0; }
.artist-cards { display:grid; grid-template-columns:repeat(auto-fill,minmax(120px,1fr)); gap:12px; margin:0 0 22px; }
.artist-card { display:flex; flex-direction:column; align-items:center; gap:6px; min-width:0; padding:14px 10px 12px; border:0; border-radius:16px; background:rgba(var(--c1),.05); color:var(--text); font:inherit; cursor:pointer; transition:background 200ms ease; }
.artist-card:hover { background:rgba(var(--c1),.11); }
.artist-card:focus-visible { outline:2px solid rgba(var(--c1),.8); outline-offset:2px; }
.artist-card-art { display:grid; place-items:center; width:84px; height:84px; border-radius:50%; background-size:cover; background-position:center; }
.artist-card b { max-width:100%; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:13px; }
.artist-card > span:last-child { color:var(--muted); font-size:11px; }
@media (max-width:640px) { .artist-header { flex-direction:column; align-items:flex-start; } .artist-header .artist-art { width:112px; height:112px; } }
@media (max-width:599px) {
  .artist-header { gap:16px; margin-bottom:24px; }
  .artist-art { width:88px; height:88px; border-radius:14px; }
  .artist-header .h1 { font-size:25px; }
}
.hero-queue-empty { display:flex; flex-direction:column; align-items:flex-start; justify-content:center; gap:12px; min-height:200px; padding:16px 12px; color:var(--muted); font-size:11px; line-height:1.6; }
.hero-queue-empty > svg { width:24px; height:24px; }
.hero-queue-empty .text-link { font-size:11px; }
@media(max-width:1199px) {
  .shell.view-home { grid-template-columns:76px minmax(0,1fr); }
  .home-view { --home-queue-width:276px; }
  .hero-stage { grid-template-columns:154px minmax(0,1fr); gap:12px 20px; padding:20px 20px 42px; }
  .hero-stage .hero-art { width:154px; height:154px; }
  .hero-stage .hero-copy h1 { font-size:30px; }
  .hero-stage .hero-artist { font-size:14px; }
}
@media(max-width:899px) {
  .shell.view-home,.shell.view-home.collapsed { grid-template-columns:64px minmax(0,1fr); }
  .home-hero { grid-template-columns:minmax(0,1fr); grid-template-rows:auto auto; height:auto; min-height:0; }
  .hero-stage { min-height:245px; padding-bottom:16px; }
  .home-view > .home-filters { margin-top:0; max-width:none; }
  .hero-queue { border-left:0; border-top:1px solid var(--edge-soft); }
  .hero-queue::before { inset:0; }
  .hero-queue-list { display:grid; grid-template-columns:repeat(2,minmax(0,1fr)); gap:3px 8px; }
  .hero-queue-empty { min-height:100px; }
}
@media(max-width:699px) {
  .shell.view-home,.shell.view-home.collapsed { grid-template-columns:54px minmax(0,1fr); }
  .hero-stage { grid-template-columns:90px minmax(0,1fr); gap:16px 14px; padding:24px 14px 14px; }
  .hero-stage .hero-art { width:90px; height:90px; }
  .hero-stage .hero-copy h1 { font-size:24px; }
  .hero-stage .hero-artist { font-size:11px; }
  .hero-stage .hero-transport { gap:8px; }
  .hero-stage .hero-transport .playbtn { width:35px; height:35px; }
  .hero-queue-list { grid-template-columns:minmax(0,1fr); }
}

/* The queue page is a plain list, without nested panels or row outlines. */
.shell.view-queue .header-actions .queue-toggle { display:none; }
.queue-page #queue-host > .context-panel { border:0; border-radius:0; background:none; box-shadow:none; backdrop-filter:none; -webkit-backdrop-filter:none; }
.queue-page .context-tabs { display:none; }
.queue-page .context-queue { padding:0; }
.queue-page .queue-head { padding:0 4px 16px; }
.queue-page .context-queue .queue-tools { max-width:420px; }
.queue-page .qrow { border:0; box-shadow:none; border-radius:8px; }
.queue-page .qrow.cur { box-shadow:none; }

/* My flow: the standalone infinity ribbon, without a background or sparkles. */
.flow-icon {
  display:inline-block; flex:none; width:54px; height:26px;
  background:currentColor;
  -webkit-mask:url("assets/flow-symbol.svg") center / contain no-repeat;
  mask:url("assets/flow-symbol.svg") center / contain no-repeat;
}
.flow-toggle:is(.hero-source,.wave-btn),.hero-stage .hero-source.flow-toggle {
  display:inline-flex; align-items:center; gap:9px; height:32px; min-height:32px; padding:0; border:0; border-radius:6px;
  background:none; box-shadow:none; color:var(--muted); flex:none;
  transition:color 320ms ease,filter 360ms ease,opacity 260ms ease;
}
.flow-toggle > .flow-icon { display:inline-block; width:54px; height:26px; flex:none; color:inherit; }
.flow-toggle .flow-label { display:inline-flex; align-items:baseline; gap:5px; white-space:nowrap; line-height:1; }
.flow-toggle .flow-prefix { display:inline; font:550 14px/1 Manrope,sans-serif; letter-spacing:-.025em; }
.flow-toggle .flow-wordmark { font:800 25px/1 Syne,Manrope,sans-serif; letter-spacing:-.075em; }
.flow-toggle:is(.hero-source,.wave-btn):is(:hover,:focus-visible) { color:var(--text); }
.flow-toggle:not(.on) > .flow-icon { opacity:.68; }
.flow-toggle:not(.on) .flow-label { opacity:.8; }
.flow-toggle:is(.hero-source,.wave-btn).on {
  --flow-fill:linear-gradient(110deg,rgb(var(--c1)) 0%,#fff 23%,rgb(var(--c2)) 46%,rgb(var(--c3)) 70%,#fff 83%,rgb(var(--c1)) 100%);
  color:var(--text); background:none; border:0; box-shadow:none;
}
.flow-toggle.on :is(.flow-icon,.flow-label) {
  background-image:var(--flow-fill); background-size:260% 100%;
  animation:flow-letter-shimmer 5.6s ease-in-out infinite;
}
.flow-toggle.on .flow-icon {
  opacity:1; background-color:transparent;
}
.flow-toggle.on .flow-label {
  color:transparent; -webkit-text-fill-color:transparent;
  background-clip:text; -webkit-background-clip:text;
  filter:drop-shadow(0 0 6px rgba(var(--c1),.38));
}
@keyframes flow-letter-shimmer {
  0%,100% { background-position:0% 50%; }
  50% { background-position:100% 50%; }
}
.qrow > .wave-mark .flow-icon { width:24px; height:14px; }
@media(max-width:1199px) {
  .wave-btn.flow-toggle .flow-label { display:inline-flex; }
  .wave-btn.flow-toggle .flow-prefix { display:inline; }
}
@media(max-width:699px) {
  .hero-stage .hero-source.flow-toggle { display:inline-flex; }
  .flow-toggle > .flow-icon { width:43px; height:23px; }
  .flow-toggle .flow-wordmark { font-size:22px; }
  .flow-toggle .flow-prefix { font-size:12px; }
}

/* ---------- 0.7.1 ---------- */
/* Окно Flow не в фокусе или свёрнуто — бесконечные анимации стоят: видеокарта не перерисовывает их впустую. */
body:not(.active) :is(.flow-toggle.on .flow-icon, .flow-toggle.on .flow-label, .avatar.loading::after, .hero-title > span) { animation-play-state:paused !important; }

/* Шапка комнаты: справа от названия — синхронизация; под ним — чего тебе нельзя */
.room-title-row { display:flex; align-items:center; gap:12px; min-width:0; }
.room-title-row .nm { flex:0 1 auto; width:auto !important; }
.room-head .sync-ind { flex:none; max-width:none; font-size:11px; white-space:nowrap; }
.room-head .sync-ind::before { width:6px; height:6px; }
.room-rights { display:flex; align-items:center; gap:6px; margin-top:4px; color:var(--muted); font-size:11px; }
.room-rights .i { width:13px; height:13px; flex:none; }

/* «Мой flow» в шапке плейлиста, левее числа треков */
.queue-head #qwave { display:flex; flex:none; }
.queue-head .queue-wave { height:26px; padding:0 8px; font-size:10px; gap:5px; }
.queue-head .queue-wave .flow-icon { width:22px; height:12px; }
.queue-head .queue-wave .flow-label { font-size:11px; }
.queue-head .queue-wave .flow-wordmark { font-size:13px; }
.queue-head #qcount { font-variant-numeric:tabular-nums; white-space:nowrap; }

/* Перемешка и повтор */
.mode-btn { position:relative; color:var(--muted); }
.mode-btn.on { color:var(--a1); }
.mode-btn.on::after { content:""; position:absolute; left:50%; bottom:-3px; width:4px; height:4px; margin-left:-2px; border-radius:50%; background:currentColor; }
.mode-btn .i { width:17px !important; height:17px !important; }
.repeat-one { position:absolute; top:1px; right:0; min-width:11px; height:11px; border-radius:6px; background:var(--a1); color:var(--bg); font-size:8px; font-weight:800; line-height:11px; text-align:center; }
.player .controls .btns { gap:14px; }

/* Плеер в баннере на главной: эквалайзер и громкость */
.hero-actions.hero-transport { gap:16px; }
.hero-actions .mode-btn { width:28px; height:28px; }
.hero-timeline .hero-sound { display:flex; align-items:center; gap:6px; flex:none; margin-left:6px; min-width:0; }
.hero-sound .iconbtn { width:30px; height:30px; color:var(--muted); }
.hero-sound .iconbtn svg { width:18px; height:18px; }
.hero-sound .eq-toggle { font-size:10px; font-weight:800; letter-spacing:.04em; }
.hero-sound .eq-toggle.on { color:var(--a1); }
.hero-sound .vol { width:96px; }

/* Вкладка «Настройки комнаты» */
.room-members-heading { display:flex; align-items:center; justify-content:space-between; gap:8px; min-height:30px; }
.room-members-heading .btn.sm { height:28px; font-size:11px; gap:6px; padding:0 10px; }
.room-members-heading .btn .i { width:13px; height:13px; }
.room-banned-heading { margin-top:22px; }
.room-settings-hint { margin:-4px 4px 12px; color:var(--dim); font-size:11px; line-height:1.45; }
.room-member:has(.room-member-perms) { flex-wrap:wrap; row-gap:8px; }
.room-member-perms { display:flex; align-items:center; gap:6px; flex:1 0 100%; padding-left:47px; }
.room-member-perms [data-act="kick"] { margin-left:auto; }
.context-tab .tab-short { display:none; }
@media (max-width:1199px) {
  .context-tab .tab-long { display:none; } .context-tab .tab-short { display:inline; }
  .room-member-perms { padding-left:0; gap:4px; }
  .perm-lock { padding:0 7px; gap:4px; }
  .room-member-perms .iconbtn { width:28px; height:28px; }
}
.perm-lock { display:inline-flex; align-items:center; gap:5px; height:28px; padding:0 9px; border-radius:999px; border:1px solid var(--panel-line); background:none; color:var(--dim); font-family:inherit; font-size:11px; font-weight:600; line-height:1; cursor:pointer; }
.perm-lock .i { width:13px; height:13px; }
.perm-lock.on { color:var(--text); border-color:rgba(var(--c1),.6); background:rgba(var(--c1),.16); }
.perm-lock:hover { border-color:rgba(var(--c1),.6); }
.perm-lock:focus-visible { outline:2px solid rgb(var(--c1)); outline-offset:2px; }
.room-member.is-banned { opacity:.8; }
.room-member.is-banned .btn.sm { height:28px; font-size:11px; padding:0 12px; }


/* Перетаскивание в очереди */
.qrow.draggable { cursor:grab; }
.qrow.dragging { opacity:.4; }
.qrow.drop-before { box-shadow:inset 0 2px 0 rgb(var(--c1)); }
.qrow.drop-after { box-shadow:inset 0 -2px 0 rgb(var(--c1)); }

/* Плюсик → галочка */
.add-btn.added { color:var(--ok); opacity:1; }
.add-btn.added:disabled { cursor:default; }
.add-btn .spin { width:13px; height:13px; }

/* Окна «Новая комната» и «Войти в комнату» */
.form-modal { display:flex; flex-direction:column; width:min(420px, calc(100vw - 32px)); }
.form-modal h2 { margin:0 0 6px; font-size:18px; }
.form-modal > p { color:var(--muted); }
.form-modal label.lbl { margin:10px 2px 6px; }
.form-modal .code-input { letter-spacing:.24em; text-transform:uppercase; }
.form-modal .err { min-height:18px; margin:10px 2px 6px; }
.form-modal .row { margin-top:4px; }
.room-entry-fields { display:flex; }

/* Живой фон: пятна заметнее и плывут по-настоящему (раньше — 20 пикселей за 8 секунд за полупрозрачной пеленой).
   Двигаются только transform — видеокарта сдвигает готовые слои; окно не в фокусе — стоят. */
body.live-bg .orbs { opacity:.62; }
.orbs i { will-change:transform; }
body.live-bg .orbs i:nth-child(1) { animation:orb-drift-a 19s ease-in-out infinite alternate; }
body.live-bg .orbs i:nth-child(2) { animation:orb-drift-b 23s ease-in-out -6s infinite alternate; }
body.live-bg .orbs i:nth-child(3) { animation:orb-drift-c 27s ease-in-out -12s infinite alternate; }
body.live-bg:not(.active) .orbs i { animation-play-state:paused; }
@keyframes orb-drift-a { 0% { transform:translate(0,0) scale(1); } 50% { transform:translate(-220px,140px) scale(1.18); } 100% { transform:translate(180px,90px) scale(.92); } }
@keyframes orb-drift-b { 0% { transform:translate(0,0) scale(1); } 50% { transform:translate(-260px,180px) scale(.9); } 100% { transform:translate(-80px,-120px) scale(1.15); } }
@keyframes orb-drift-c { 0% { transform:translate(0,0) scale(1); } 50% { transform:translate(240px,-160px) scale(1.12); } 100% { transform:translate(-200px,-60px) scale(.95); } }

/* Вкладка «Настройки комнаты»: подпись как у соседних вкладок, без плашки счётчика */
.context-tab > i { font-style:normal; }

/* Карточки «Создать комнату» / «Присоединиться» — компактные, в одну строку */
.room-entry-grid { gap:12px; margin:18px 0 26px; }
.room-entry-card { flex-direction:row; align-items:center; gap:14px; padding:14px 16px; border-radius:14px; }
.room-entry-icon { width:40px; height:40px; border-radius:11px; margin:0; flex:none; }
.room-entry-icon svg { width:20px; height:20px; }
.room-entry-text { flex:1; min-width:0; }
.room-entry-card h2 { font-size:15px; margin:0 0 2px; }
.room-entry-card p { min-height:0; margin:0; font-size:12px; line-height:1.45; }
.room-entry-card > .btn { width:auto; flex:none; height:36px; padding:0 18px; font-size:12px; }
/* без белого квадрата в углу прокрутки и без сдвига вбок в настройках комнаты */
::-webkit-scrollbar-corner { background:transparent; }
.context-members { overflow-x:hidden; }

/* Profile: one identity panel and one editor, following the existing Flow surfaces. */
.main > .profile-page { padding:28px 28px 30px; }
.profile-page .page-heading { margin-bottom:26px; }
.profile-layout { display:grid; grid-template-columns:minmax(220px, .32fr) minmax(0, 1fr); gap:18px; align-items:stretch; max-width:1260px; }
/* на большом мониторе заголовок и карточки по центру и шире, как страница Premium, а не прижаты к левому краю */
.profile-page .page-heading,.profile-layout { width:100%; margin-left:auto; margin-right:auto; }
.profile-page .page-heading { max-width:1260px; }
@media(min-width:1600px) {
  .profile-page .page-heading,.profile-layout { max-width:1440px; }
  .profile-editor { min-height:580px; }
}
/* 2560×1440 и больше: всё пропорционально крупнее, иначе карточки теряются в пустом экране */
@media(min-width:2200px) and (min-height:1100px) { .main > .profile-page { zoom:1.25; } }
.profile-identity,.profile-editor { border:1px solid var(--edge-soft); border-radius:20px; background:var(--glass); box-shadow:var(--shine); min-width:0; }
.profile-identity { display:flex; align-items:center; flex-direction:column; padding:34px 20px 18px; text-align:center; }
.profile-portrait { position:relative; margin:0 0 18px; }
.profile-portrait .profile-avatar.large { width:144px; height:144px; padding:3px; }
.profile-portrait .avatar { font-size:48px; }
.profile-camera.iconbtn { position:absolute; right:-3px; bottom:2px; width:40px; height:40px; border-radius:50%; border:1px solid var(--edge); background:var(--panel-bg); box-shadow:0 3px 12px #0003; }
.profile-identity h2 { font:750 23px/1.3 Manrope,sans-serif; letter-spacing:-.035em; margin:0 0 5px; max-width:100%; overflow-wrap:anywhere; }
.profile-tag { margin:0; color:var(--muted); font-size:13px; overflow-wrap:anywhere; max-width:100%; }
.profile-presence { display:inline-flex; align-items:center; gap:8px; padding:7px 12px; border-radius:999px; background:rgba(140,150,165,.09); color:var(--muted); font-size:12px; margin:17px 0 22px; }
.profile-presence i { width:7px; height:7px; border-radius:50%; background:currentColor; }
.profile-presence.online { background:rgba(52,211,153,.09); color:#a5d5c7; }
.profile-presence.online i { background:#34d399; box-shadow:0 0 8px #34d39955; }
.profile-avatar-upload { width:100%; min-height:42px; justify-content:center; gap:8px; }
.profile-avatar-upload svg { width:18px; height:18px; }
.profile-avatar-help { color:var(--muted); font-size:11px; line-height:1.85; margin:12px 0 4px; }
.profile-avatar-remove { margin-top:6px; font-size:11px; }
.profile-logout {
  display:inline-flex; align-items:center; justify-content:center; gap:8px;
  width:100%; min-height:40px; margin-top:auto; padding:10px 12px;
  font-size:12px; line-height:20px; color:var(--muted); border-radius:10px;
}
.profile-logout:hover,.profile-logout:focus-visible { color:var(--text); background:rgba(var(--c1),.06); }
.profile-logout svg { display:block; width:16px; height:16px; flex:none; }
.profile-editor { padding:14px 17px 20px; min-height:510px; }
.profile-tabs { display:grid; grid-template-columns:repeat(2,minmax(0,1fr)); gap:4px; padding-bottom:12px; border-bottom:1px solid var(--edge-soft); }
.profile-tabs button { display:flex; align-items:center; justify-content:center; gap:9px; min-height:46px; padding:8px 10px; font-size:12px; font-weight:550; border:1px solid transparent; border-radius:12px; color:var(--muted); transition:background-color 200ms ease,border-color 200ms ease,color 200ms ease; }
.profile-tabs button svg { width:19px; height:19px; flex:none; }
.profile-tabs button:hover { color:var(--text); background:rgba(var(--c1),.06); }
.profile-tabs button[aria-selected="true"] { color:var(--text); background:rgba(var(--c1),.15); border-color:rgba(var(--c1),.3); box-shadow:inset 0 1px rgba(255,255,255,.04); }
.profile-panel { padding:23px 6px 0; min-width:0; }
.profile-section-heading { margin-bottom:23px; }
.profile-section-heading h2 { font-size:19px; letter-spacing:-.025em; font-weight:700; margin:0 0 6px; }
.profile-section-heading p { color:var(--muted); font-size:12px; line-height:1.6; margin:0; }
.profile-form { display:flex; flex-direction:column; gap:22px; }
.profile-field { display:flex; flex-direction:column; gap:9px; min-width:0; }
.profile-field > label { font-size:13px; font-weight:600; }
.profile-field > p { font-size:11px; color:var(--muted); margin:0; line-height:1.6; }
.profile-input-wrap { position:relative; display:flex; min-width:0; }
.profile-field .field { width:100%; height:43px; font-size:13px; border-radius:11px; border:1px solid var(--edge-soft); background:rgba(7,9,13,.16); padding:11px 65px 11px 13px; }
.profile-input-wrap > [data-counter] { position:absolute; right:13px; top:15px; font-size:10px; font-variant-numeric:tabular-nums; line-height:1.2; color:var(--muted); pointer-events:none; }
.profile-input-prefix { display:flex; align-items:center; justify-content:center; width:43px; flex:none; color:var(--muted); background:rgba(255,255,255,.035); border:1px solid var(--edge-soft); border-right:0; border-radius:11px 0 0 11px; }
.profile-input-wrap.has-prefix > .field { border-radius:0 11px 11px 0; }
.profile-input-wrap.is-textarea .field { height:auto; min-height:88px; resize:vertical; padding:12px 14px 26px; line-height:1.6; }
.profile-input-wrap.is-textarea > [data-counter] { top:auto; bottom:11px; }
.profile-field .field[aria-invalid="true"] { border-color:#e18c9c; }
.profile-form-footer { display:flex; flex-wrap:wrap; gap:12px; align-items:center; justify-content:flex-end; margin-top:0; }
.profile-form-actions { display:flex; justify-content:flex-end; gap:10px; margin-left:auto; }
.profile-form-actions .btn { min-height:40px; padding:9px 17px; font-size:12px; }
.profile-form-actions .primary { background:var(--text); color:var(--panel-bg); border-color:transparent; box-shadow:none; }
.profile-form-status { font-size:12px; line-height:1.5; color:var(--muted); margin:0; overflow-wrap:anywhere; }
.profile-form-status:empty { display:none; }
.profile-form-status.bad { color:#efa8b5; }
#profile-avatar-status { margin-top:12px; font-size:11px; }
.password-form .profile-field .field { padding-right:13px; }
.auth-forgot { display:block; margin:14px auto 0; padding:0; font-size:12px; background:none; border:0; cursor:pointer; }
.preferences-content .settings { max-width:none; margin:0; }
.preferences-content .settings-pane { display:flex; flex-direction:column; gap:14px; }
.preferences-content .settings-pane[hidden] { display:none; }
.preferences-content .page-tabs { margin:0; padding:0 0 20px; }
.preferences-content .card { padding:17px; background:rgba(7,9,13,.12); box-shadow:none; }
.preferences-content .card::before { display:none; }
.preferences-content .set-row b { font-size:13px; }
.preferences-content .themes { grid-template-columns:repeat(3,minmax(0,1fr)); }
.preferences-content .service .txt { overflow-wrap:anywhere; }
.preferences-content .service { flex-wrap:wrap; }
.preferences-content .service .txt { flex:1; min-width:140px; }
.preferences-content .set-row { flex-wrap:wrap; gap:12px; }

/* Room discovery and owner-controlled visibility. Private rooms stay accessible by invite. */
.room-directory-note { margin:5px 0 0; color:var(--muted); font-size:12px; }
#room-directory-status:not(:empty) { margin-bottom:14px; }
.public-room-grid { grid-template-columns:repeat(auto-fill,minmax(290px,1fr)); gap:12px; margin-bottom:32px; }
.public-room-grid > .empty,.room-grid > .empty { grid-column:1/-1; min-height:130px; }
.public-room { display:flex; align-items:center; gap:13px; padding:16px; border:1px solid var(--edge-soft); border-radius:16px; background:var(--glass); min-width:0; }
.public-room-art { width:55px; height:55px; flex:none; border-radius:12px; display:flex; align-items:center; justify-content:center; background-color:rgba(var(--c1),.07); color:var(--muted); }
.public-room-art svg { width:24px; height:24px; }
.public-room-info { min-width:0; flex:1; }
.public-room-info h3 { font-size:14px; font-weight:650; margin:0 0 5px; white-space:nowrap; text-overflow:ellipsis; overflow:hidden; }
.public-room-info p { margin:0 0 6px; color:var(--muted); font-size:11px; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; }
.public-room-info > span { font-size:10px; color:var(--muted); }
.public-room > .btn { flex:none; }
.room-visibility { padding:18px 4px 0; margin:0; border:0; min-width:0; }
.room-visibility legend { padding-top:18px; font-size:13px; font-weight:650; }
.room-visibility > p { color:var(--muted); font-size:11px; margin:0 0 13px; line-height:1.6; }
.room-visibility-option { display:flex; align-items:center; gap:9px; min-width:0; padding:10px 9px; margin-bottom:6px; border:1px solid var(--edge-soft); border-radius:11px; cursor:pointer; transition:background-color 200ms ease,border-color 200ms ease; }
.room-visibility-option:has(input:checked) { border-color:rgba(var(--c1),.4); background:rgba(var(--c1),.09); }
.room-visibility-option:has(input:focus-visible) { outline:2px solid var(--text); outline-offset:2px; }
.room-visibility-option input { accent-color:rgb(var(--c1)); flex:none; width:13px; height:13px; }
.room-visibility-option > svg { width:16px; height:16px; flex:none; color:var(--muted); }
.room-visibility-option > span { display:flex; flex-direction:column; gap:4px; min-width:0; }
.room-visibility-option b { font-size:12px; font-weight:600; }
.room-visibility-option small { font-size:10px; color:var(--muted); line-height:1.5; }
.room-visibility:disabled .room-visibility-option { cursor:default; opacity:.7; }
#room-visibility-status:not(:empty) { padding:6px 5px 14px; font-size:11px; }
@media(max-width:1199px) {
  .profile-layout { grid-template-columns:230px minmax(0,1fr); gap:14px; }
  .profile-tabs button { font-size:11px; gap:7px; padding:8px 6px; }
  .profile-tabs button svg { width:17px; height:17px; }
  .profile-identity { padding:30px 16px 18px; }
  .profile-portrait .profile-avatar.large { width:128px; height:128px; }
  .preferences-content .themes { grid-template-columns:repeat(2,minmax(0,1fr)); }
}
@media(max-width:899px) {
  .profile-layout { grid-template-columns:minmax(0,1fr); }
  .profile-identity { padding:22px; }
  .profile-logout { margin-top:0; }
  .profile-avatar-upload { max-width:280px; }
  .profile-editor { min-height:480px; }
}
@media(max-height:900px) {
  .main > .profile-page { padding-top:18px; }
  .profile-page .page-heading { margin-bottom:20px; }
  .profile-editor { min-height:0; padding:12px 16px 16px; }
  .profile-tabs { padding-bottom:10px; }
  .profile-tabs button { min-height:40px; }
  .profile-panel { padding-top:16px; }
  .profile-section-heading { margin-bottom:16px; }
  .profile-section-heading h2 { font-size:18px; }
  .profile-form { gap:12px; }
  .profile-field { gap:6px; }
  .profile-field .field { height:40px; }
  .profile-input-wrap > [data-counter] { top:14px; }
  .profile-input-wrap.is-textarea .field { height:76px; min-height:76px; }
  .profile-form-actions .btn { min-height:36px; padding-top:7px; padding-bottom:7px; }
  .profile-identity { padding-top:28px; }
  .profile-portrait .profile-avatar.large { width:128px; height:128px; }
}

/* App preferences are a separate page from account management. */
.settings-page .preferences-content { max-width:1040px; }
.settings-page .page-heading { margin-bottom:24px; }
.preferences-content .page-tabs { flex-wrap:wrap; }

/* A continuous listening surface: transport and playlist on the left, room tools on the right. */
.main > .player-view { padding:10px 2px 14px !important; }
.player-view .room-head { min-height:52px; padding:0 18px 16px; }
.player-view .room-head.has-room { min-height:88px; padding:4px 18px 18px; }
.player-view .room-heading .nm { font-size:23px; font-weight:750; }
.player-view .room-listeners { margin-top:7px; }
.player-view .room-listeners > span { font-size:12px; }
.player-view .room-title-row { gap:14px; }
.player-view .room-actions { gap:9px; }
.player-view .room-actions .iconbtn { width:34px; height:36px; color:var(--muted); }
.player-view .code-pill { height:36px; padding:0 14px; border-color:var(--edge-soft); background:rgba(var(--c1),.04); font-size:13px; font-variant-numeric:tabular-nums; letter-spacing:.08em; }
.player-workspace { position:relative; isolation:isolate; grid-template-columns:minmax(0,1fr) clamp(304px,34%,438px); gap:0; border:1px solid rgba(var(--c1),.1); border-radius:28px; overflow:hidden; background:radial-gradient(ellipse at 35% 0,rgba(var(--c1),.1),transparent 50%),linear-gradient(130deg,rgba(17,19,25,.92),rgba(10,12,17,.91)); box-shadow:inset 0 1px 0 #ffffff03; }
.listening-ribbons { position:absolute; z-index:-1; inset:0; width:100%; height:100%; pointer-events:none; }
.ribbon-back { fill:url(#listening-ribbon-back); stroke:rgba(var(--c1),.08); stroke-width:.7; }
.ribbon-front { fill:url(#listening-ribbon-front); stroke:rgba(var(--c1),.08); stroke-width:.7; }
.ribbon-shade { stop-color:rgb(var(--c1)); stop-opacity:.015; }
.ribbon-light { stop-color:rgb(var(--c1)); stop-opacity:.18; }
.player-page .room-bg:not(.custom) { opacity:.2; }
.player-view .player-main-column .listening-stage { min-height:242px; padding:24px 26px 18px; border:0; border-radius:0; background:none; overflow:visible; }
.player-view .stage-ambient { inset:0; opacity:.09; filter:blur(48px) saturate(.8); }
.player-view .stage-content { position:relative; align-items:center; gap:26px; }
.player-view .player-main-column .stage-art { position:relative; width:clamp(140px,12.4vw,192px); height:auto; aspect-ratio:1; border-radius:14px; box-shadow:0 10px 35px #0004,inset 0 0 0 1px #ffffff0a; }
.player-view .stage-description { padding:8px 0 0; align-self:stretch; display:flex; flex-direction:column; justify-content:center; }
.player-view .stage-description .eyebrow { padding-right:76px; font-size:9px; letter-spacing:.16em; color:var(--muted); }
.player-view .stage-description h1 { margin:9px 0 7px; padding-right:12px; font-size:clamp(24px,2.2vw,36px); line-height:1.14; letter-spacing:-.04em; -webkit-line-clamp:1; }
.player-view .stage-description > p { font-size:15px; line-height:1.5; }
.player-view .player-main-column .stage-tools { top:-4px; right:0; gap:7px; }
.player-view .player-main-column .stage-tools .iconbtn { width:29px; height:29px; color:var(--muted); }
.player-view .player-main-column .stage-tools .iconbtn.on { color:rgb(var(--c1)); }
.player-view .player-main-column .stage-tools svg { width:19px; height:19px; }
.player-view .stage-timeline { display:flex; flex-direction:column; align-items:stretch; gap:7px; margin-top:22px; font-size:11px; }
.player-view .stage-timeline .seek-range { flex:none; width:100%; height:5px; }
.player-view .stage-times { display:flex; justify-content:space-between; font-variant-numeric:tabular-nums; color:var(--muted); }
.player-view .stage-controls { gap:19px; margin-top:-13px; min-height:46px; }
.player-view .stage-controls .iconbtn { width:28px; height:32px; color:var(--muted); }
.player-view .stage-controls .iconbtn > svg { width:19px; height:19px; }
.player-view .stage-controls .playbtn { width:46px; height:46px; color:var(--on-accent); background:rgb(var(--c1)); box-shadow:0 4px 24px rgba(var(--c1),.26),inset 0 1px 0 #ffffff38; }
.player-view .stage-controls .playbtn > svg { width:23px; height:23px; }
.player-view .stage-art .hero-added-by { position:absolute; bottom:0; left:0; right:0; display:flex; gap:6px; justify-content:center; padding:7px; margin:0; border-radius:0 0 14px 14px; background:linear-gradient(transparent,#000b); color:#fff; font-size:9px; opacity:0; transition:opacity 180ms ease; }
.player-view .stage-art:hover .hero-added-by { opacity:1; }
.player-view .stage-art .hero-added-by .avatar { width:18px; height:18px; }
.player-view .stage-empty { gap:24px; text-align:left; }
.player-view .stage-empty h1 { font-size:24px; line-height:1.2; }
.player-view .stage-empty p { margin:10px 0 18px; font-size:12px; line-height:1.6; }
.player-view #player-context-host { padding:16px 18px 18px 8px; }
.player-view #player-context-host .context-panel { border:0; border-radius:0; background:none; box-shadow:none; backdrop-filter:none; -webkit-backdrop-filter:none; }
.player-view #player-context-host .context-tabs { min-height:48px; gap:19px; padding:0 2px; border-bottom-color:rgba(var(--c1),.13); }
.player-view #player-context-host .context-tab { gap:6px; font-size:12px; font-weight:600; }
.player-view #player-context-host .context-tab > .i { width:16px; height:16px; }
.player-view #player-context-host .context-tab[data-tab="queue"] { display:none; }
.player-view #player-context-host .context-body { padding:0; }
.player-view #player-context-host .context-favorites { padding:14px 0; }
.player-view .context-favorites .trow { min-height:58px; padding:8px 3px; gap:10px; }
.player-view .context-favorites .trow .cover { width:38px; height:38px; border-radius:7px; }
.player-view .context-favorites .trow .track-title { font-size:12px; }
.player-view .context-favorites .trow .tt > span { font-size:11px; }
.player-view .context-chat .panel { padding:0; }
.player-view .context-chat .chat { padding:22px 4px 16px; gap:23px; }
.player-view .context-chat .msg,.player-view .context-chat .msg.me { flex-direction:row; padding:0; gap:10px; }
.player-view .context-chat .msg > .avatar,.player-view .context-chat .msg.me > .avatar { display:flex; width:36px; height:36px; margin-top:0; }
.player-view .context-chat .msg .bub,.player-view .context-chat .msg.me .bub { max-width:calc(100% - 46px); padding:0; background:none; border:0; border-radius:0; }
.player-view .context-chat .message-meta,.player-view .context-chat .msg.me .message-meta { display:flex; margin:0 0 5px; gap:9px; }
.player-view .context-chat .message-meta b,.player-view .context-chat .msg.me .message-meta b { display:inline; font-size:11px; font-weight:700; color:var(--text); text-shadow:none; }
.player-view .context-chat .message-meta time { opacity:1; font-size:10px; }
.player-view .context-chat .msg .bub p { display:inline-block; padding:9px 12px; border-radius:4px 12px 12px; background:rgba(var(--c1),.075); font-size:12px; line-height:1.6; }
.player-view .context-chat .msg .bub.big p { background:none; padding:0; font-size:36px; }
.player-view .context-chat .msg.sys { justify-content:center; padding:0 12px; }
.player-view .context-chat .chat-input { gap:9px; margin:0; border:0; padding-top:12px; }
.player-view .context-chat .chat-input textarea.field { min-height:44px; height:44px; padding:12px; border:1px solid rgba(var(--c1),.17); border-radius:14px; background:rgba(var(--c1),.03); }
.player-view .context-chat .chat-input textarea.field:focus-visible { border-color:rgba(var(--c1),.6); }
.player-view .context-chat .chat-input .emoji-btn { width:36px; height:44px; border-radius:12px; background:rgba(var(--c1),.04); }
.player-view .context-chat .chat-input .chat-send { width:44px; height:44px; border-radius:13px; background:rgb(var(--c1)); }
@media(max-width:1399px) {
  .player-view .player-main-column .listening-stage { padding:22px 20px 18px; }
  .player-view .stage-content { gap:20px; }
  .player-view #player-context-host { padding:14px 14px 16px 6px; }
  .player-view #player-context-host .context-tabs { gap:12px; }
  .player-view #player-context-host .context-tab { font-size:11px; gap:5px; }
  .player-view #player-context-host .tab-long { display:none; }
  .player-view #player-context-host .tab-short { display:inline; }
}
@media(max-height:780px) {
  .player-view .room-head.has-room { min-height:76px; padding-bottom:12px; }
  .player-view .player-main-column .listening-stage { min-height:182px; padding-top:16px; padding-bottom:10px; }
  .player-view .player-main-column .stage-art { width:120px; }
  .player-view .stage-description h1 { font-size:23px; margin-top:7px; }
  .player-view .stage-description > p { font-size:13px; }
  .player-view .stage-timeline { margin-top:14px; }
  .player-view .stage-controls { min-height:40px; margin-top:-12px; }
  .player-view .stage-controls .playbtn { width:40px; height:40px; }
  .player-view .context-chat .chat { gap:18px; padding-top:16px; }
}

/* The focused player owns playback; other pages retain the bottom transport. */
.shell.view-player { grid-template-rows:minmax(0,1fr); }
.shell.view-player > #player { display:none; }
.player-view .stage-transport { display:flex; align-items:center; justify-content:space-between; flex-wrap:wrap; gap:8px 14px; margin-top:-13px; }
.player-view .stage-transport .stage-controls { flex:1; margin-top:0; }
.player-view .stage-sound { display:flex; align-items:center; gap:5px; flex:none; }
.player-view .stage-sound .iconbtn { width:26px; height:30px; color:var(--muted); }
.player-view .stage-sound .eq-toggle { font-size:10px; font-weight:750; }
.player-view .stage-sound .eq-toggle.on { color:rgb(var(--c1)); }
.player-view .stage-sound .vol { width:64px; }
@media(max-height:780px) {
  .player-view .stage-transport { margin-top:-12px; }
  .player-view .stage-sound .vol { width:52px; }
}

/* Уведомления: ошибки и события, которых больше нигде не видно. Над нижним плеером, не перехватывают клики мимо себя */
.toasts { position:fixed; right:26px; bottom:112px; z-index:100; display:flex; flex-direction:column; align-items:flex-end; gap:8px; width:min(360px,calc(100vw - 52px)); pointer-events:none; }
.toast { position:relative; max-width:100%; padding:11px 15px 11px 17px; border:1px solid var(--panel-line); border-radius:14px; background:var(--panel-raised); color:var(--text); font-size:12px; font-weight:550; line-height:1.45; overflow-wrap:anywhere; box-shadow:0 14px 40px #0007; pointer-events:auto; cursor:pointer; user-select:text; animation:surface-arrive 240ms var(--motion-ease) both; }
.toast::before { content:""; position:absolute; left:0; top:10px; bottom:10px; width:3px; border-radius:0 3px 3px 0; background:rgb(var(--c1)); }
.toast.bad { border-color:color-mix(in srgb, var(--bad) 55%, transparent); }
.toast.bad::before { background:var(--bad); }
body.player-page .toasts { bottom:92px; }  /* в плеере нижней панели нет — держимся над полем чата */
@media(max-height:780px) { .toasts { bottom:101px; } }
@media(max-width:679px) { .toasts, body.player-page .toasts { left:15px; right:15px; bottom:95px; width:auto; } .toast { font-size:11px; } }

/* Track actions stay compact; the active radio source remains readable. */
.track-art > .track-more { position:absolute; top:8px; right:8px; z-index:3; width:30px; height:30px; border-radius:50%; background:rgba(10,12,16,.75); color:#fff; opacity:0; }
.track-card:is(:hover,:focus-within) .track-more { opacity:1; }
.track-menu-title { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.pl-menu button:disabled { opacity:.45; cursor:default; }
@media (hover:none) { .track-art > .track-more { opacity:1; } }
.pl-menu button > .flow-icon { width:22px; height:14px; flex:none; }
.pl-menu button > .flow-icon { color:var(--muted); }

/* A track seed lives beside My flow, with a direct return to personal radio. */
.queue-head #qwave { align-items:center; gap:5px; flex:0 1 auto; min-width:0; max-width:48%; }
.queue-head .queue-wave { flex:none; }
.flow-source { display:inline-flex; align-items:center; gap:4px; min-width:0; max-width:190px; color:var(--muted); font-size:10px; font-weight:500; line-height:1.4; }
.flow-source-copy { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; min-width:0; }
.flow-source .iconbtn { flex:none; width:22px; height:24px; color:var(--muted); }
.flow-source .iconbtn:hover { color:var(--text); }
.flow-source .iconbtn svg { width:12px; height:12px; }
.flow-source .spin { flex:none; width:10px; height:10px; border-width:1px; }
.flow-source.is-error .flow-source-copy { color:var(--muted); text-decoration:underline dotted; text-underline-offset:3px; }
.home-flow-control { display:flex; align-items:center; flex-wrap:wrap; gap:6px 10px; margin-top:12px; }
.hero-stage .home-flow-control .hero-source { margin-top:0; }
.home-flow-source { display:flex; min-width:0; }
.home-flow-source .flow-source { max-width:220px; }
.context-queue .queue-tools[hidden] { display:none; }
.queue-head #qwave.track-seeded { flex:1; max-width:none; }
.queue-head #qwave.track-seeded .flow-source { flex:0 1 auto; max-width:none; }

/* Public discovery shares the library's artwork shelf. */
.catalog-note { margin:5px 0 0; font-size:11px; color:var(--muted); }
.catalog-status { display:flex; align-items:center; gap:12px; margin:12px 0; color:var(--muted); font-size:12px; }
.playlist-skeleton { width:var(--home-playlist-size); height:var(--home-playlist-height); border-radius:12px; background:rgba(var(--c1),.07); animation:catalog-pulse 1.4s ease-in-out infinite alternate; }
.playlist-skeleton:nth-child(even) { animation-delay:.15s; }
.popular-playlists .playlist-tile { border:0; }
.home-view .popular-playlists .playlist-shelf { grid-auto-flow:row; grid-auto-columns:auto; grid-template-columns:repeat(6,minmax(0,1fr)); overflow:visible; }
.home-view .popular-playlists :is(.playlist-tile,.playlist-skeleton) { width:100%; min-width:0; }
.home-view .popular-playlists .playlist-tile { height:var(--home-playlist-height); }
@media(max-width:1199px) { .home-view .popular-playlists .playlist-shelf { grid-template-columns:repeat(3,minmax(0,1fr)); } }
@media(max-width:599px) { .home-view .popular-playlists .playlist-shelf { grid-template-columns:repeat(2,minmax(0,1fr)); } }
.popular-playlists .playlist-tile:disabled { cursor:progress; opacity:.65; }
.popular-playlists .playlist-tile[aria-busy="true"] .playlist-open { opacity:1; }
@keyframes catalog-pulse { to { background:rgba(var(--c1),.14); } }
@media(prefers-reduced-motion:reduce) { .playlist-skeleton { animation:none; } }

/* Статус в профиле: роль и подписка. Base — спокойная плашка без неона */
.profile-status { display:flex; flex-wrap:wrap; gap:6px; align-items:center; }
.profile-status .role-badge { margin-left:0; top:0; }
.role-badge.r-base { background:rgba(var(--c1),.1); color:var(--muted) !important; box-shadow:inset 0 0 0 1px var(--panel-line); }
.profile-identity .profile-status { justify-content:center; margin:2px 0 4px; }

/* значок ∞ «Моего flow» в обложках — от размера плитки, а не фиксированные 54×26: в плитке 32–44 px он вылезал за край и обрезался */
.library-art > .flow-icon { width: 72%; height: 40%; }
.mosaic.likes > .flow-icon { width: 60%; height: 32%; }
.playlist-tile .mosaic.likes > .flow-icon { margin-bottom: 24px; }

/* вкладки справа в плеере («Мне нравится», «Чат», «Настройки») — поровну на всю ширину блока */
.player-view #player-context-host .context-tabs { gap: 0; }
.player-view #player-context-host .context-tab { flex: 1 1 0; min-width: 0; }
.admin-hint { font-size:12px; line-height:1.6; margin:0 0 12px; }
.admin-reset { margin-top:14px; padding-top:14px; border-top:1px solid var(--edge-soft); }
.admin-reset-head { font-size:13px; margin-bottom:10px; }
.admin-reset .row .field { font-size:12px; font-family:ui-monospace, SFMono-Regular, Consolas, monospace; }
.admin-reset .admin-hint { margin:10px 0 0; }

/* The Premium reference is a full-height page; audio keeps playing in the existing player.
   Blocks never shrink: when the page holds more than the window (Discord, gifts), the page scrolls instead of overlapping. */
.shell.view-premium { grid-template-rows:minmax(0,1fr); }
.shell.view-premium > .player { display:none; }
.shell.view-premium > .context-panel { bottom:12px; }
.shell.view-premium.context-open .context-scrim { bottom:0; }
.main > .view.premium-page {
  --premium-muted:color-mix(in srgb,rgb(var(--c1)) 20%,#c0c5d6);
  position:relative; isolation:isolate; display:flex; flex-direction:column; gap:18px;
  max-width:1440px; height:100%; overflow-y:auto; margin:0 auto; padding:18px 30px 20px; color:var(--text);
}
.main > .view.premium-page > * { flex-shrink:0; }
.premium-page::before {
  content:""; position:absolute; z-index:-1; pointer-events:none; inset:0;
  background:linear-gradient(120deg,rgba(var(--c2),.28) 15%,rgb(var(--c3)) 40%,rgb(var(--c1)) 65%,rgb(var(--c2)) 85%,rgb(var(--c3)) 100%);
  mask-image:url("assets/premium-waves.jpg"); mask-mode:luminance;
  mask-size:cover; mask-position:center; mask-repeat:no-repeat;
  opacity:.95;
}
.premium-hero { display:flex; align-items:center; justify-content:space-between; gap:24px; flex:none; padding:4px 0 9px; }
.premium-intro { min-width:0; }
.premium-intro h1 { font:800 clamp(34px,4.2vw,62px)/1.12 Syne,Manrope,sans-serif; letter-spacing:-.075em; margin:0 0 5px; white-space:nowrap; text-shadow:0 0 24px #ffffff08; }
.premium-title-accent {
  display:inline-block;
  background-image:linear-gradient(110deg,rgb(var(--c1)) 0%,#fff 23%,rgb(var(--c2)) 46%,rgb(var(--c3)) 70%,#fff 83%,rgb(var(--c1)) 100%);
  background-size:260% 100%; color:transparent; -webkit-text-fill-color:transparent;
  background-clip:text; -webkit-background-clip:text;
  filter:drop-shadow(0 0 6px rgba(var(--c1),.38));
  animation:flow-letter-shimmer 5.6s ease-in-out infinite;
}
body:not(.active) .premium-title-accent { animation-play-state:paused; }
.premium-tagline { font-size:clamp(13px,1.4vw,20px); line-height:1.5; font-weight:700; letter-spacing:-.025em; margin:0 0 10px; }
.premium-lead { color:var(--premium-muted); font-size:12px; line-height:1.6; }
.premium-profile-preview { display:flex; align-items:center; flex:none; gap:14px; padding:16px 20px; background:linear-gradient(125deg,color-mix(in srgb,rgba(var(--c1),.8) 12%,#11151edc),#10131dc2); border:1px solid rgba(var(--c1),.15); border-radius:15px; max-width:270px; box-shadow:0 10px 35px #04051040; }
.premium-profile-preview > div { display:flex; flex-direction:column; align-items:flex-start; gap:5px; min-width:0; }
.premium-profile-preview .profile-avatar.large { width:58px; height:58px; flex:none; box-shadow:0 0 15px rgba(var(--c1),.21); }
.premium-profile-preview .avatar { font-size:24px; }
.premium-preview-name { max-width:100%; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; font-size:14px; font-weight:650; }
.premium-preview-tag { font-size:10px; color:var(--premium-muted); }
.premium-comparison { display:grid; grid-template-columns:repeat(2,minmax(0,1fr)); gap:24px; flex:1 0 auto; }
.premium-plan { position:relative; isolation:isolate; display:flex; flex-direction:column; min-width:0; padding:21px 24px 18px; border:1px solid rgba(var(--c1),.2); border-radius:18px; background:linear-gradient(135deg,#0b1017e8,color-mix(in srgb,rgba(var(--c2),.8) 10%,#11151ed6)); box-shadow:0 12px 35px #03040c35; }
.premium-plan-paid { border:1px solid color-mix(in srgb,rgb(var(--c3)) 65%,#fff); background:linear-gradient(145deg,rgba(var(--c2),.25) 0%,#0e121bdc 42%,#0c111ace 70%,rgba(var(--c1),.36) 100%); box-shadow:0 0 0 1px rgba(var(--c3),.8),0 0 9px rgba(var(--c1),.6),0 0 28px rgba(var(--c2),.2),inset 0 0 30px rgba(var(--c1),.08); }
.premium-plan-paid::before {
  content:""; position:absolute; inset:-2px; z-index:-1; border-radius:19px; padding:2px; pointer-events:none;
  background:linear-gradient(130deg,#fff 0%,rgb(var(--c3)) 20%,rgb(var(--c2)) 48%,rgb(var(--c1)) 76%,#fff 100%);
  -webkit-mask:linear-gradient(#fff 0 0) content-box,linear-gradient(#fff 0 0); -webkit-mask-composite:xor;
  mask:linear-gradient(#fff 0 0) content-box,linear-gradient(#fff 0 0); mask-composite:exclude;
}
.premium-plan-heading { position:relative; display:flex; justify-content:space-between; align-items:flex-start; gap:12px; flex:none; }
.premium-plan-heading h2 { font:800 clamp(25px,2.8vw,38px)/1.15 Syne,Manrope,sans-serif; letter-spacing:-.055em; margin:0 0 5px; }
.premium-plan-title { display:flex; align-items:baseline; gap:12px; }
.premium-plan-title h2 { margin:0; }
.premium-plan-price { display:inline-flex; align-items:baseline; gap:3px; white-space:nowrap; color:var(--premium-muted); }
.premium-plan-price strong { font-size:17px; font-weight:650; font-variant-numeric:tabular-nums; color:var(--text); }
.premium-plan-price > span { font-size:11px; }
.premium-plan-heading p { font-size:12px; color:var(--text); line-height:1.5; margin-top:5px; }
.premium-plan-badge { padding:9px 11px; border:1px solid rgba(var(--c1),.16); border-radius:11px; background:linear-gradient(120deg,rgba(var(--c1),.1),rgba(var(--c2),.14)); color:var(--text); font-size:10px; white-space:nowrap; }
.premium-plan-paid .premium-plan-badge { position:absolute; right:0; bottom:0; padding:3px 7px; }
.premium-plan dl { display:flex; flex-direction:column; justify-content:space-between; flex:1 0 auto; margin:16px 0; }
.premium-plan-row { display:flex; justify-content:space-between; align-items:center; gap:12px; min-height:31px; flex:1 0 auto; }
.premium-plan-row + .premium-plan-row { border-top:1px solid rgba(var(--c1),.08); }
.premium-plan-row dt { display:flex; align-items:center; gap:12px; flex:0 0 43%; font-size:12px; line-height:1.5; color:var(--premium-muted); }
.premium-plan-row dt .i { flex:none; width:20px; height:20px; color:var(--text); }
.premium-plan-row dd { margin:0; font-size:12px; line-height:1.5; text-align:right; font-variant-numeric:tabular-nums; }
.premium-plan-row.is-limit dd { font-weight:600; }
.premium-plan-footer { flex:none; margin-top:auto; }
.premium-plan-status { display:flex; align-items:center; justify-content:center; gap:9px; width:100%; min-height:44px; padding:10px; border:1px solid rgba(var(--c1),.08); border-radius:11px; background:linear-gradient(110deg,rgba(var(--c1),.08),rgba(var(--c2),.13)); color:var(--premium-muted); font-size:13px; }
.premium-plan-status .i { width:20px; height:20px; }
.premium-plan .premium-buy.btn.primary { position:relative; display:flex; align-items:center; justify-content:center; width:100%; min-height:44px; padding:11px 36px; font-size:13px; font-weight:750; color:var(--on-accent,#090b10); background:linear-gradient(105deg,color-mix(in srgb,rgb(var(--c2)) 75%,#fff) 0%,rgb(var(--c2)) 43%,rgb(var(--c1)) 78%,rgb(var(--c3)) 100%); border:1px solid rgba(var(--c3),.6); border-radius:11px; box-shadow:0 0 22px rgba(var(--c1),.45),inset 0 1px #ffffff30; }
.premium-buy .i { position:absolute; right:16px; width:20px; height:20px; }
.premium-plan .premium-buy:disabled { opacity:1; cursor:default; }
.premium-purchase-note { margin:5px 0 -2px; color:var(--premium-muted); font-size:9px; line-height:1.4; text-align:center; }
.premium-has-access .premium-plan-free .premium-plan-footer { padding-bottom:15px; }
.premium-plan a.premium-buy { text-decoration:none; }
.premium-howto { flex:none; padding:15px 18px; border:1px solid rgba(var(--c1),.18); border-radius:16px; background:color-mix(in srgb,rgba(var(--c1),.8) 6%,#0c111ddb); font-size:12px; line-height:1.6; }
.premium-howto h3 { margin:0 0 6px; font-size:13px; }
.premium-howto ol { margin:0 0 6px; padding-left:20px; }
.premium-howto li { margin:3px 0; }
.premium-howto p { margin:0; color:var(--premium-muted); }
.premium-howto .premium-copy { margin-left:4px; vertical-align:middle; }
.premium-howto a.btn { text-decoration:none; color:var(--text); }
.premium-howto a.btn.primary { color:var(--on-accent,#090b10); }
.premium-discord li .btn, .premium-discord .premium-discord-actions .btn { margin-left:4px; vertical-align:middle; }
.premium-discord .btn .i { width:14px; height:14px; margin-right:5px; vertical-align:-2px; }
.premium-discord-actions { margin-top:8px; }
.premium-discord-linked { display:inline-flex; align-items:center; gap:5px; }
.premium-discord-linked .i { width:14px; height:14px; color:rgb(var(--c1)); }
.premium-howto .premium-discord-hint { margin:0 0 6px; color:#fca5a5; }
.premium-gift h4 { margin:10px 0 4px; font-size:12px; }
/* бейдж подписки рядом со статусом и именем */
.premium-badge { width:18px; height:18px; flex:none; border-radius:5px; vertical-align:middle; box-shadow:0 0 8px rgba(255,255,255,.35); cursor:help; }
.room-member-name + .premium-badge { width:15px; height:15px; margin-left:5px; border-radius:4px; }
.premium-gift-form { display:flex; gap:8px; margin:8px 0; max-width:420px; }
.premium-gift-form .field { flex:1; min-width:0; }
.premium-gift .btn .i { width:14px; height:14px; margin-right:5px; vertical-align:-2px; }
.premium-gift li .btn { margin-left:4px; vertical-align:middle; }
.premium-gift-code { font-family:ui-monospace, Consolas, monospace; letter-spacing:.06em; }
.premium-gift-list { margin:0; padding-left:18px; }
.premium-gift-list li { margin:3px 0; }
.premium-highlights { display:grid; grid-template-columns:repeat(4,minmax(0,1fr)); flex:none; padding:15px 18px; border:1px solid rgba(var(--c1),.18); border-radius:16px; background:linear-gradient(110deg,color-mix(in srgb,rgba(var(--c1),.8) 8%,#0c111ddb),color-mix(in srgb,rgba(var(--c2),.9) 14%,#11151de8)); }
.premium-highlights > div { display:flex; align-items:center; gap:13px; min-width:0; padding:0 16px; }
.premium-highlights > div + div { border-left:1px solid rgba(var(--c1),.12); }
.premium-highlights > div > .i { width:30px; height:30px; flex:none; color:rgb(var(--c1)); filter:drop-shadow(0 0 7px rgba(var(--c2),.4)); }
.premium-highlights > div > .flow-icon { width:35px; }
.premium-highlights span { display:flex; flex-direction:column; gap:5px; min-width:0; }
.premium-highlights b { font-size:11px; font-weight:650; line-height:1.4; white-space:nowrap; }
.premium-highlights small { font-size:10px; color:var(--premium-muted); line-height:1.4; white-space:nowrap; }
@media(max-width:1199px) {
  .main > .view.premium-page { padding-left:22px; padding-right:22px; gap:15px; }
  .premium-comparison { gap:22px; }
  .premium-plan { padding:18px 20px 15px; }
  .premium-plan-row dt { gap:10px; font-size:11px; }
  .premium-plan-row dd { font-size:11px; }
  .premium-highlights { padding:13px 5px; }
  .premium-highlights > div { padding:0 13px; gap:9px; }
  .premium-highlights > div > .i { width:27px; height:27px; }
}
@media(max-height:760px) and (min-width:900px) {
  .main > .view.premium-page { gap:10px; padding-top:8px; padding-bottom:10px; }
  .premium-hero { padding:0 0 3px; }
  .premium-intro h1 { font-size:34px; margin-bottom:2px; }
  .premium-tagline { font-size:13px; margin-bottom:4px; }
  .premium-lead { font-size:10px; }
  .premium-profile-preview { padding:11px 14px; }
  .premium-profile-preview .profile-avatar.large { width:48px; height:48px; }
  .premium-plan { padding:12px 18px; }
  .premium-plan-heading h2 { font-size:25px; margin-bottom:3px; }
  .premium-plan-title h2 { margin-bottom:0; }
  .premium-plan-title { gap:9px; }
  .premium-plan-price strong { font-size:15px; }
  .premium-plan-price > span { font-size:10px; }
  .premium-plan-heading p { font-size:10px; }
  .premium-plan-badge { padding:6px 8px; }
  .premium-plan dl { margin:8px 0; }
  .premium-plan-row { min-height:0; }
  .premium-plan-row dt { font-size:10px; gap:8px; }
  .premium-plan-row dd { font-size:10px; }
  .premium-plan-row dt .i { width:17px; height:17px; }
  .premium-plan .premium-buy.btn.primary,.premium-plan-status { min-height:35px; padding-top:7px; padding-bottom:7px; font-size:11px; }
  .premium-has-access .premium-plan-free .premium-plan-footer { padding-bottom:14px; }
  .premium-highlights { padding-top:10px; padding-bottom:10px; }
  .premium-highlights > div > .i { width:25px; height:25px; }
  .premium-highlights b { font-size:10px; }
  .premium-highlights small { font-size:9px; }
}
@media(max-width:800px) {
  .premium-intro h1 { font-size:32px; }
  .premium-profile-preview { display:none; }
  .premium-highlights { grid-template-columns:repeat(2,minmax(0,1fr)); gap:12px; }
  .premium-highlights > div:nth-child(3) { border-left:0; }
}
@media(max-width:650px) {
  .main > .view.premium-page { height:auto; min-height:100%; padding:14px; }
  .premium-intro h1 { font-size:clamp(25px,7vw,40px); }
  .premium-tagline { font-size:12px; }
  .premium-comparison { grid-template-columns:minmax(0,1fr); }
  .premium-plan dl { min-height:245px; }
  .premium-highlights { grid-template-columns:minmax(0,1fr); }
  .premium-highlights > div + div { border-left:0; }
}

/* Итоги месяца */
.wrapped-page { display:flex; flex-direction:column; gap:18px; }
.wrapped-page .page-heading { margin-bottom:0; }
.wrapped-months { display:flex; flex-wrap:wrap; gap:8px; }
.wrapped-months .filter-chip { text-transform:capitalize; }
.wrapped-locked .i { width:14px; height:14px; }
.wrapped-banner .btn, .wrapped-banner .iconbtn { flex:none; }

.wrapped-hero, .wrapped-card, .wrapped-share { border:1px solid rgba(var(--c1),.18); border-radius:18px; background:color-mix(in srgb,rgba(var(--c1),.8) 6%,#0c111ddb); }
.wrapped-hero { display:flex; align-items:center; gap:28px; padding:22px 26px; background:linear-gradient(110deg,color-mix(in srgb,rgba(var(--c1),.8) 12%,#0c111ddb),color-mix(in srgb,rgba(var(--c2),.9) 16%,#11151de8)); }
.wrapped-big { display:flex; align-items:baseline; gap:12px; flex:none; }
.wrapped-big b { font-family:Syne, sans-serif; font-size:64px; font-weight:800; line-height:1; }
.wrapped-big span { max-width:150px; color:var(--muted); font-size:13px; line-height:1.4; }
.wrapped-stats { display:grid; grid-template-columns:repeat(5,minmax(0,1fr)); gap:12px; flex:1; min-width:0; }
.wrapped-stat { display:flex; flex-direction:column; gap:4px; min-width:0; padding-left:14px; border-left:1px solid rgba(var(--c1),.14); }
.wrapped-stat b { font-size:20px; font-weight:750; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; }
.wrapped-stat span { color:var(--muted); font-size:11px; line-height:1.4; }

.wrapped-grid { display:grid; grid-template-columns:repeat(3,minmax(0,1fr)); gap:14px; }
.wrapped-card { padding:16px 18px; min-width:0; }
.wrapped-card h2, .wrapped-share h2 { margin:0 0 12px; font-size:14px; font-weight:750; }
.wrapped-list { list-style:none; margin:0; padding:0; display:flex; flex-direction:column; gap:10px; }
.wrapped-list li { display:flex; align-items:center; gap:10px; min-width:0; }
.wrapped-list .avatar.s { width:36px; height:36px; font-size:14px; flex:none; }
.wrapped-n { width:16px; flex:none; color:var(--muted); font-size:12px; font-weight:700; text-align:right; }
.wrapped-cover { width:36px; height:36px; flex:none; border-radius:9px; background:rgba(var(--c2),.3) center/cover; }
.wrapped-cover.round { border-radius:50%; }
.wrapped-name { display:flex; flex-direction:column; gap:2px; flex:1; min-width:0; }
.wrapped-name b, .wrapped-name small { white-space:nowrap; overflow:hidden; text-overflow:ellipsis; }
.wrapped-name b { font-size:13px; font-weight:650; }
.wrapped-name small { color:var(--muted); font-size:11px; }
.wrapped-meta { flex:none; color:var(--muted); font-size:11px; white-space:nowrap; }
.wrapped-none { margin:0; color:var(--muted); font-size:12px; line-height:1.6; }

.wrapped-share { display:flex; align-items:center; gap:24px; padding:18px 22px; }
.wrapped-share-text { flex:1; min-width:0; }
.wrapped-share-text p { margin:0 0 12px; color:var(--muted); font-size:12px; line-height:1.6; }
.wrapped-share-actions { display:flex; flex-wrap:wrap; gap:8px; margin-bottom:12px; }
.wrapped-share-actions .btn .i { width:15px; height:15px; margin-right:6px; vertical-align:-3px; }
.wrapped-premium-note { margin:0 !important; }
.wrapped-premium-note .text-link { font:inherit; padding:0; }
.wrapped-preview { flex:none; width:216px; aspect-ratio:1080 / 1350; border-radius:14px; overflow:hidden; background:rgba(var(--c1),.08); box-shadow:0 10px 30px rgba(0,0,0,.35); }
.wrapped-preview img { display:block; width:100%; height:100%; }

@media(max-width:1199px) {
  .wrapped-hero { flex-direction:column; align-items:flex-start; }
  .wrapped-stats { width:100%; }
  .wrapped-grid { grid-template-columns:1fr 1fr; }
}
@media(max-width:860px) {
  .wrapped-stats { grid-template-columns:repeat(3,minmax(0,1fr)); }
  .wrapped-grid { grid-template-columns:1fr; }
  .wrapped-share { flex-direction:column-reverse; align-items:flex-start; }
}

/* Account-wide Premium appearance. Colors are validated before becoming CSS variables. */
.profile-tabs { grid-template-columns:repeat(3,minmax(0,1fr)); }
/* Author-chosen names never alter the account's role badge. */
.premium-nick { font-weight:700; }
.premium-nick.nick-solid { color:var(--profile-color) !important; }
.premium-nick:is(.nick-gradient,.nick-animated) { color:transparent !important; -webkit-text-fill-color:transparent; background:linear-gradient(110deg,var(--profile-color),var(--profile-color-2) 55%,var(--profile-color)); background-clip:text; -webkit-background-clip:text; }
.premium-nick.nick-animated { background-size:260% 100%; animation:flow-letter-shimmer 5.6s ease-in-out infinite; }
.user-profile-name { color:inherit; font:inherit; text-align:left; border:0; padding:0; background:none; }
.user-profile-name:hover { text-decoration:underline; text-underline-offset:3px; }
.user-profile-avatar { display:block; flex:none; padding:0; border:0; background:none; border-radius:50%; }
.user-profile-name:focus-visible,.user-profile-avatar:focus-visible { outline:2px solid rgb(var(--c1)); outline-offset:3px; }
.room-member-copy .user-profile-name { display:inline-flex; align-items:center; min-width:0; }

/* Four frames are rendered around the image, without replacing animated GIFs. */
.avatar.premium-frame { position:relative; }
.avatar.frame-halo { outline:2px solid var(--profile-color); outline-offset:2px; box-shadow:0 0 13px color-mix(in srgb,var(--profile-color) 50%,transparent); }
.avatar.frame-orbit::before { content:""; position:absolute; inset:-5px; border:2px dashed var(--profile-color); border-left-color:var(--profile-color-2); border-radius:50%; pointer-events:none; animation:premium-orbit 14s linear infinite; }
.avatar.frame-prism::before { content:""; position:absolute; inset:-4px; border-radius:inherit; padding:2px; background:linear-gradient(135deg,var(--profile-color),#fff,var(--profile-color-2),var(--profile-color)); -webkit-mask:linear-gradient(#fff 0 0) content-box,linear-gradient(#fff 0 0); -webkit-mask-composite:xor; mask:linear-gradient(#fff 0 0) content-box,linear-gradient(#fff 0 0); mask-composite:exclude; pointer-events:none; }
.avatar.frame-vinyl { outline:3px solid #12151d; outline-offset:1px; box-shadow:0 0 0 6px color-mix(in srgb,var(--profile-color) 70%,#303541),0 0 0 7px #20242b; }
@keyframes premium-orbit { to { transform:rotate(360deg); } }
body:not(.active) :is(.avatar.frame-orbit::before,.premium-nick.nick-animated) { animation-play-state:paused; }
@media(prefers-reduced-motion:reduce) { .avatar.frame-orbit::before,.premium-nick.nick-animated { animation:none; } }

/* Banner and pinned track in the account card and the public profile. */
.profile-identity { align-self:start; }
.profile-identity:has(> .profile-banner) { padding:0 0 22px; overflow:hidden; }
.profile-identity > .profile-banner { display:block; width:100%; max-width:none; height:auto; aspect-ratio:3 / 1; flex:none; object-fit:cover; margin:0; }
.profile-identity:has(> .profile-banner) > :not(.profile-banner):not(.profile-portrait) { max-width:calc(100% - 40px); }
.profile-identity:has(> .profile-banner) .profile-portrait { z-index:1; margin:-30px 0 14px; }
.profile-identity:has(> .profile-banner) .profile-avatar.large { width:88px; height:88px; background:var(--panel-bg); padding:4px; }
.profile-identity:has(> .profile-banner) .profile-portrait .avatar { font-size:32px; }
.profile-identity:has(> .profile-banner) .profile-camera { width:30px; height:30px; right:-5px; bottom:0; }
.public-profile-backdrop { z-index:110; }
.public-profile-dialog { position:relative; width:min(390px,calc(100vw - 32px)); max-height:calc(100dvh - 50px); overflow:auto; border:1px solid var(--edge-soft); border-radius:17px; background:var(--panel-bg); box-shadow:0 20px 70px #0007; }
.public-profile-close { position:absolute; top:10px; right:10px; z-index:2; background:#111a; }
.public-profile-banner { display:block; width:100%; height:auto; aspect-ratio:3 / 1; object-fit:cover; }
.public-profile-body { padding:25px; }
.public-profile-body > .avatar { width:76px; height:76px; font-size:30px; margin-bottom:18px; }
.public-profile-dialog:has(.public-profile-banner) .public-profile-body > .avatar { margin-top:-59px; position:relative; }
.public-profile-body h2 { margin:0 0 6px; font-size:22px; line-height:1.4; overflow-wrap:anywhere; }
.public-profile-body .profile-status { display:block; margin-top:10px; }
.public-profile-bio { color:var(--muted); white-space:pre-wrap; overflow-wrap:anywhere; font-size:12px; line-height:1.8; margin:18px 0; }
.public-profile-pin { margin-top:22px; }
.public-profile-pin > span { display:block; color:var(--muted); font-size:10px; margin-bottom:9px; }
.public-profile-pin > button { display:flex; align-items:center; gap:10px; width:100%; padding:10px; border-radius:9px; background:rgba(var(--c1),.07); text-align:left; }
.public-profile-pin img { width:42px; height:42px; object-fit:cover; border-radius:5px; }
.public-profile-pin button > span { display:flex; flex:1; min-width:0; flex-direction:column; gap:5px; }
.public-profile-pin b { font-size:12px; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.public-profile-pin small { color:var(--muted); font-size:10px; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }

/* Message decoration follows the author, not the viewer. */
.msg .bub { position:relative; }
.bub.message-style-accent { border-left:3px solid var(--profile-color) !important; }
.bub.message-style-glow { background:color-mix(in srgb,var(--profile-color) 10%,var(--panel-bg)) !important; box-shadow:0 0 16px color-mix(in srgb,var(--profile-color) 18%,transparent),inset 0 0 0 1px color-mix(in srgb,var(--profile-color) 24%,transparent) !important; }
.chat-reactions { position:relative; display:flex; align-items:center; flex-wrap:wrap; gap:5px; margin-top:8px; }
.reaction-chip { display:inline-flex; align-items:center; justify-content:center; gap:5px; min-width:30px; min-height:24px; padding:2px 6px; border:1px solid var(--edge-soft); border-radius:6px; font-size:13px; background:rgba(var(--c1),.04); }
.reaction-chip > span { color:var(--muted); font-size:10px; }
.reaction-chip.is-mine { background:rgba(var(--c1),.16); border-color:rgba(var(--c1),.4); }
.reaction-chip:disabled { opacity:.7; cursor:default; }
.reaction-picker { position:static; }
.reaction-picker > summary { display:flex; align-items:center; justify-content:center; width:27px; height:24px; color:var(--muted); list-style:none; border-radius:6px; cursor:pointer; }
.reaction-picker > summary::-webkit-details-marker { display:none; }
.reaction-picker .i { width:16px; height:16px; }
.reaction-picker > summary:hover,.reaction-picker[open] > summary { background:rgba(var(--c1),.12); color:var(--text); }
.reaction-options { position:absolute; z-index:12; left:0; bottom:calc(100% + 5px); width:215px; padding:7px; display:grid; grid-template-columns:repeat(4,1fr); gap:4px; border:1px solid var(--edge-soft); border-radius:10px; background:var(--panel-raised); box-shadow:0 10px 30px #0005; }
.reaction-options > button { font-size:21px; min-height:35px; border-radius:6px; }
.reaction-options > button:hover { background:rgba(var(--c1),.13); }
.reaction-options > button:disabled { opacity:.3; cursor:default; }
.player-view .context-chat .msg .bub:is(.message-style-glow,.message-style-accent) { padding:9px 12px; border-radius:9px; }
.context-chat .msg.me > .user-profile-avatar { display:none; }
.player-view .context-chat .msg.me > .user-profile-avatar { display:block; }

/* Profile placement follows the reference: avatar left, overlapping the cover. */
.profile-identity:has(> .profile-banner) { align-items:flex-start; text-align:left; }
.profile-identity:has(> .profile-banner) .profile-portrait { margin:-36px 16px 12px; }
.profile-identity:has(> .profile-banner) > :not(.profile-banner):not(.profile-portrait) { margin-left:16px; margin-right:16px; max-width:calc(100% - 32px); }
.profile-identity:has(> .profile-banner) .profile-presence { margin-top:12px; margin-bottom:14px; }
.public-profile-body { padding:18px; }
.public-profile-body > .avatar { width:96px; height:96px; font-size:36px; margin-bottom:12px; }
.public-profile-dialog:has(.public-profile-banner) .public-profile-body > .avatar { margin-top:-72px; box-shadow:0 0 0 5px var(--panel-bg); }

/* Premium uses the same form scale, surfaces and spacing as account/settings. */
.shell:has(.profile-premium-page) { grid-template-rows:minmax(0,1fr); }
.shell:has(.profile-premium-page) > .player { display:none; }
.shell:has(.profile-premium-page) > .context-panel { bottom:12px; }
.main > .view.profile-premium-page { height:100%; padding:24px 28px; display:flex; flex-direction:column; overflow:hidden; }
.profile-premium-page .page-heading { flex:none; margin-bottom:20px; }
.profile-premium-page .page-heading .h1 { font-size:28px; }
.profile-premium-page .page-heading .sub { display:block; font-size:12px; margin-top:8px; }
.profile-premium-page .profile-layout { display:block; flex:0 1 auto; width:100%; min-height:0; }
.profile-premium-page .profile-editor { min-height:0; padding:16px 20px 18px; }
.profile-premium-page .profile-tabs { padding-bottom:12px; }
.profile-premium-page .profile-tabs button { min-height:42px; padding:8px 12px; font-size:12px; }
.profile-premium-page .profile-panel { padding:18px 0 0; }
.premium-editor { min-width:0; }
.premium-editor-compact { display:grid; grid-template-areas:"settings" "pin" "footer"; grid-template-columns:minmax(0,1fr); gap:16px; }
.premium-editor-compact > .appearance-form { display:contents; }
.appearance-settings-grid { grid-area:settings; display:grid; grid-template-columns:minmax(0,1fr) minmax(0,1fr); align-items:start; gap:24px; min-width:0; }
.appearance-media-column { display:flex; flex-direction:column; gap:18px; min-width:0; }
.premium-editor .appearance-section { min-width:0; padding:0; border:0; }
.premium-editor .appearance-section h3 { margin:0 0 12px; font-size:16px; line-height:1.35; font-weight:650; letter-spacing:-.015em; }
.appearance-section-heading { display:flex; align-items:center; justify-content:space-between; gap:12px; margin-bottom:12px; }
.premium-editor .appearance-section-heading h3 { margin:0; }
.premium-editor .text-link { display:inline-flex; align-items:center; gap:5px; font-size:11px; line-height:1.4; }
.premium-editor .text-link .i { width:14px; height:14px; }
.banner-editor-preview { position:relative; display:flex; align-items:center; justify-content:center; width:min(100%,360px); aspect-ratio:3 / 1; overflow:hidden; border-radius:12px; background:rgba(var(--c1),.055); }
.banner-editor-preview img { position:absolute; inset:0; display:block; width:100%; height:100%; object-fit:cover; }
.banner-editor-preview > span { color:var(--muted); font-size:12px; }
.appearance-inline { display:flex; align-items:center; flex-wrap:wrap; gap:12px; margin-top:10px; }
.appearance-inline small { color:var(--muted); font-size:11px; }
.premium-editor .btn.sm { height:33px; min-height:33px; padding:0 12px; font-size:11px; }
.premium-editor .btn.sm .i { width:16px; height:16px; }
.banner-position-controls { display:grid; grid-template-columns:minmax(0,1fr) minmax(0,1fr); gap:18px; margin-top:12px; }
.banner-position-controls label { display:flex; flex-direction:column; gap:5px; color:var(--muted); font-size:12px; line-height:1.4; min-width:0; }
.banner-position-controls input { width:100%; height:4px; margin:8px 0; accent-color:rgb(var(--c1)); }
.premium-editor .appearance-palette-section { border-top:1px solid var(--edge-soft); padding-top:14px; }
.palette-inline-fields { display:grid; grid-template-columns:minmax(0,1fr) auto; align-items:center; gap:12px; }
.palette-inline-fields > .field { min-width:0; }
.premium-editor .field { width:100%; min-width:0; height:38px; min-height:38px; padding:8px 11px; border:0; border-radius:7px; background:rgba(var(--c1),.055); color:var(--text); font-size:12px; }
.premium-editor select.field option { color:var(--text); background:var(--panel-bg); }
.appearance-colors { display:flex; align-items:center; gap:8px; flex:none; }
.appearance-colors input[type=color] { width:38px; height:38px; flex:none; border:0; padding:3px; border-radius:7px; background:rgba(var(--c1),.055); cursor:pointer; }
.appearance-help { color:var(--muted); font-size:11px; line-height:1.5; margin:8px 0 0; }
.appearance-style-section { display:flex; flex-direction:column; align-items:stretch; gap:14px; }
.premium-editor .appearance-style-section > h3 { margin:0; }
.appearance-control-grid { display:grid; grid-template-columns:minmax(0,1fr) auto; align-items:end; gap:12px; }
.appearance-control-grid > label { display:flex; flex-direction:column; gap:7px; font-size:12px; line-height:1.4; min-width:0; }
.appearance-select { display:grid; grid-template-columns:minmax(100px,.55fr) minmax(0,1fr); gap:14px; align-items:center; min-width:0; font-size:12px; line-height:1.4; }
.appearance-message-preview { display:flex; align-items:flex-start; gap:12px; min-width:0; padding:10px 12px; background:rgba(var(--c1),.035); border-radius:9px; }
.appearance-message-preview > .avatar { flex:none; margin-top:2px; }
.appearance-message-preview .bub { padding:7px 10px; min-width:0; border-radius:7px; background:var(--surface); font-size:12px; }
.appearance-message-preview .message-meta { display:flex; align-items:center; gap:5px; }
.appearance-message-preview .bub p { margin:4px 0 0; line-height:1.5; }
.premium-editor .appearance-pin-section { grid-area:pin; padding-top:14px; border-top:1px solid var(--edge-soft); }
.profile-track-controls { display:grid; grid-template-columns:minmax(0,1fr) minmax(0,1fr); align-items:center; gap:18px; }
.profile-track-search { position:relative; min-width:0; }
.profile-track-search form { display:flex; align-items:center; gap:7px; }
.profile-track-search form input { min-width:0; }
.profile-track-search .iconbtn { width:38px; height:38px; flex:none; }
.profile-track-search .iconbtn .i { width:18px; height:18px; }
.appearance-pinned { min-width:0; display:flex; flex-direction:column; gap:4px; font-size:12px; line-height:1.4; }
.appearance-pinned :is(b,span) { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.appearance-pinned span { color:var(--muted); font-size:11px; }
.appearance-save-footer { grid-area:footer; display:flex; align-items:center; justify-content:space-between; gap:16px; padding-top:14px; border-top:1px solid var(--edge-soft); }
.appearance-save-footer .profile-form-status { margin:0; min-width:0; color:var(--muted); font-size:12px; line-height:1.5; }
.appearance-save-footer .profile-form-status.bad { color:#efa8b5; }
.appearance-save-footer .profile-form-status:empty { display:none; }
.appearance-save-footer .profile-form-actions { margin-left:auto; flex:none; gap:10px; }
.appearance-save-footer .btn { height:38px; min-height:38px; padding:8px 16px; font-size:12px; }
.appearance-save-footer .btn.primary { background:var(--text); color:var(--panel-bg); box-shadow:none; }
.profile-track-results { position:absolute; bottom:calc(100% + 8px); left:0; z-index:30; width:max(100%,300px); max-width:calc(100vw - 60px); padding:8px; border:1px solid var(--edge-soft); border-radius:12px; background:var(--panel-raised); box-shadow:0 12px 35px #0006; }
.profile-track-results[hidden] { display:none; }
.profile-track-result-heading { padding:6px 8px 9px; font-size:11px; color:var(--muted); }
.profile-track-result { display:flex; align-items:center; width:100%; gap:10px; padding:8px; border-radius:7px; text-align:left; }
.profile-track-result:hover,.profile-track-result:focus-visible { background:rgba(var(--c1),.13); }
.profile-track-result > img { width:34px; height:34px; flex:none; object-fit:cover; border-radius:5px; }
.profile-track-result > span { flex:1; min-width:0; display:flex; flex-direction:column; gap:4px; }
.profile-track-result b,.profile-track-result small { white-space:nowrap; overflow:hidden; text-overflow:ellipsis; font-size:12px; }
.profile-track-result small { color:var(--muted); font-size:11px; }
.profile-track-result > .i { width:16px; height:16px; }
.profile-track-pages { display:flex; align-items:center; justify-content:space-between; padding:4px 6px; font-size:11px; color:var(--muted); }
.profile-track-pages button { display:grid; place-items:center; width:30px; height:30px; border-radius:6px; }
.profile-track-pages .i { width:16px; height:16px; }
@media(max-width:1199px) {
  .main > .view.profile-premium-page { padding-left:20px; padding-right:20px; }
  .profile-premium-page .profile-editor { padding-left:16px; padding-right:16px; }
  .appearance-settings-grid { gap:20px; }
  .appearance-inline { gap:10px; }
  .appearance-inline small { flex-basis:100%; }
  .appearance-control-grid { gap:10px; }
  .appearance-colors { gap:6px; }
  .appearance-colors input[type=color] { width:36px; }
}
@media(max-height:900px) {
  .main > .view.profile-premium-page { padding-top:18px; padding-bottom:18px; }
  .profile-premium-page .page-heading { margin-bottom:14px; }
  .profile-premium-page .profile-editor { padding-top:12px; padding-bottom:12px; }
  .profile-premium-page .profile-tabs { padding-bottom:8px; }
  .profile-premium-page .profile-tabs button { min-height:38px; }
  .profile-premium-page .profile-panel { padding-top:12px; }
  .premium-editor-compact { gap:10px; }
  .premium-editor .appearance-section h3 { font-size:14px; margin-bottom:8px; }
  .premium-editor .appearance-section-heading h3,.premium-editor .appearance-style-section > h3 { margin:0; }
  .appearance-section-heading { margin-bottom:8px; }
  .appearance-media-column { gap:12px; }
  .banner-editor-preview { max-width:300px; }
  .banner-position-controls { margin-top:8px; gap:12px; }
  .banner-position-controls input { height:4px; }
  .appearance-inline { margin-top:8px; }
  .premium-editor .appearance-palette-section { padding-top:10px; }
  .appearance-style-section { gap:10px; }
  .appearance-message-preview { padding:8px 10px; gap:10px; }
  .appearance-message-preview .bub { padding:5px 8px; }
  .premium-editor .appearance-pin-section,.appearance-save-footer { padding-top:10px; }
}
@media(max-height:740px) {
  .main > .view.profile-premium-page { padding-top:12px; padding-bottom:12px; }
  .profile-premium-page .page-heading { margin-bottom:8px; }
  .profile-premium-page .page-heading .sub { margin-top:4px; }
  .profile-premium-page .profile-editor { padding-top:10px; padding-bottom:10px; }
  .profile-premium-page .profile-panel { padding-top:8px; }
  .premium-editor-compact { gap:8px; }
  .appearance-settings-grid { gap:20px; }
  .appearance-media-column { gap:8px; }
  .banner-editor-preview { max-width:255px; }
  .appearance-inline small,.appearance-help { display:none; }
  .appearance-style-section { gap:8px; }
  .premium-editor .appearance-style-section > h3 { display:none; }
  .appearance-control-grid > label { display:grid; grid-template-columns:80px minmax(0,1fr); align-items:center; gap:8px; }
  .premium-editor .field { height:36px; min-height:36px; padding-top:7px; padding-bottom:7px; }
  .appearance-colors input[type=color] { height:36px; width:34px; }
  .appearance-select { grid-template-columns:minmax(100px,.55fr) minmax(0,1fr); gap:10px; }
  .appearance-message-preview { padding:6px 8px; }
  .appearance-message-preview .bub { padding:4px 7px; }
  .appearance-message-preview .bub p { margin-top:2px; }
  .appearance-save-footer .btn,.profile-track-search .iconbtn { height:36px; min-height:36px; }
}

/* Shared control geometry across all Flow screens. Loaded after feature styles. */
:root {
  --control-radius: 7px;
  --icon-control-radius: 6px;
  --play-control-radius: 8px;
  --play-control-fill: rgba(var(--c1), .14);
}

/* The sidebar is navigation on the page, without an enclosing card. */
.shell .sidebar {
  border: 0;
  background: none;
  box-shadow: none;
  backdrop-filter: none;
  -webkit-backdrop-filter: none;
}

/* Search has the same quiet geometry as the other controls, including on focus. */
.app-header .global-search {
  border: 0;
  border-radius: 8px;
  background: rgba(var(--c1), .045);
  box-shadow: none;
  transition: background-color 200ms ease;
}
.app-header .global-search:focus-within {
  background: rgba(var(--c1), .1);
  box-shadow: none;
}
.global-search kbd { border: 0; background: rgba(var(--c1), .06); }

/* Artwork tiles keep their own geometry; action controls share this shape. */
button:is(
  .btn, .btn.primary, .iconbtn, .playbtn, .filter-chip, .filter-chip.on,
  .nav, .nav.on, .library-item, .side-room, .side-toggle, .profile-settings,
  .track-play, .track-more, .hero-source, .hero-queue-all, .wave-btn,
  .code-pill, .perm-lock, .update-btn, .emoji-btn, .chat-latest, .switch
),
:is(.page-tabs, .tabs, .profile-tabs, .eq-presets, .emoji-tabs, .emoji-grid, .pl-menu, .profile-menu-actions) > button {
  border: 0;
  border-radius: var(--control-radius);
  box-shadow: none;
}

button.iconbtn { --control-radius: var(--icon-control-radius); }
button.playbtn { --control-radius: var(--play-control-radius); }

/* Clear older inset rims and playback glows, including the main transport. */
.hero-transport .hero-play,
.player-view .stage-controls .playbtn {
  border: 0;
  box-shadow: none;
}

/* A quieter transport, with the icon kept fully opaque. */
button.playbtn { width: 36px; height: 36px; background: var(--play-control-fill); }
.hero-stage .hero-transport .playbtn { width: 38px; height: 38px; background: var(--play-control-fill); }
.player-view .stage-controls .playbtn { width: 40px; height: 40px; background: var(--play-control-fill); }
button.playbtn > svg { color: var(--text); opacity: 1; }
.hero-stage .hero-transport .playbtn > svg,
.player-view .stage-controls .playbtn > svg { width: 20px; height: 20px; }

/* Room discovery and preferences use fills and spacing instead of frames. */
:is(.rooms-page, .settings-page) :is(
  .room-entry-card, .room-card, .room-tile, .public-room, .empty,
  .card, .service, .service-ico, .theme, .theme .sw, .page-tabs, .field
),
.room-visibility-option,
.form-modal,
.form-modal .field {
  border: 0;
  box-shadow: none;
}
.settings-page .theme { background: rgba(var(--c1), .045); }
.settings-page .theme:hover { background: rgba(var(--c1), .09); }
.settings-page .theme.on { background: rgba(var(--c1), .18); }
.settings-page .theme.on:hover { background: rgba(var(--c1), .23); }

.profile-page :is(
  .profile-identity, .profile-editor, .profile-tabs, .profile-tabs > button,
  .profile-field .field, .profile-input-prefix, .profile-avatar, .profile-avatar > .avatar
) {
  border: 0;
  box-shadow: none;
}
.profile-page .profile-portrait .profile-avatar { padding: 0; background: none; }
.profile-page .profile-field .field { background: rgba(var(--c1), .055); }
.profile-page .profile-field .field[aria-invalid="true"] { background: rgba(225, 140, 156, .1); }

@media (max-height: 780px) {
  .hero-stage .hero-transport .playbtn { width: 34px; height: 34px; }
  .player-view .stage-controls .playbtn { width: 36px; height: 36px; }
}

.filter-chip { background: rgba(var(--c1), .065); }
.filter-chip:hover { background: rgba(var(--c1), .12); }
.filter-chip.on {
  background: rgba(var(--c1), .2);
  color: var(--text);
}
.filter-chip.on:hover { background: rgba(var(--c1), .26); }
.nav.on { background: rgba(var(--c1), .16); }
.nav.on:hover { background: rgba(var(--c1), .21); }
.btn:not(.primary):not(.danger):not(:disabled):hover,
.code-pill:hover,
.hero-queue-all:hover { background: rgba(var(--c1), .14); }

/* Small play/create affordances are spans inside artwork buttons. */
.playlist-open {
  border: 0;
  border-radius: var(--icon-control-radius);
  box-shadow: none;
}
.playlist-create .playlist-art > span {
  border: 0;
  border-radius: var(--control-radius);
  background: rgba(var(--c1), .1);
}
.switch i { border-radius: 3px; }

/* The collapsed account trigger also reads as a square control. */
#me .profile-settings .profile-avatar {
  border: 0;
  border-radius: var(--control-radius);
  padding: 0;
  background: none;
  box-shadow: none;
}
#me .profile-settings .profile-avatar > .avatar {
  border-radius: var(--control-radius);
  box-shadow: none;
}

/* Keyboard focus continues to use the app's focus-visible outline. */

.crossfade-options { display:flex; align-items:center; flex-wrap:wrap; gap:14px; margin-top:16px; }
.crossfade-options label { display:flex; align-items:center; gap:12px; font-size:12px; }
.crossfade-options select.field { width:86px; height:36px; padding:6px 10px; background:rgba(var(--c1),.07); border:0; border-radius:7px; }
.crossfade-options > span { flex:1; min-width:180px; color:var(--muted); font-size:11px; line-height:1.6; }
.crossfade-settings .switch:disabled { cursor:default; opacity:.4; }

/* Импорт в новый плейлист из Яндекс Музыки / SoundCloud */
.pl-import { display:flex; flex-direction:column; gap:6px; margin:4px 0 14px; padding:14px 16px; border:1px solid rgba(var(--c1),.18); border-radius:16px; background:color-mix(in srgb,rgba(var(--c1),.8) 5%,#0c111dcc); }
.pl-import > b { font-size:14px; font-weight:700; }
.pl-import > span { color:var(--muted); font-size:12px; line-height:1.5; }
.pl-import-row { display:flex; gap:8px; align-items:center; margin-top:4px; }
.pl-import-row .searchbox { flex:1; min-width:0; }
.pl-import-row .btn { flex:none; }

/* Уведомление с отменой (разбитое сердце в «Моём flow») */
.undo-toast { display:flex; align-items:center; gap:12px; overflow:hidden; cursor:default; }
.undo-toast .undo-text { flex:1; min-width:0; }
.undo-toast .undo-btn { flex:none; }
.undo-toast .undo-btn b { display:inline-block; min-width:1ch; margin-left:4px; font-variant-numeric:tabular-nums; }
.undo-toast .undo-bar { position:absolute; left:0; bottom:0; height:2px; width:100%; background:rgb(var(--c1)); transform-origin:left; animation:undo-bar linear forwards; }
@keyframes undo-bar { from { transform:scaleX(1); } to { transform:scaleX(0); } }
@media(prefers-reduced-motion:reduce) { .undo-toast .undo-bar { animation:none; display:none; } }

/* «Управление аккаунтом» (FLOW-21): раскладка как в настройках Telegram/Discord — слева мини-профиль и разделы,
   справа содержимое; вкладка Premium — настройки плитками слева и живая карточка «Так тебя увидят» справа. */
.profile-page.account-layout .profile-layout { max-width:1180px; }
.profile-page.account-layout .profile-editor { min-height:0; }
.profile-page.account-layout .profile-panel { padding-top:18px; }
.profile-page.account-layout .profile-section-heading { margin-bottom:14px; }
.profile-page.account-layout .profile-section-heading h2 { font-size:17px; }
.profile-page.account-layout .profile-form { gap:14px; }
.profile-page.account-layout .profile-field { gap:6px; }
.profile-page.account-layout .profile-field > p { font-size:11px; margin:0; }
.profile-page.account-layout .session-row { padding:11px 0; gap:10px; }
.profile-page.account-layout .session-row .session-meta { display:block; font-size:12px; color:var(--muted); margin-top:3px; }
.profile-page.account-layout .session-list { margin-bottom:12px; }
.profile-page.account-layout .profile-sessions, .profile-page.account-layout .profile-discord { margin-bottom:18px; padding-bottom:16px; border-bottom:1px solid var(--edge-soft); }
.profile-page.account-layout .profile-form-footer { margin-top:2px; }
.profile-page.account-layout .profile-layout { display:grid; grid-template-columns:250px minmax(0, 1fr); grid-template-rows:auto 1fr; gap:14px 18px; align-items:start; }
.profile-page.account-layout .profile-editor { display:contents; }
.profile-page.account-layout .profile-identity { grid-column:1; grid-row:1; padding:18px 16px 14px; align-items:flex-start; text-align:left; display:grid; grid-template-columns:auto minmax(0, 1fr); column-gap:12px; row-gap:0; }
.profile-page.account-layout .profile-identity > * { grid-column:2; margin:0 !important; max-width:none !important; }
.profile-page.account-layout .profile-identity > .profile-banner { grid-column:1 / -1; width:calc(100% + 32px); margin:-18px -16px 12px !important; aspect-ratio:3 / 1; height:auto; object-fit:cover; }
.profile-page.account-layout .profile-identity > .profile-portrait { grid-column:1; grid-row:span 3; align-self:center; }
.profile-page.account-layout .profile-identity .profile-avatar.large { width:52px !important; height:52px !important; padding:2px !important; }
.profile-page.account-layout .profile-identity .profile-portrait .avatar { font-size:20px !important; }
.profile-page.account-layout .profile-identity .profile-camera { width:22px; height:22px; right:-5px; bottom:-3px; }
.profile-page.account-layout .profile-identity .profile-camera svg { width:12px; height:12px; }
.profile-page.account-layout .profile-identity > h2 { font-size:16px; line-height:1.25; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.profile-page.account-layout .profile-identity > .profile-tag { font-size:12px; }
.profile-page.account-layout .profile-identity > .profile-status { justify-self:start; margin-top:4px !important; transform:scale(.9); transform-origin:left center; }
.profile-page.account-layout .profile-identity > :is(.profile-presence, .profile-avatar-help, .profile-avatar-upload) { display:none; }
.profile-page.account-layout .profile-identity > .profile-avatar-remove { grid-column:1 / -1; margin-top:10px !important; font-size:12px; }
.profile-page.account-layout .profile-identity > .profile-form-status { grid-column:1 / -1; }
.profile-page.account-layout .profile-identity > .profile-form-status:empty { display:none; }
.profile-page.account-layout .profile-identity > .profile-logout { grid-column:1 / -1; justify-self:start; margin-top:12px !important; padding-top:12px; border-top:1px solid var(--edge-soft); width:100%; }
.profile-page.account-layout .profile-tabs { grid-column:1; grid-row:2; display:flex; flex-direction:column; gap:2px; padding:8px; border-radius:var(--radius-lg, 18px); background:var(--panel-bg); width:auto; }
.profile-page.account-layout .profile-tabs button { justify-content:flex-start; padding:10px 12px; width:100%; }
.profile-page.account-layout .profile-panel { grid-column:2; grid-row:1 / span 2; padding:22px 26px; border-radius:var(--radius-lg, 18px); background:var(--panel-bg); max-width:760px; }
@media (max-width: 1180px) {
  .profile-page.account-layout .profile-layout { grid-template-columns:220px minmax(0, 1fr); }
}
.profile-page.account-layout .profile-panel:has(.pm-v2) { max-width:1120px; }
.pm { display:flex; flex-direction:column; gap:14px; }
.pm .pm-row { padding:16px 18px; border-radius:16px; background:rgba(var(--c1), .045); border:1px solid var(--edge-soft); min-width:0; }
.pm .pm-card-head { display:flex; align-items:flex-start; gap:12px; margin-bottom:14px; }
.pm .pm-card-head > div { flex:1; min-width:0; }
.pm .pm-card-head h3 { margin:0; font-size:15px; font-weight:650; }
.pm .pm-card-head p { margin:2px 0 0; font-size:12px; color:var(--muted); line-height:1.45; }
.pm .pm-card-head > .text-link { font-size:12px; white-space:nowrap; align-self:center; }
.pm .pm-card-icon { width:34px; height:34px; flex:none; display:grid; place-items:center; border-radius:11px; background:linear-gradient(135deg, rgba(var(--c1), .32), rgba(var(--c1), .12)); color:rgb(var(--c1)); box-shadow:inset 0 0 0 1px rgba(var(--c1), .3); }
.pm .pm-card-icon .i { width:17px; height:17px; }
.pm .pm-options { display:flex; flex-wrap:wrap; gap:8px; }
.pm .pm-option { position:relative; cursor:pointer; }
.pm .pm-option input { position:absolute; opacity:0; pointer-events:none; }
.pm .pm-option-body { display:flex; flex-direction:column; align-items:center; gap:6px; padding:10px 12px; border-radius:12px; border:1px solid var(--edge-soft); background:rgba(var(--c1), .03); transition:border-color .15s, background .15s, transform .15s; min-width:92px; text-align:center; }
.pm .pm-option-body small { font-size:11px; color:var(--muted); }
.pm .pm-option:hover .pm-option-body { border-color:rgba(var(--c1), .45); }
.pm .pm-option input:checked + .pm-option-body { border-color:rgb(var(--c1)); background:rgba(var(--c1), .14); box-shadow:0 0 0 3px rgba(var(--c1), .14); }
.pm .pm-option input:checked + .pm-option-body small { color:var(--text); }
.pm .pm-option input:focus-visible + .pm-option-body { outline:2px solid rgb(var(--c1)); outline-offset:2px; }
.pm .pm-names .pm-option-body { min-width:120px; padding:12px 14px; }
.pm .pm-name-sample { font-size:15px; font-weight:700; white-space:nowrap; }
.pm .pm-tiles { display:grid; grid-template-columns:repeat(auto-fill, minmax(86px, 1fr)); }
.pm .pm-tiles .pm-option-body { min-width:0; padding:14px 8px 10px; }
.pm .pm-frame-sample { height:46px; display:grid; place-items:center; }
.pm .pm-frame-sample .avatar.m { width:38px; height:38px; font-size:15px; }
.pm .pm-msgs { grid-template-columns:repeat(3, minmax(0, 1fr)); }
.pm .pm-bubble { display:block; width:100%; padding:8px 10px; border-radius:12px; background:rgba(var(--c1), .08); font-size:12px; text-align:left; }
.pm .pm-bubble p { margin:0; }
.pm .pm-bubble.message-style-accent { border-left:3px solid var(--profile-color); border-radius:3px 12px 12px 3px; }
.pm .pm-bubble.message-style-glow { box-shadow:0 0 18px color-mix(in srgb, var(--profile-color) 45%, transparent), inset 0 0 0 1px color-mix(in srgb, var(--profile-color) 55%, transparent); }
.pm .pm-colors { display:flex; align-items:center; flex-wrap:wrap; gap:8px; margin-top:14px; }
.pm .pm-colors-label { font-size:12px; color:var(--muted); margin-right:2px; }
.pm .pm-sep { width:1px; height:22px; background:var(--edge-soft); margin:0 4px; }
.pm .pm-swatch { position:relative; width:34px; height:34px; border-radius:50%; background:var(--sw); cursor:pointer; flex:none; box-shadow:0 0 0 2px rgba(255,255,255,.14), 0 4px 12px color-mix(in srgb, var(--sw) 40%, transparent); transition:transform .15s; }
.pm .pm-swatch:hover { transform:scale(1.08); }
.pm .pm-swatch::after { content:""; position:absolute; right:-2px; bottom:-2px; width:13px; height:13px; border-radius:50%; background:var(--panel-bg); box-shadow:inset 0 0 0 1.5px var(--muted); -webkit-mask:radial-gradient(circle, #000 2px, transparent 2.5px) center/100% 100%; }
.pm .pm-swatch input { position:absolute; inset:0; width:100%; height:100%; opacity:0; cursor:pointer; border:0; padding:0; }
.pm .pm-swatch:focus-within { box-shadow:0 0 0 2px rgb(var(--c1)), 0 0 0 4px rgba(var(--c1), .25); }
.pm .pm-preset { width:24px; height:24px; border-radius:50%; border:0; padding:0; cursor:pointer; background:linear-gradient(135deg, var(--a), var(--b)); box-shadow:0 0 0 1px rgba(255,255,255,.12); transition:transform .15s; }
.pm .pm-preset:hover { transform:scale(1.15); }
.pm .pm-palette-row { display:flex; align-items:center; gap:10px; }
.pm .pm-palette-row .field { flex:1; min-width:0; }
.pm .pm-palette-strip { height:8px; border-radius:99px; margin:12px 0 10px; }
.pm .pm-palette-presets { display:flex; flex-wrap:wrap; gap:6px; }
.pm .pm-palette-preset { display:inline-flex; align-items:center; gap:7px; padding:5px 10px 5px 6px; border-radius:99px; border:1px solid var(--edge-soft); background:rgba(var(--c1), .03); color:var(--text); font-size:12px; cursor:pointer; }
.pm .pm-palette-preset:hover { border-color:rgba(var(--c1), .45); }
.pm .pm-palette-preset i { width:22px; height:12px; border-radius:99px; }
.pm .banner-editor-preview { border-radius:12px; }
.pm .banner-position-controls { margin-top:10px; }
.pm .appearance-message-preview { margin-top:12px; }
.pm .pm-save { position:sticky; bottom:0; z-index:3; margin-top:2px; padding:12px 14px; border-radius:14px; border:1px solid var(--edge-soft); background:color-mix(in srgb, var(--panel-bg) 88%, transparent); backdrop-filter:blur(14px); }
.pm.pm-v2 .pm-v2-grid { display:grid; grid-template-columns:minmax(0, 1fr) 300px; gap:16px; align-items:start; }
.pm.pm-v2 .pm-v2-settings { display:flex; flex-direction:column; gap:12px; }
.pm.pm-v2 .pm-v2-aside { position:sticky; top:12px; display:flex; flex-direction:column; gap:12px; }
.pm.pm-v2 .pm-aside-label { font-size:11px; letter-spacing:.08em; text-transform:uppercase; color:var(--muted); }
.pm .pm-profile-card { border-radius:18px; overflow:hidden; background:var(--panel-bg); border:1px solid var(--edge-soft); box-shadow:0 18px 40px -20px rgba(0,0,0,.6); }
.pm .pm-pc-banner { aspect-ratio:3 / 1; position:relative; }
.pm .pm-pc-banner img { position:absolute; inset:0; width:100%; height:100%; object-fit:cover; }
.pm .pm-pc-body { padding:0 16px 16px; }
.pm .pm-pc-avatar { margin-top:-30px; margin-bottom:8px; }
.pm .pm-pc-avatar .avatar.l { width:64px; height:64px; font-size:24px; box-shadow:0 0 0 4px var(--panel-bg); }
.pm .pm-pc-name { font-size:18px; font-weight:700; }
.pm .pm-pc-tag { font-size:12px; color:var(--muted); margin-bottom:10px; }
.pm .pm-pc-track { display:flex; gap:8px; align-items:center; font-size:12px; padding:8px 10px; border-radius:10px; background:rgba(var(--c1), .07); margin-bottom:10px; }
.pm .pm-pc-track span { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.pm .pm-pc-chat { display:flex; gap:8px; align-items:flex-start; padding-top:10px; border-top:1px solid var(--edge-soft); }
.pm .pm-pc-chat .bub { padding:7px 10px; border-radius:12px; background:rgba(var(--c1), .08); font-size:12px; }
.pm .pm-pc-chat .bub p { margin:2px 0 0; }
.pm .pm-pc-chat .bub.message-style-accent { border-left:3px solid var(--profile-color); border-radius:3px 12px 12px 3px; }
.pm .pm-pc-chat .bub.message-style-glow { box-shadow:0 0 18px color-mix(in srgb, var(--profile-color) 45%, transparent), inset 0 0 0 1px color-mix(in srgb, var(--profile-color) 55%, transparent); }
.pm.pm-v2 .pm-track .profile-track-controls { flex-direction:column; align-items:stretch; }
@media (max-width: 1180px) {
  .pm.pm-v2 .pm-v2-grid { grid-template-columns:1fr; }
  .pm.pm-v2 .pm-v2-aside { position:static; order:-1; }
}
.pm .pm-swatch::after { content:none; }
.pm .pm-save { background:var(--panel-bg); box-shadow:0 -10px 24px -12px rgba(0,0,0,.55); }
.pm .banner-editor-preview { width:100%; max-width:none; aspect-ratio:4 / 1; height:auto; }
.pm .pm-tiles:not(.pm-msgs) { grid-template-columns:repeat(5, minmax(0, 1fr)); }
.pm .pm-names { display:grid; grid-template-columns:repeat(2, minmax(0, 1fr)); }
.pm.pm-v2 .pm-names { grid-template-columns:repeat(4, minmax(0, 1fr)); }
.pm .pm-names .pm-option-body { min-width:0; }
.pm .pm-names .pm-option-body small { line-height:1.25; }
.pm.pm-v2 .pm-track .profile-track-controls { display:flex; flex-direction:column; gap:10px; }
.pm.pm-v2 .pm-track .profile-track-search, .pm.pm-v2 .pm-track .profile-track-search form { width:100%; }
.pm.pm-v2 .pm-track .profile-track-search form { display:flex; gap:6px; }
.pm.pm-v2 .pm-track .profile-track-search input { flex:1; min-width:0; }

/* Account popover: profile artwork and identity above a short, themed action list. */
.profile-menu {
  --menu-surface:var(--panel-bg);
  position:fixed;
  z-index:75;
  width:368px;
  max-width:calc(100vw - 24px);
  overflow:auto;
  overscroll-behavior:contain;
  border:1px solid rgba(var(--c1), .32);
  border-radius:16px;
  background:var(--menu-surface);
  color:var(--text);
  box-shadow:0 18px 60px #0007, 0 0 24px rgba(var(--c1), .06);
  animation:surface-arrive 180ms var(--motion-ease) both;
  scrollbar-width:thin;
}
.profile-menu-banner { display:block; width:100%; height:auto; aspect-ratio:3 / 1; object-fit:cover; border-radius:15px 15px 10px 10px; }
.profile-menu-banner-fallback {
  background:radial-gradient(ellipse at 20% 80%, rgba(var(--c1), .28), transparent 65%), radial-gradient(ellipse at 90% 0%, rgba(var(--c2), .2), transparent 70%), var(--panel-raised);
}
.profile-menu-body { padding:0 16px 18px; }
.profile-menu-info { position:relative; display:grid; grid-template-columns:88px minmax(0,1fr); gap:16px; align-items:start; margin-top:-22px; padding-bottom:20px; }
.profile-menu-portrait { position:relative; width:88px; height:88px; }
.profile-menu-portrait > .profile-avatar.large { width:88px; height:88px; box-shadow:0 0 0 5px var(--menu-surface); }
.profile-menu-portrait .avatar { font-size:32px; }
.profile-menu-presence { position:absolute; z-index:1; right:3px; bottom:-3px; width:28px; height:28px; border:6px solid var(--menu-surface); border-radius:50%; background:#85878f; }
.profile-menu-presence.is-online { background:#43a36c; }
.profile-menu-presence > span { position:absolute; width:1px; height:1px; overflow:hidden; clip-path:inset(50%); white-space:nowrap; }
.profile-menu-identity { display:flex; flex-direction:column; align-items:flex-start; min-width:0; gap:4px; padding-top:29px; }
.profile-menu-display { display:flex; align-items:center; gap:8px; min-width:0; max-width:100%; }
.profile-menu-display > b { min-width:0; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:21px; line-height:1.35; font-weight:800; letter-spacing:-.04em; }
.profile-menu-display > .premium-badge { width:22px; height:22px; border-radius:5px; box-shadow:0 0 12px rgba(var(--c1), .18); }
.profile-menu-tag { max-width:100%; color:var(--muted); overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:13px; line-height:1.5; }
.profile-menu-identity > .profile-menu-role { top:0; margin:5px 0 0; padding:4px 9px; border-radius:4px; font-size:10px; line-height:1.4; letter-spacing:.08em; }
.profile-menu-bio { margin:0 0 16px; color:var(--muted); font-size:12px; line-height:1.6; white-space:pre-wrap; overflow-wrap:anywhere; }
.profile-menu-pin { display:flex; align-items:center; gap:10px; width:100%; padding:11px 12px; margin:0 0 14px; border-radius:8px; background:rgba(var(--c1), .06); text-align:left; transition:background 160ms ease; }
.profile-menu-pin:hover { background:rgba(var(--c1), .12); }
.profile-menu-pin > .i { flex:none; width:18px; height:18px; color:rgb(var(--c1)); }
.profile-menu-pin > span { display:flex; flex-direction:column; gap:4px; min-width:0; flex:1; }
.profile-menu-pin small { color:var(--muted); font-size:10px; }
.profile-menu-pin b { overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:12px; }
.profile-menu-actions { display:flex; flex-direction:column; gap:9px; }
.profile-menu-actions > button {
  display:flex;
  align-items:center;
  gap:12px;
  width:100%;
  min-height:52px;
  padding:12px 14px;
  border:1px solid rgba(var(--c1), .1);
  border-radius:9px;
  background:rgba(var(--c1), .025);
  color:var(--text);
  text-align:left;
  font-size:13px;
  font-weight:500;
  line-height:1.45;
  transition:background 160ms ease, border-color 160ms ease;
}
.profile-menu-actions > button > .i { flex:none; width:20px; height:20px; color:var(--muted); }
.profile-menu-actions > button > span:not(.profile-menu-chevron) { flex:1; }
.profile-menu-chevron { display:flex; align-items:center; flex:none; color:var(--muted); }
.profile-menu-chevron > .i { width:16px; height:16px; }
.profile-menu-actions > button:hover { background:rgba(var(--c1), .085); border-color:rgba(var(--c1), .24); }
.profile-menu-actions > button:active { background:rgba(var(--c1), .14); }
.profile-menu-actions > .profile-premium-link { border:1px solid rgba(var(--c1), .8); background:rgba(var(--c1), .09); box-shadow:inset 0 0 0 1px rgba(var(--c1), .15); }
.profile-menu-actions > .profile-premium-link > .i { color:rgb(var(--c1)); }
.profile-menu-actions > .profile-premium-link:hover { background:rgba(var(--c1), .16); border-color:rgb(var(--c1)); }
.profile-menu :is(button,.profile-menu-pin):focus-visible { outline:2px solid rgb(var(--c1)); outline-offset:2px; }
.profile-menu-actions > [data-act="profile-logout"] { color:var(--muted); }
@media (max-height:740px) {
  .profile-menu { width:352px; }
  .profile-menu-body { padding:0 14px 14px; }
  .profile-menu-info { gap:14px; padding-bottom:16px; }
  .profile-menu-actions { gap:8px; }
  .profile-menu-actions > button { min-height:46px; padding:10px 12px; }
}
@media (prefers-reduced-motion:reduce) { .profile-menu { animation:none; } .profile-menu-actions > button { transition:none; } }

/* Чат комнаты — компактно, как в мессенджерах. Подключается последним и перекрывает старые правила чата
   из styles.css / redesign.css / profile-premium.css.
   - сообщения подряд от одного человека (до 5 минут) — группа: аватар и ник только у первого (.cont у остальных);
   - стиль сообщения Premium (подсветка, полоска) красит только «пилюлю» с текстом, а не весь блок;
   - кнопка реакции — при наведении в углу сообщения, отдельную строку не занимает. */

.context-chat .chat,
.player-view .context-chat .chat { gap:0; padding:12px 6px 10px; }

.context-chat .msg { position:relative; margin-top:12px; padding:3px 6px; border-radius:8px; transition:background-color 120ms ease; }
.context-chat .msg:first-child { margin-top:0; }
.context-chat .msg.cont { margin-top:2px; }
.context-chat .msg:not(.sys):hover,
.context-chat .msg:not(.sys):focus-within { background:rgba(var(--c1),.05); }
.context-chat .msg.sys { margin:12px 0 2px; padding:0 8px; }

/* продолжение группы: аватар не виден, но держит отступ, ника и времени нет */
.context-chat .msg.cont > .user-profile-avatar { visibility:hidden; height:0; }
.context-chat .msg.cont .message-meta,
.player-view .context-chat .msg.cont .message-meta,
.player-view .context-chat .msg.me.cont .message-meta { display:none; }
.player-view .context-chat .message-meta,
.player-view .context-chat .msg.me .message-meta { margin-bottom:3px; }

/* текст — в «пилюле»; в «Плеере» она есть у всех, в боковой панели — у своих (как было) и у оформленных */
.player-view .context-chat .msg .bub p { padding:6px 11px; border-radius:4px 12px 12px; line-height:1.5; }
.player-view .context-chat .msg.cont .bub p { border-radius:12px; }

/* стиль сообщения Premium: только у текста, без рамки вокруг ника и времени */
.context-chat .bub:is(.message-style-glow,.message-style-accent),
.player-view .context-chat .msg .bub:is(.message-style-glow,.message-style-accent) {
  padding:0 !important; border:0 !important; border-radius:0 !important; background:none !important; box-shadow:none !important;
}
.context-chat .bub.message-style-glow p {
  display:inline-block; padding:6px 11px; border-radius:4px 12px 12px;
  background:color-mix(in srgb,var(--profile-color) 14%,transparent) !important;
  box-shadow:inset 0 0 0 1px color-mix(in srgb,var(--profile-color) 26%,transparent),0 0 12px color-mix(in srgb,var(--profile-color) 14%,transparent);
}
.context-chat .bub.message-style-accent p { display:inline-block; padding:6px 11px 6px 9px; border-left:3px solid var(--profile-color); border-radius:3px 12px 12px 3px; background:rgba(var(--c1),.075); }
.context-chat .msg.cont .bub:is(.message-style-glow,.message-style-accent) p { border-top-left-radius:12px; }
.context-chat .msg.cont .bub.message-style-accent p { border-top-left-radius:3px; }
.context-chat .bub.big p { background:none !important; box-shadow:none !important; border:0 !important; padding:0 !important; }

/* реакции: поставленные — маленькие таблетки под текстом; кнопка добавить — в углу при наведении */
.context-chat .msg .bub,
.context-chat .chat-reactions { position:static; }
.context-chat .chat-reactions { margin:0; gap:4px; }
.context-chat .chat-reactions.has-chips { margin-top:4px; }
.context-chat .reaction-chip { min-width:0; min-height:22px; padding:1px 7px; gap:4px; border-radius:11px; font-size:12px; }
.context-chat .reaction-chip > span { font-size:10.5px; }
.context-chat .reaction-picker { position:absolute; top:2px; right:4px; z-index:4; opacity:0; pointer-events:none; transition:opacity 120ms ease; }
.context-chat .msg:hover .reaction-picker,
.context-chat .msg:focus-within .reaction-picker,
.context-chat .reaction-picker[open] { opacity:1; pointer-events:auto; }
.context-chat .reaction-picker > summary { width:28px; height:24px; border:1px solid var(--edge-soft); border-radius:8px; background:var(--panel-raised); box-shadow:0 4px 14px #0005; }
.context-chat .reaction-options { left:auto; right:0; bottom:calc(100% + 4px); width:auto; grid-template-columns:repeat(3,36px); }
/* в боковой панели свои сообщения справа — и реакции под ними тоже; в «Плеере» все сообщения слева */
.context-chat .msg.me .chat-reactions { justify-content:flex-end; }
.player-view .context-chat .msg.me .chat-reactions { justify-content:flex-start; }
/* у верхних сообщений сверху нет места — окно реакций открывается вниз (класс ставит app.js) */
.context-chat .reaction-picker.down .reaction-options { top:calc(100% + 4px); bottom:auto; }

/* «Что нового» — окно на всё приложение после обновления. Фон — волны в цветах темы, как на странице Premium */
.whats-new {
  position:fixed; inset:0; z-index:1000; display:flex; isolation:isolate; overflow:hidden;
  background:#080a11; color:var(--text); animation:wn-in 260ms var(--motion-ease, ease) both;
}
.whats-new::before {
  content:""; position:absolute; z-index:-1; inset:0; pointer-events:none;
  background:linear-gradient(120deg,rgba(var(--c2),.28) 15%,rgb(var(--c3)) 40%,rgb(var(--c1)) 65%,rgb(var(--c2)) 85%,rgb(var(--c3)) 100%);
  mask-image:url("assets/premium-waves.jpg"); mask-mode:luminance; mask-size:cover; mask-position:center; mask-repeat:no-repeat;
  opacity:.55;
}
.whats-new.closing { animation:wn-out 180ms ease both; }
/* заголовок окна (Windows: свернуть/развернуть/закрыть и перетаскивание) остаётся над окном; содержимое начинается ниже него */
body.wn-open .titlebar { z-index:1001; }
@keyframes wn-in { from { opacity:0; transform:scale(1.015); } to { opacity:1; transform:none; } }
@keyframes wn-out { to { opacity:0; transform:scale(1.01); } }

.wn-inner { display:flex; flex-direction:column; gap:22px; width:100%; max-width:1280px; margin:40px auto 0; padding:20px 48px 28px; overflow-y:auto; }
.wn-inner > * { flex-shrink:0; }

.wn-hero { display:flex; flex-direction:column; gap:6px; }
.wn-eyebrow { font-size:11px; font-weight:750; letter-spacing:.14em; text-transform:uppercase; color:color-mix(in srgb,rgb(var(--c1)) 55%,#cfd3e0); }
.wn-hero h1 { margin:0; font:750 clamp(36px,4.4vw,58px)/1.1 Manrope,sans-serif; letter-spacing:-.035em; }
.wn-version {
  display:inline-block; background-image:linear-gradient(110deg,rgb(var(--c1)) 0%,#fff 23%,rgb(var(--c2)) 46%,rgb(var(--c3)) 70%,#fff 83%,rgb(var(--c1)) 100%);
  background-size:260% 100%; color:transparent; -webkit-text-fill-color:transparent; background-clip:text; -webkit-background-clip:text;
  filter:drop-shadow(0 0 6px rgba(var(--c1),.35)); animation:flow-letter-shimmer 5.6s ease-in-out infinite;
}
body:not(.active) .wn-version { animation-play-state:paused; }
.wn-sub { margin:0; font-size:13px; color:var(--muted); }

.wn-grid { display:grid; grid-template-columns:minmax(0,1.75fr) minmax(0,1fr); gap:18px; align-items:start; }
.wn-grid.wn-single { grid-template-columns:minmax(0,1fr); }
.wn-side { display:flex; flex-direction:column; gap:18px; }
.wn-card { padding:20px 22px 22px; border:1px solid rgba(var(--c1),.16); border-radius:16px; background:linear-gradient(150deg,#141826e6,#0e111ae0); box-shadow:0 14px 40px #03040a55; }
.wn-card h2 { display:flex; align-items:center; gap:9px; margin:0 0 14px; font-size:15px; font-weight:750; letter-spacing:-.01em; }
.wn-card h2 .i { width:18px; height:18px; color:rgb(var(--c1)); }
.wn-fixed h2 .i { color:#4ade80; }
.wn-removed h2 .i { color:#f87171; }
.wn-count { margin-left:auto; min-width:24px; padding:2px 8px; border-radius:999px; background:rgba(var(--c1),.12); color:var(--muted); font-size:11px; font-weight:700; text-align:center; }

.wn-list { display:grid; gap:12px; margin:0; padding:0; list-style:none; }
.wn-list.wn-two { grid-template-columns:repeat(2,minmax(0,1fr)); gap:14px 22px; }
.wn-list li { position:relative; display:flex; flex-direction:column; gap:3px; padding-left:14px; min-width:0; }
.wn-list li::before { content:""; position:absolute; left:0; top:7px; width:5px; height:5px; border-radius:50%; background:rgb(var(--c1)); box-shadow:0 0 8px rgba(var(--c1),.6); }
.wn-fixed .wn-list li::before { background:#4ade80; box-shadow:0 0 8px #4ade8088; }
.wn-removed .wn-list li::before { background:#f87171; box-shadow:0 0 8px #f8717188; }
.wn-list b { font-size:13px; font-weight:700; line-height:1.4; }
.wn-list span { font-size:12px; line-height:1.55; color:var(--muted); }

.wn-foot { display:flex; align-items:center; gap:16px; padding-top:4px; }
.wn-foot .btn { min-width:150px; justify-content:center; }
.wn-foot span { font-size:12px; color:var(--dim, var(--muted)); }

@media (max-width:900px) {
  .wn-grid { grid-template-columns:minmax(0,1fr); }
  .wn-list.wn-two { grid-template-columns:minmax(0,1fr); }
  .wn-inner { padding:30px 28px 22px; }
}
/* невысокие экраны (ноутбук 1366×768): всё помещается без прокрутки */
@media (max-height:860px) {
  .wn-inner { gap:12px; padding-top:6px; padding-bottom:16px; }
  .wn-hero { gap:3px; }
  .wn-hero h1 { font-size:clamp(32px,3.6vw,44px); }
  .wn-grid, .wn-side { gap:14px; }
  .wn-card { padding:14px 18px 16px; }
  .wn-card h2 { margin-bottom:10px; font-size:14px; }
  .wn-list { gap:8px; }
  .wn-list.wn-two { gap:9px 20px; }
  .wn-list b { font-size:12.5px; }
  .wn-list span { font-size:11.5px; line-height:1.45; }
}
@media (prefers-reduced-motion:reduce) { .whats-new, .whats-new.closing, .wn-version { animation:none; } }

}
@media (max-width: 760px) {
/* Keep the desktop visual system; adapt its layout to the Android viewport. */
@layer mobile-priority {
  [hidden] { display:none !important; }
  body.web-mobile .main > .player-view { padding:10px 0 24px !important; }
  body.web-mobile .shell .app-header .queue-toggle { display:grid !important; }
  body.web-mobile .shell.context-open .context-scrim { display:block !important; }
}
:root { --mobile-nav-height:64px; --mobile-dock-height:64px; --mobile-header-height:56px; }
html, body { width:100%; height:100%; overflow:hidden; overscroll-behavior:none; }
body { font-size:14px; }
.titlebar, .side-top, .side-library, #side-room, #me { display:none; }
#app { height:100%; }
.shell, .shell.collapsed, .shell.view-home, .shell.view-player {
  display:flex; flex-direction:column; width:100%; height:100%; min-height:0;
  padding:0 0 var(--mobile-nav-height); gap:0; transition:none;
}
.sidebar, .shell.collapsed .sidebar { display:contents; }
.sidebar::before, .sidebar::after { display:none; }
.workspace { display:flex; flex-direction:column; flex:1 1 0; min-width:0; min-height:0; padding:0 12px; }
.app-header { display:flex; align-items:center; flex:none; gap:8px; width:100%; height:var(--mobile-header-height); min-height:var(--mobile-header-height); padding:6px 0; }
.history-controls, .global-search kbd { display:none; }
.global-search { display:flex; flex:1; min-width:0; height:42px; padding:0 12px; }
.global-search input { min-width:0; font-size:14px; }
.global-search > svg { width:18px; height:18px; flex:none; }
.header-actions { flex:none; }
.header-actions .queue-toggle { width:42px; height:44px; }
.main { flex:1 1 0; width:100%; min-width:0; min-height:0; overflow:hidden; border:0; border-radius:0; }
.main > .view, .main > .view:not(.home-view), .main .search-view {
  display:block; width:100%; height:100%; min-height:0; padding:12px 0 24px;
  overflow-y:auto; overflow-x:hidden; overscroll-behavior-y:contain;
  animation:none; transform:none; filter:none; zoom:1;
}
.view > *, .card, .tt, .track-primary, .hero-copy, .stage-description { min-width:0; }
.h1 { font-size:26px; line-height:1.2; overflow-wrap:anywhere; }
.sub { font-size:13px; line-height:1.5; }
.section-heading { gap:10px; margin-bottom:16px; }
.section-heading h2 { font-size:19px; }
.section-heading > button { font-size:12px; }
.btn, .btn.sm { min-height:42px; height:auto; padding:10px 15px; font-size:13px; line-height:1.3; white-space:normal; }
.iconbtn { width:40px; height:44px; min-width:40px; min-height:44px; flex:none; }
.iconbtn > svg { width:20px; height:20px; }
.field, input, textarea, select { min-width:0; font-size:16px; }
.primary-nav {
  position:fixed; z-index:45; inset:auto 0 0; display:flex; flex-direction:row;
  height:var(--mobile-nav-height); padding:5px 2px; gap:0;
  border-top:1px solid var(--edge-soft); background:var(--panel-bg);
}
.primary-nav .nav, .shell.collapsed .primary-nav .nav {
  display:flex; flex-direction:column; flex:1 1 0; align-items:center; justify-content:center;
  min-width:0; min-height:48px; padding:4px 1px; gap:4px;
  font-size:10px; line-height:1.2; border:0; border-radius:0; background:none; box-shadow:none;
}
.primary-nav .nav > span { display:block; white-space:nowrap; max-width:100%; }
.primary-nav .nav svg.i { width:22px; height:22px; flex:none; }
.primary-nav .nav.on { color:rgb(var(--c1)); background:none; box-shadow:none; }
.primary-nav .nav.on svg { color:inherit; filter:none; }
/* As on desktop, Home and Player already have their own transport. */
#player { display:grid; flex:0 0 var(--mobile-dock-height); height:var(--mobile-dock-height); min-height:var(--mobile-dock-height); grid-template-columns:minmax(0,1fr) 88px; align-items:center; gap:6px; margin:0 8px; padding:8px; border-radius:12px; }
.shell.view-player > #player { display:none; }
#player .np { display:flex; min-width:0; gap:9px; }
#player .np .cover { width:40px; height:40px; aspect-ratio:1; flex:none; border-radius:7px; }
#player .np .tt { flex:1; min-width:0; max-width:none; }
#player .np b { display:block; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:14px; line-height:1.4; color:var(--text); }
#player .np span { display:block; margin-top:3px; font-size:11px; line-height:1.3; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; }
#player .np > .iconbtn, #player > .right, #player .progress { display:none; }
#player .controls { width:88px; min-width:0; }
#player .controls .btns { display:flex; width:100%; justify-content:space-between; gap:0; }
#player .controls .btns > * { display:none; }
#player .controls .btns > [data-act="toggle"] { display:grid; width:44px; height:44px; flex:none; }
#player .controls .btns > [data-act="next"] { display:grid; width:44px; height:44px; min-width:44px; }
#player .playbtn svg { width:23px; height:23px; }
.home-section { margin:8px 0 24px; }
.track-shelf { display:grid; grid-auto-flow:column; grid-auto-columns:132px; gap:12px; overflow-x:auto; }
.track-card { min-width:0; }
.track-card > .track-title { display:-webkit-box; -webkit-box-orient:vertical; -webkit-line-clamp:2; max-width:100%; width:100%; margin:7px 0 0; padding:0; color:var(--text); font-size:14px; line-height:1.4; white-space:normal; overflow:hidden; overflow-wrap:anywhere; text-align:left; }
.track-card .track-artist { display:block; font-size:12px; line-height:1.4; }
.track-play, .track-more { opacity:1; transform:none; }
.playlist-shelf { display:grid; grid-template-columns:repeat(2,minmax(0,1fr)); grid-auto-columns:auto; gap:10px; }
.playlist-tile { min-width:0; }
.playlist-info b { font-size:13px; white-space:normal; line-height:1.35; }
.playlist-info span { font-size:11px; }
/* A single trailing menu leaves the desktop title/artist hierarchy room to breathe. */
.track-table-head { display:none; }
.pl-row, .frow.pl-row { display:grid; grid-template-columns:44px minmax(0,1fr) 40px; grid-template-rows:auto auto; align-items:center; min-height:72px; gap:2px 10px; width:100%; padding:8px 0; }
.pl-row > .n, .pl-row > .d { display:none; }
.pl-row > .cover { grid-column:1; grid-row:1 / span 2; width:44px; height:44px; border-radius:7px; }
.pl-row > .track-primary { grid-column:2; grid-row:1; align-self:end; min-width:0; }
.pl-row .track-primary b { display:-webkit-box; -webkit-box-orient:vertical; -webkit-line-clamp:2; font-size:14px; line-height:1.3; white-space:normal; overflow:hidden; overflow-wrap:anywhere; color:var(--text); }
.pl-row .track-primary > span { display:none; }
.pl-row > .track-artist { grid-column:2; grid-row:2; align-self:start; display:block; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:12px; }
.pl-row > .acts { grid-column:3; grid-row:1 / span 2; }
.trow, .qrow { display:grid; grid-template-columns:44px minmax(0,1fr) 40px; grid-template-rows:auto; align-items:center; width:100%; min-height:72px; gap:10px; padding:8px 0; }
.trow > .cover, .qrow > .cover { grid-column:1; width:44px; height:44px; flex:none; border-radius:7px; }
.trow > .tt, .qrow > .tt { grid-column:2; width:auto; min-width:0; padding:0; }
.trow .tt .track-title, .queue-title { display:-webkit-box; -webkit-box-orient:vertical; -webkit-line-clamp:2; font-size:14px; line-height:1.3; width:100%; height:auto; text-align:left; color:var(--text); white-space:normal; overflow:hidden; overflow-wrap:anywhere; margin:0; padding:0; }
:is(.trow,.qrow) .tt > span { display:block; font-size:12px; line-height:1.4; color:var(--muted); margin-top:3px; overflow:hidden; white-space:nowrap; text-overflow:ellipsis; }
.trow > .iconbtn:not([data-act="pl-menu"]), .qrow > :is(.num,.dur,.avatar,.wave-mark), .qrow > div:empty { display:none; }
.qrow:hover .tt, .qrow:focus-within .tt { padding-right:0; }
:is(.pl-row,.qrow) > .acts { display:flex; grid-column:3; position:static; inset:auto; width:40px; min-width:0; max-width:none; padding:0; border:0; background:none; box-shadow:none; opacity:1; pointer-events:auto; transform:none; }
:is(.pl-row,.qrow) .acts > :not([data-act="pl-menu"]) { display:none; }
:is(.pl-row,.qrow,.trow) [data-act="pl-menu"] { display:grid; width:40px; min-width:40px; height:48px; min-height:48px; }
:is(.pl-row,.qrow,.trow) [data-act="pl-menu"] svg { width:20px; height:20px; }
.artist-row { display:block; }
.artist-row > .n { display:none; }
.player-workspace { display:block; min-height:0; height:auto; overflow:hidden; border-radius:20px; }
.player-main-column { display:block; min-width:0; min-height:0; }
.player-main-column .listening-stage { display:block; min-height:0; padding:18px 14px 12px; }
/* Full player: artwork and title lead; secondary controls stay quiet. */
.mobile-stage-content { display:block; width:100%; }
.shell.view-player .app-header { display:none; }
.player-main-column .stage-empty { display:flex; flex-direction:column; align-items:center; text-align:center; gap:12px; }
.player-main-column .stage-art { width:136px; height:136px; aspect-ratio:1; margin:0 auto 14px; border-radius:12px; }
.stage-description { display:block; width:100%; padding:0; }
.stage-description .eyebrow { display:block; padding:0; font-size:9px; }
.stage-description h1 { display:-webkit-box; -webkit-box-orient:vertical; -webkit-line-clamp:3; max-height:3.6em; margin:6px 0 4px; padding:0; font-size:23px; line-height:1.2; white-space:normal; overflow:hidden; overflow-wrap:anywhere; }
.stage-description > p { margin:0; font-size:13px; line-height:1.5; }
.stage-timeline { display:flex; flex-direction:column; gap:7px; margin-top:14px; font-size:11px; }
.stage-timeline .seek-range { width:100%; height:5px; flex:none; }
.stage-times { display:flex; justify-content:space-between; }
.stage-transport { display:block; margin:0; }
.stage-controls { display:flex; justify-content:center; align-items:center; gap:28px; margin:6px 0; min-height:56px; }
.stage-controls .iconbtn { width:48px; min-width:48px; height:48px; }
.stage-controls .playbtn { width:56px; height:56px; flex:none; }
.mobile-player-actions { display:flex; justify-content:space-evenly; align-items:center; gap:10px; }
.mobile-player-actions .iconbtn { width:44px; height:44px; min-width:44px; }
.mobile-sound-settings { margin:4px 0 0; border-top:1px solid var(--edge-soft); }
.mobile-sound-settings summary { display:flex; align-items:center; justify-content:center; gap:7px; min-height:40px; font-size:12px; color:var(--muted); list-style:none; cursor:pointer; }
.mobile-sound-settings summary::-webkit-details-marker { display:none; }
.mobile-sound-settings summary .i { width:15px; height:15px; }
.mobile-sound-settings:not([open]) > .stage-sound { display:none; }
.stage-sound { display:flex; align-items:center; justify-content:center; margin:0 0 12px; gap:10px; }
.stage-sound .vol { width:120px; }
#player-context-host { display:none; }
.player-queue-host { display:block; min-height:0; overflow:visible; }
.player-queue-host .context-queue { flex:none; height:auto; padding:12px 8px; }
.player-queue-host .queue { flex:none; overflow:visible; height:auto; }
.player-queue-host .queue-head { display:grid; grid-template-columns:minmax(0,1fr) auto auto; gap:8px; }
.player-queue-host .player-queue-label { grid-column:1; grid-row:1; }
.player-queue-host #qcount { grid-column:2; grid-row:1; }
.player-queue-host #qclear { grid-column:3; grid-row:1; }
.player-queue-host #qwave { grid-column:1 / -1; grid-row:2; max-width:100%; }
.player-queue-host .queue-head .queue-tools { grid-column:1 / -1; grid-row:3; margin:0; }
.room-head { display:flex; flex-wrap:wrap; min-height:0; align-items:center; justify-content:space-between; gap:10px; padding:0 0 14px; }
.room-head > .nm { font-size:20px; }
.room-head .members { margin:0; }
.room-head .members .btn { min-height:36px; padding:8px 10px; font-size:11px; }
.room-heading { min-width:0; }
.room-heading .nm { font-size:22px; white-space:normal; overflow-wrap:anywhere; }
.room-actions { flex-wrap:wrap; gap:6px; }
.banner { display:flex; flex-wrap:wrap; align-items:flex-start; gap:10px; margin-bottom:16px; padding:14px; font-size:12px; line-height:1.5; }
.banner > .grow { flex:1 1 180px; min-width:0; }
.banner > .btn { margin:0; }
.wrapped-banner { display:grid; grid-template-columns:minmax(0,1fr) auto 32px; align-items:center; gap:8px; padding:12px; }
.wrapped-banner > svg, .wrapped-banner .grow > br { display:none; }
.wrapped-banner .grow { font-size:0; line-height:0; }
.wrapped-banner .grow b { font-size:12px; line-height:1.4; }
.wrapped-banner > .btn { min-height:36px; padding:8px 10px; font-size:11px; }
.wrapped-banner > .iconbtn { width:32px; min-width:32px; height:36px; min-height:36px; }
.player-view .wrapped-banner { display:none; }
#context { display:none; position:fixed; z-index:55; top:var(--mobile-header-height); left:8px; right:8px; bottom:calc(var(--mobile-nav-height) + 8px); width:auto; min-height:0; max-height:none; margin:0; border:1px solid var(--panel-line); border-radius:16px; background:var(--panel-bg); }
.shell.context-open #context { display:flex; flex-direction:column; opacity:1; visibility:visible; transform:none; }
.shell.context-open .context-scrim { display:block; position:fixed; z-index:54; inset:0; background:#0009; border-radius:0; backdrop-filter:none; }
.context-tabs { display:flex; align-items:center; min-height:48px; flex:none; padding:0 10px; gap:6px; overflow-x:auto; }
.context-tab { flex:none; min-width:0; min-height:44px; font-size:12px; }
.shell.view-player #tab-queue { display:none; }
.shell.view-player .context-tab.player-only { display:flex; }
.context-close { margin-left:auto; }
.context-body { flex:1 1 0; min-height:0; overflow:hidden; }
.context-queue, .context-favorites, .context-chat, .context-members { display:flex; flex-direction:column; height:100%; min-height:0; }
.context-favorites, .context-members { overflow-y:auto; }
.context-chat > .panel { display:flex; flex-direction:column; flex:1; min-height:0; }
.queue-head { display:flex; flex-wrap:wrap; gap:10px; padding:12px 0; }
.queue-head .queue-tools { flex:1 1 100%; width:100%; max-width:none; }
.queue, .context-chat .chat { flex:1 1 0; min-height:0; overflow-y:auto; }
.context-chat .chat-input { flex:none; display:flex; width:100%; min-width:0; gap:6px; padding:10px 0; }
.context-chat .chat-input textarea { flex:1; min-width:0; }
.context-chat .msg .bub { max-width:calc(100% - 44px); overflow-wrap:anywhere; }
.queue-page #queue-host #context { display:flex; position:static; width:100%; height:100%; border:0; transform:none; visibility:visible; opacity:1; }
.main > .view.queue-page { display:flex; flex-direction:column; }
.queue-page #queue-host { flex:1 1 0; min-height:0; }
.queue-page #context { flex-direction:column; }
.queue-page .context-tabs { display:none; }
#pl-menu { width:min(320px,calc(100vw - 24px)); max-height:calc(100dvh - 100px); overflow-y:auto; }
#pl-menu .track-menu-title { white-space:normal; overflow-wrap:anywhere; }
#pl-menu button { min-height:44px; }
.toasts { left:12px; right:12px; bottom:calc(var(--mobile-nav-height) + var(--mobile-dock-height) + 10px); width:auto; }
body:has(.shell.context-open) .toasts { top:4px; bottom:auto; pointer-events:none; }
body:has(.shell.context-open) .toasts button { pointer-events:auto; }
body.player-page .toasts { bottom:calc(var(--mobile-nav-height) + 10px); }
.toast { font-size:12px; }
@media (max-width:359px) {
  .primary-nav .nav { font-size:10px; }
  .player-main-column .stage-art { width:96px; height:96px; margin-bottom:10px; }
  .stage-description h1 { font-size:21px; }
  .stage-controls { gap:22px; }
}

/* One persistent entry to playback on every browsing screen. */
#player { position:relative; background:var(--panel-raised); border:1px solid var(--edge-soft); }
.mobile-now-playing { display:flex; align-items:center; gap:9px; width:100%; min-width:0; height:48px; text-align:left; border-radius:8px; }
.mobile-now-playing > .cover { display:block; width:40px; height:40px; flex:none; border-radius:7px; background:center/cover; }
.mobile-now-playing .tt { flex:1; min-width:0; }
#player .mobile-now-playing b { display:block; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; font-size:14px; font-weight:650; line-height:1.4; }
#player .mobile-now-playing .tt > span { display:block; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; margin-top:3px; font-size:11px; color:var(--muted); }
.mobile-mini-controls { display:flex; align-items:center; gap:0; }
.mobile-mini-controls .playbtn, .mobile-mini-controls .iconbtn { display:grid; width:44px; min-width:44px; height:44px; }
.primary-nav .nav { font-size:11px; }
.mobile-home-heading { margin:0 0 18px; }
.mobile-home-heading .h1 { font-size:28px; margin:0 0 4px; }
.mobile-home-heading .sub { font-size:12px; }
.flow-discovery { position:relative; display:grid; grid-template-columns:minmax(0,1fr) 56px; align-items:center; gap:8px 16px; padding:18px; border-radius:18px; margin-bottom:24px; background:radial-gradient(ellipse at 90% 20%,rgba(var(--c1),.19),transparent 75%),var(--panel-bg); border:1px solid var(--edge-soft); }
.flow-discovery-copy { position:relative; padding-left:0; }
.flow-discovery-symbol { position:absolute; top:0; right:8px; opacity:.35; }
.flow-discovery-symbol .flow-icon { width:60px; height:32px; }
.flow-discovery h2 { margin:0 0 6px; font-size:24px; letter-spacing:-.04em; }
.flow-discovery p { margin:0; color:var(--muted); font-size:13px; line-height:1.5; }
.flow-discovery > .playbtn { width:56px; height:56px; }
.flow-discovery > .text-link { grid-column:1 / -1; justify-self:start; display:flex; min-height:30px; align-items:center; gap:4px; margin:0; font-size:12px; }
.mobile-home .track-shelf { grid-auto-columns:112px; }
.mobile-home .track-card .track-art { height:112px; aspect-ratio:1; border-radius:10px; }
.mobile-home .track-card .track-title { font-size:13px; }
.mobile-home .home-section { margin-bottom:28px; }
.mobile-home .playlist-tile { width:144px; height:132px; min-height:132px; }
.mobile-home .playlist-shelf { grid-template-columns:none; grid-auto-flow:column; grid-auto-columns:144px; gap:12px; overflow-x:auto; }
.mobile-home .section-heading { margin-bottom:12px; }
.mobile-home .section-heading h2 { font-size:18px; }
.mobile-home .section-heading .text-link { font-size:11px; }
.mobile-friends-link, .mobile-room-shortcut { display:flex; align-items:center; gap:12px; width:100%; min-height:64px; margin-bottom:18px; padding:12px; border:1px solid var(--edge-soft); border-radius:12px; text-align:left; }
:is(.mobile-friends-link,.mobile-room-shortcut) > span { min-width:0; flex:1; }
:is(.mobile-friends-link,.mobile-room-shortcut) b { display:block; font-size:14px; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
:is(.mobile-friends-link,.mobile-room-shortcut) small { display:block; color:var(--muted); font-size:11px; margin-top:3px; }
.mobile-room-shortcut small { margin:0 0 3px; }
.mobile-home #banner:empty { display:none; }
.mobile-home .wrapped-banner { margin-top:24px; }
.player-view .room-head { flex-wrap:nowrap; gap:10px; padding:0 0 14px; }
.mobile-player-context { flex:1; min-width:0; }
.mobile-player-context small { display:block; font-size:10px; color:var(--muted); margin-bottom:3px; }
.mobile-player-context b { display:block; font-size:16px; overflow:hidden; text-overflow:ellipsis; white-space:nowrap; }
.player-workspace { background:var(--panel-bg); border-color:var(--edge-soft); }
.listening-ribbons { opacity:.12; }
.mobile-listening-tabs { display:flex; align-items:center; gap:4px; padding:8px; border-top:1px solid var(--edge-soft); }
.mobile-listening-tabs > button { display:flex; flex:1; min-width:0; min-height:44px; align-items:center; justify-content:center; gap:6px; font-size:12px; color:var(--text); background:rgba(var(--c1),.06); border-radius:8px; }
.mobile-listening-tabs .i { width:17px; height:17px; }
.shell.view-player #tab-favorites { display:none; }
.context-tab .tab-long { display:none; }
#tab-members .tab-short { font-size:0; }
#tab-members .tab-short::after { content:'Участники'; font-size:12px; }
.context-tab .i { width:17px; height:17px; }
.mobile-search-back { display:flex; align-items:center; gap:5px; min-height:40px; margin:0 0 8px; font-size:13px; }
.mobile-room-actions { display:flex; flex-wrap:wrap; gap:8px; margin:0 0 22px; }
.mobile-room-actions .btn { flex:1 1 120px; white-space:nowrap; padding:10px; font-size:12px; }
.mobile-room-actions > .sub { flex:1 1 100%; margin:0; font-size:11px; }
.mobile-room-tools { display:flex; flex-wrap:wrap; gap:8px; margin:0 0 20px; }
.mobile-room-tools > div:first-child { flex:1 1 100%; }
.mobile-room-tools b { display:block; font-size:18px; margin-bottom:5px; }
.mobile-room-tools span { font-size:12px; color:var(--muted); }
.mobile-room-tools .btn { min-height:40px; font-size:12px; }
.mobile-room-tools details { width:100%; margin-top:6px; }
.mobile-room-tools summary { padding:10px 0; font-size:12px; color:var(--muted); }
.mobile-room-tools .row { flex-wrap:wrap; gap:8px; }
.mobile-track-access { display:block; font-size:11px; line-height:1.3; margin-top:3px; color:var(--text); }
.mobile-track-connection { margin-top:12px; padding:10px; border-radius:10px; background:rgba(var(--c1),.09); font-size:12px; line-height:1.4; }
.mobile-track-connection > span { display:flex; align-items:center; gap:7px; }
.mobile-track-connection .text-link { display:block; min-height:36px; margin-top:4px; font-size:12px; }
.mobile-track-connection .i { width:18px; height:18px; flex:none; }
@media (max-width:359px) {
  .primary-nav .nav { font-size:10px; }
  .flow-discovery { padding:16px; }
  .flow-discovery h2 { font-size:23px; }
  .flow-discovery-symbol { display:none; }
  .mobile-home .section-heading .text-link { max-width:120px; }
}
.stage-description h1.is-expanded { display:block; max-height:none; }
.mobile-title-expand { display:block; min-height:32px; margin:0 0 3px; font-size:11px; color:var(--muted); }

/* Keep the desktop components and visual theme; reflow their page content for a phone. */
.page-heading { align-items:flex-start; flex-wrap:wrap; gap:14px; margin-bottom:20px; }
.page-heading > div, .section-heading > div { min-width:0; }
.page-heading .h1 { font-size:26px; line-height:1.2; overflow-wrap:anywhere; }
.page-heading .sub { font-size:13px; line-height:1.55; }
.section-heading { gap:12px; flex-wrap:wrap; }
.section-heading h2 { font-size:19px; }
.page-tabs, .preferences-content .page-tabs { display:flex; flex-wrap:nowrap; gap:6px; margin:16px 0 0; padding-bottom:16px; max-width:100%; overflow-x:auto; }
.page-tabs > button { flex:none; min-height:42px; padding:8px 13px; font-size:13px; }
.back { display:inline-flex; align-items:center; min-height:40px; margin-bottom:12px; }

/* Rooms retain the two desktop entry cards followed by the room directory. */
.room-entry-grid { grid-template-columns:minmax(0,1fr); gap:12px; margin:20px 0 26px; }
.room-entry-card { display:grid; grid-template-columns:40px minmax(0,1fr); gap:8px 12px; padding:18px; }
.room-entry-icon { width:40px; height:40px; margin:0; }
.room-entry-icon svg { width:22px; height:22px; }
.room-entry-text { min-width:0; }
.room-entry-card h2 { font-size:18px; margin-bottom:6px; }
.room-entry-card p { min-height:0; margin-bottom:6px; font-size:12px; line-height:1.6; }
.room-entry-card > .btn, .room-entry-card > .field { grid-column:2; }
.room-entry-card > .btn { min-height:42px; }
.room-grid, .rooms, .public-room-grid { display:grid; grid-template-columns:minmax(0,1fr); gap:12px; }
.room-tile { min-height:142px; padding:16px; }
.room-tile .info, .room-tile .t, .room-tile .m { display:block; }
.public-room { gap:10px; padding:12px; }
.public-room-art { width:44px; height:44px; }
.public-room-info { min-width:0; }
.public-room-info h3 { white-space:normal; overflow-wrap:anywhere; line-height:1.35; }
.public-room-info > span { line-height:1.45; }
.public-room > .btn { min-width:62px; min-height:42px; padding:9px 10px; font-size:12px; }
.room-directory-note { font-size:12px; line-height:1.5; }

/* The desktop catalogue becomes two columns, with its controls in document order. */
.catalog-toolbar { display:flex; flex-wrap:wrap; gap:10px; margin-bottom:16px; }
.catalog-toolbar .inline-search { flex:1 1 100%; min-width:0; height:42px; }
.inline-search input { font-size:14px; }
.catalog-toolbar > select.field { flex:1 1 150px; min-width:0; max-width:100%; min-height:42px; font-size:13px; }
.pl-code { flex:1 1 140px; min-width:0; gap:6px; }
.pl-code .field { flex:1; width:0; min-width:60px; min-height:42px; font-size:14px; }
.pl-code .btn { min-height:42px; }
.catalog-grid, .pl-grid { grid-template-columns:repeat(2,minmax(0,1fr)); gap:12px; margin-top:16px; }
.catalog-grid .playlist-info b { font-size:14px; line-height:1.35; white-space:normal; overflow-wrap:anywhere; }
.catalog-grid .playlist-info span { font-size:11px; line-height:1.5; }
.catalog-grid .playlist-tile { min-width:0; }
.playlist-detail .pl-head, .likes-detail .pl-head { gap:14px; align-items:flex-start; flex-wrap:nowrap; padding-bottom:20px; margin-bottom:18px; }
.pl-head > #pl-cover, .pl-head > .likes-art { flex:none; }
.pl-head .mosaic.big, .likes-detail .likes-art { width:82px; height:82px; border-radius:12px; }
.pl-head .grow { min-width:0; }
.pl-title { display:block; width:100%; min-width:0; max-width:100%; font-size:25px; line-height:1.2; overflow-wrap:anywhere; }
input.pl-title { padding:2px 0; }
.pl-head .row { flex-wrap:wrap; gap:7px; margin-top:12px; }
.pl-head .row .btn { min-height:42px; height:auto; padding:9px 12px; font-size:12px; }
.pl-head .row .btn svg { width:17px; height:17px; }
.pl-head .code-pill { min-height:40px; }
.pl-head .sub { line-height:1.5; }
.pl-import .row, #pl-import .row { flex-wrap:wrap; gap:8px; }
#pl-import input { width:100%; min-width:0; }
.playlist-add-area, .playlist-add-area > .searchbox { width:100%; max-width:none; min-width:0; }
.playlist-add-area .searchbox input { min-width:0; }

.artist-header { flex-direction:row; align-items:center; gap:16px; margin-bottom:24px; }
.artist-header .artist-art { width:88px; height:88px; }
.artist-header .h1 { font-size:25px; line-height:1.2; }
.artist-header .sub { font-size:12px; line-height:1.5; }
.artist-actions { gap:8px; margin-top:12px; }
.artist-actions .btn { min-height:42px; font-size:12px; padding:9px 12px; }
.artist-cards { grid-template-columns:repeat(2,minmax(0,1fr)); gap:10px; }

/* Account navigation stays within the page; the application account tab stays below. */
.mobile-account-tabs { display:flex; align-items:center; gap:6px; padding:0 0 18px; }
.mobile-account-tabs > button { display:flex; align-items:center; justify-content:center; gap:7px; min-height:44px; padding:0 12px; border-radius:12px; font-size:13px; color:var(--muted); }
.mobile-account-tabs > button[aria-current="page"] { background:rgba(var(--c1),.12); color:var(--text); }
.mobile-account-tabs .mobile-account-logout { margin-left:auto; flex:none; width:44px; padding:0; }
.mobile-account-tabs .i { width:18px; height:18px; flex:none; }
.mobile-yandex-account { display:grid; grid-template-columns:36px minmax(0,1fr); gap:10px 12px; align-items:start; margin:0 0 20px; padding:14px; border-radius:16px; background:rgba(var(--c1),.07); }
.mobile-yandex-symbol { display:grid; place-items:center; width:36px; height:36px; border-radius:10px; background:#fc3; color:#13151b; font-size:22px; font-weight:800; }
.mobile-yandex-account h2 { font-size:14px; line-height:1.4; margin:0 0 4px; }
.mobile-yandex-account p { margin:0; color:var(--muted); font-size:12px; line-height:1.55; overflow-wrap:anywhere; }
.mobile-yandex-account > .btn { grid-column:2; justify-self:start; min-height:42px; }
.profile-page.account-layout .profile-layout { display:flex; flex-direction:column; gap:14px; width:100%; }
.profile-page.account-layout .profile-identity { width:100%; padding:18px 16px 14px; }
.profile-page.account-layout .profile-editor { display:contents; min-height:0; }
.profile-page.account-layout .profile-tabs { display:flex; flex-direction:row; width:100%; gap:4px; padding:5px; overflow-x:auto; }
.profile-page.account-layout .profile-tabs > button { flex:1 0 auto; width:auto; min-width:0; justify-content:center; min-height:44px; padding:8px; gap:5px; font-size:12px; }
.profile-page .profile-tabs > button svg { width:17px; height:17px; }
.profile-page.account-layout .profile-panel { width:100%; max-width:none; padding:18px 16px; }
.profile-page .profile-form { gap:16px; }
.profile-page .profile-field .field { font-size:15px; height:44px; }
.profile-page .profile-input-wrap.is-textarea .field { min-height:88px; height:auto; }
.profile-form-footer, .appearance-save-footer { flex-wrap:wrap; align-items:stretch; gap:12px; }
.profile-form-actions, .appearance-save-footer .profile-form-actions { display:flex; flex-wrap:wrap; gap:8px; width:100%; margin-left:0; min-width:0; }
.profile-form-actions .btn { flex:1 1 115px; min-width:0; min-height:44px; white-space:normal; }
.profile-section-heading p { font-size:12px; line-height:1.6; }
.session-row { gap:10px; }
.session-row .txt { flex:1 1 150px; }
.profile-discord-row { gap:10px; }

/* Settings use the original cards in one scrollable column. */
.settings, .settings-page .settings, .preferences-content .settings { display:flex; flex-direction:column; width:100%; max-width:none; margin:0; gap:14px; }
.settings-pane { width:100%; min-width:0; gap:14px; }
.settings-pane .card, .preferences-content .card { padding:16px; }
.settings-pane .themes, .preferences-content .themes { grid-template-columns:repeat(2,minmax(0,1fr)); gap:10px; }
.settings-pane .theme .sw { height:52px; }
.settings-pane .theme b { font-size:12px; }
.settings-pane .theme span { font-size:11px; line-height:1.4; }
.set-row { flex-wrap:wrap; gap:12px; }
.set-row .txt { flex:1 1 160px; min-width:0; }
.settings-pane .set-row .txt b, .preferences-content .set-row b { font-size:14px; }
.set-row .txt span { font-size:12px; line-height:1.55; }
.settings-pane .services { grid-template-columns:minmax(0,1fr); gap:10px; }
.settings-pane .service { display:flex; align-items:flex-start; flex-wrap:wrap; padding:12px; gap:10px; }
.settings-pane .service .txt, .preferences-content .service .txt { flex:1 1 145px; min-width:0; }
.settings-pane .service .txt b { font-size:13px; }
.settings-pane .service .txt span { font-size:12px; line-height:1.5; }
.settings-pane .service .btn { margin-left:49px; min-height:42px; }
.crossfade-options { flex-wrap:wrap; min-width:0; gap:10px; }
.crossfade-options > span { min-width:0; overflow-wrap:anywhere; }

/* Both Premium presentations preserve their desktop content order. */
.premium-hero { display:block; padding:4px 0 8px; }
.premium-intro h1 { white-space:normal; font-size:clamp(27px,8vw,36px); line-height:1.2; }
.premium-tagline { font-size:14px; line-height:1.5; }
.premium-lead { font-size:12px; }
.premium-comparison { grid-template-columns:minmax(0,1fr); gap:18px; }
.premium-plan { padding:20px 16px 16px; }
.premium-plan-title { flex-wrap:wrap; gap:8px; }
.premium-plan-heading h2 { font-size:28px; }
.premium-plan dl { min-height:245px; }
.premium-plan-row { padding:8px 0; }
.premium-plan-row dt, .premium-plan-row dd { font-size:12px; }
.premium-highlights { grid-template-columns:minmax(0,1fr); gap:18px; padding:18px; }
.premium-highlights > div { padding:0; }
.premium-highlights > div + div { border-left:0; }
.premium-highlights b, .premium-highlights small { white-space:normal; font-size:12px; }
.premium-howto { padding:16px; overflow-wrap:anywhere; }
.premium-gift-form { flex-wrap:wrap; }
.premium-gift-form .field { flex:1 1 150px; }
.profile-premium-page .profile-layout { min-height:0; }
.profile-premium-page .profile-editor { padding:16px; min-height:0; }
.profile-premium-page .profile-tabs { display:flex; flex-wrap:nowrap; overflow-x:auto; }
.profile-premium-page .profile-tabs button { flex:none; min-height:44px; padding:8px 10px; }
.profile-premium-page .profile-panel { padding:16px 0 0; }
.appearance-settings-grid, .profile-track-controls { grid-template-columns:minmax(0,1fr); gap:20px; }
.appearance-control-grid { grid-template-columns:minmax(0,1fr); align-items:start; gap:12px; }
.appearance-control-grid > label { display:flex; flex-direction:column; align-items:stretch; gap:7px; }
.appearance-colors { flex-wrap:wrap; }
.appearance-select { grid-template-columns:minmax(0,1fr); gap:7px; }
.appearance-inline small, .appearance-help { display:block; }
.premium-editor .appearance-style-section > h3 { display:block; }
.premium-editor .field { min-height:42px; height:auto; font-size:14px; }
.appearance-save-footer .btn { min-height:44px; }
.profile-track-search, .profile-track-search form { width:100%; min-width:0; }
.profile-track-search input { flex:1; min-width:0; }
.profile-track-results { width:100%; max-width:100%; }
.pm.pm-v2 .pm-v2-grid { grid-template-columns:minmax(0,1fr); }
.pm.pm-v2 .pm-v2-aside { position:static; order:0; }
.pm .pm-row { padding:16px 12px; }
.pm .pm-card-head { flex-wrap:wrap; }
.pm.pm-v2 .pm-names, .pm .pm-names { grid-template-columns:repeat(2,minmax(0,1fr)); }
.pm .pm-tiles:not(.pm-msgs) { grid-template-columns:repeat(3,minmax(0,1fr)); }
.pm .pm-msgs { grid-template-columns:minmax(0,1fr); }
.pm .pm-name-sample { font-size:13px; max-width:100%; overflow:hidden; text-overflow:ellipsis; }
.pm .pm-save { position:static; }

.admin-page .row { flex-wrap:wrap; gap:10px; }
.admin-page .row .field { min-width:0; flex:1 1 150px; }
.admin-page .admin-box { padding:16px; }
.admin-page .admin-room { flex-wrap:wrap; gap:10px; padding:12px; }
.admin-page .admin-room .grow { min-width:0; flex:1 1 150px; }
.admin-page .admin-room-acts { flex-wrap:wrap; gap:6px; }
.admin-row { flex-wrap:wrap; }
.admin-row .grow { flex:1 1 130px; overflow-wrap:anywhere; }
.admin-hint, .admin-reset { overflow-wrap:anywhere; line-height:1.55; }

.auth { height:100%; overflow-y:auto; padding:24px 18px; }
.auth-box { width:min(100%,430px); margin:auto; }
.auth-box .logo { font-size:60px; }
.auth-box .card { padding:20px; }
.auth-box .field, .auth-box .btn { min-height:46px; font-size:15px; }
.modal-bg { padding:14px; }
.modal { width:min(100%,520px); max-height:calc(100dvh - 28px); overflow-y:auto; padding:20px; }
.modal .row { flex-wrap:wrap; }
.modal .field { max-width:100%; min-width:0; }
.public-profile-dialog { max-height:calc(100dvh - 28px); }

@media (min-width:600px) {
  .room-entry-grid, .room-grid { grid-template-columns:repeat(2,minmax(0,1fr)); }
  .catalog-grid, .pl-grid { grid-template-columns:repeat(3,minmax(0,1fr)); }
  .premium-comparison { grid-template-columns:repeat(2,minmax(0,1fr)); }
}

}